0
What else can I help you with?
What is the periodic symbol of the element cobalt?
Co
What is the significance of the keyword "co co 4" in the context of the experiment?
The keyword "co co 4" is significant in the experiment because it represents a specific compound or element that is being studied or analyzed. Its presence or behavior can provide important insights into the results and conclusions of the experiment.
How many pi bonds are present in C6H6?
There are 3 pi bonds present in benzene (C6H6), which is a cyclic compound with alternating single and double bonds between carbon atoms.
What is a chemical formula for 4 carbon monoxide?
The chemical formula for carbon monoxide is CO. Therefore, the chemical formula for 4 molecules of carbon monoxide would be 4CO.
What is the oxidation number of ferrocyanide?
The oxidation number of iron in ferrocyanide is +2, as each cyanide ligand has a -1 charge. Therefore, since there are four cyanide ligands, they contribute a total charge of -4, balancing the +2 charge of the iron atom.
How many electrons does the complex have using 18 electron rule Cr(n5-C5H5)(CO)2(PPh3)?
To determine the number of electrons in the complex Cr(n5-C5H5)(CO)2(PPh3), we can apply the 18-electron rule. Chromium (Cr) in the zero oxidation state contributes 6 electrons. Each CO ligand donates 2 electrons (total of 4 from 2 CO), and the PPh3 ligand contributes 2 electrons. The n5-C5H5 (cyclopentadienyl) ligand donates 5 electrons. Thus, the total electron count is 6 (Cr) + 4 (from CO) + 2 (from PPh3) + 5 (from n5-C5H5) = 17 electrons.
What is the reciprocal of 4 - pi?
pi-4 is the opposite and 1/4-pi is the reciprocal
What is the exact value using a sum or difference formula of the expression cos 11pi over 12?
11pi/12 = pi - pi/12 cos(11pi/12) = cos(pi - pi/12) cos(a-b) = cos(a)cos(b)+sin(a)sin(b) cos(pi -pi/12) = cos(pi)cos(pi/12) + sin(pi)sin(pi/12) sin(pi)=0 cos(pi)=-1 Therefore, cos(pi -pi/12) = -cos(pi/12) pi/12=pi/3 -pi/4 cos(pi/12) = cos(pi/3 - pi/4) = cos(pi/3)cos(pi/4)+sin(pi/3) sin(pi/4) cos(pi/3)=1/2 sin(pi/3)=sqrt(3)/2 cos(pi/4)= sqrt(2)/2 sin(pi/4) = sqrt(2)/2 cos(pi/3)cos(pi/4)+sin(pi/3) sin(pi/4) = (1/2)(sqrt(2)/2 ) + (sqrt(3)/2)( sqrt(2)/2) = sqrt(2)/4 + sqrt(6) /4 = [sqrt(2)+sqrt(6)] /4 Therefore, cos(pi/12) = (sqrt(2)+sqrt(6))/4 -cos(pi/12) = -(sqrt(2)+sqrt(6))/4 cos(11pi/12) = -(sqrt(2)+sqrt(6))/4
How do you find the height of a cylinder if the surface area is 312 inches and the radius is 2 inches?
Entire surface area = (2*pi*4)+(4*pi*height) = 312 (4*pi*height) = 312-(2*pi*4) (4*pi*height) = 286.8672588 Divide both sides by 4*pi to find the height:- height = 22,82817112 inches Check: (2*pi*4)+(4*pi*22.82817112) = 312 square inches Formula: (2*pi*radius2)+(diameter*pi*height) = area
What is the exact value of the expression cos 7pi over 12 cos pi over 6 -sin 7pi over 12 sin pi over 6?
cos(a)cos(b)-sin(a)sin(b)=cos(a+b) a=7pi/12 and b=pi/6 a+b = 7pi/12 + pi/6 = 7pi/12 + 2pi/12 = 9pi/12 We want to find cos(9pi/12) cos(9pi/12) = cos(3pi/4) cos(3pi/4)= cos(pi-pi/4) cos(pi)cos(pi/4)-sin(pi)sin(pi/4) cos(pi)=-1 sin(pi)=0 cos(pi/4) = √2/2 sin(pi/4) =√2/2 cos(pi)cos(pi/4)-sin(pi)sin(pi/4) = - cos(pi/4) = -√2/2
What is the piston area of a cylinder bore of 2 inches?
Area = (Pi/4)*(dia2) = (Pi/4)*22 = (Pi/4)*4 = Pi sq.in = 3.1416 square inches.
What are the distinct fourth root of -1?
The four roots are cos(theta)+i*sin(theta) where theta = pi/4, 3*pi/4, 5*pi/4 and 7*pi/4.
What is the formula of pi?
4-(4/3)+(4/5)-(4/7)+(4/9)-(4/11)....=pi There are no non-infinite serieses known for finding pi
What is Tan pi over 4?
tangent of pi/4 = 1
Will the sum of two irrational numbers always be rational?
Consider pi and 4 - pi. 4 - pi + pi = 4, which is clearly rational. However, both pi and 4 - pi are irrational, as you can verify. plz to be lerning numburs Then consider pi + pi = 2pi, which is clearly irrational. The sum of two irrational numbers, therefore, may or may not be rational.
What is the ratio of the surface area of the sphere to its volume?
The surface area of a sphere with radius 'R' is 4(pi)R2 The volume of the same sphere is (4/3)(pi)R3 . Their ratio is (4 pi R2)/(4/3 pi R3) = (12 pi R2)/(4 pi R3) = 3/R
What is the formula for finding surface area of a sphere?
4 πr2π is pi... Also it is 4(pi(r^2))
