0
Write the structure of linolenic acid why is it an unsaturated fatty acid?
Wiki User
∙ 10y ago
ch3ch2ch=chch2ch=chch2ch=ch(ch2)6cooh
It's an unsaturated fatty acids because it has double bonds
Wiki User
∙ 10y ago
Add your answer:
Earn +20 pts
What type of fatty acid has a bend in its structure?
unsaturated
Why is linolenic acid an unsaturated fatty acid?
Because fats are having double bond and triple bonds so they are known as unsaturated fatty acids.
Why do saturated fatty acid have straight structures while unsaturated fatty acid structure bend?
The bent structure in unsaturated fatty acids arises due to the presence of the double bonds.
What are the differences between the structures of saturated and unsaturated fatty acids?
The chemical structure of a saturated fat is fully saturated with hydrogen atoms, and does not contain double bonds between carbon atoms. Unsaturated fats, on the other hand, are found foods such as nuts, avocados, and olives. They are liquid at room temperature and differ from saturated fats in that their chemical structure contains double bonds.
Why are they called omega-3 fatty acids?
The name "Omega-3" indicates that the first double bond occurs on the third carbon atom from the end of the molecule or last position (i.e. the omega position, the last letter in Greek alphabet)To find the place of the double bond, you would count to the third carbon atom from the 'end' carbon atom of the alkenoic acid (the unsaturated fatty acid). More complex unsaturated acid names would include, for example,Omega-3,6,9-Octadecatrienoic acid (linolenic acid)(see related link to a structural formula diagram of omega or alpha numbering of unsaturated fatty acids)
What type of fatty acid has a bend in its structure?
unsaturated
Why is linolenic acid an unsaturated fatty acid?
Because fats are having double bond and triple bonds so they are known as unsaturated fatty acids.
Why do saturated fatty acid have straight structures while unsaturated fatty acid structure bend?
The bent structure in unsaturated fatty acids arises due to the presence of the double bonds.
What are the similarities between the structures of linoleic and linolenic acids?
Both linoleic and linolenic acids are unsaturated fatty acids with 18 carbon atoms and a COOH group in each molecule. They are both biologically important as the body cannot synthesize them.
What structure in the membrane causes plasma membranes to resist freezing?
Unsaturated fatty acids tails.
What are unsaturated fatty acids?
Unsaturated fatty acids are fatty acids that have double bonds in their long carbon chains.
What is linoleic acid?
Gamma-linoleic acid (GLA) is an omega-6 polyunsaturated fatty acid made in the body from linolenic acid, an essential fatty acid (EFA).
How do unsaturated fatty acids in the glycerophospholipids affect the structure of the Cell Membrane?
Because of the kinks in the carbon chains at the cis double bonds of unsaturated fatty acids, the glycerophospholipids do not fit closely together. As a result, the lipid bilayer is not a rigid, fixed structure, but one that is dynamic and fluid like.
What causes an unsaturated fatty to have a different shape than a saturated fatty acid?
unsaturated fatty acids have a double carbon bonds APEX
What causes an unsaturated fatty acid to have a different shape than an a saturated fatty acid?
Unsaturated fatty acids have double carbon bonds.
Which type of fatty acid is naturally found in fish oils and is considered to be good for you?
Fish oil contains omega- fatty acids which is an unsaturated fatty acid containing alpha linolenic acid,eicosapentaenoic acid,docosahexaenoic acid which are nutritionally important for brain health,cardiovascular disease prevention, immune function and cancer prevention.
What are the differences between the structures of saturated and unsaturated fatty acids?
The chemical structure of a saturated fat is fully saturated with hydrogen atoms, and does not contain double bonds between carbon atoms. Unsaturated fats, on the other hand, are found foods such as nuts, avocados, and olives. They are liquid at room temperature and differ from saturated fats in that their chemical structure contains double bonds.
