0
The CO ligand can easily back-bond, accepting electron density from the metal centre through pi bonds.
This is because of the empty anti-bonding orbitals.
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
Why CoCl4 -2 shows blue colour?
1. metal to ligand charge transfer transition 2. ligand to metal charge transfer transition 3. spin allowed and Laporte forbidden d-d transition 4. spin allowed and Laporte allowed d-d transition
How many pi bonds are present in C6H6?
4
What is the periodic symbol of the element cobalt?
Co
How many pi bonds are present in caffeine?
Epinephrine or also known as adrenaline contains 6 pi bonds. Epinephrine is a naturally occurring hormone that is also commercially manufactured for use as heart stimulant.
A uniform lead sphere and a uniform aluminium sphere have the same mass what is the ratio of the radius of aluminium sphere to the radius of the lead sphere?
d=m/v v= (4/3)(pi)(r^3) set up equation for aluminum and lead 11.3*10^3=m/( (4/3)(pi)(ri^3)) 2.7*10^3=m/( (4/3)(pi)(ra^3)) solve for m. then set two equations equal to each other, since they have the same masses. finally, solve your new equations for ra/ri 11.3*10^3( (4/3)(pi)(ri^3)) =m 2.7*10^3( (4/3)(pi)(ra^3)) =m 11.3*10^3( (4/3)(pi)(ri^3)) = 2.7*10^3( (4/3)(pi)(ra^3)) 11.3*10^3/2.7*10^3 = (ra^3)/(ri^3) (11.3*10^3/2.7*10^3)^(1/3)=ra/ri
What is the reciprocal of 4 - pi?
pi-4 is the opposite and 1/4-pi is the reciprocal
What is the exact value using a sum or difference formula of the expression cos 11pi over 12?
11pi/12 = pi - pi/12 cos(11pi/12) = cos(pi - pi/12) cos(a-b) = cos(a)cos(b)+sin(a)sin(b) cos(pi -pi/12) = cos(pi)cos(pi/12) + sin(pi)sin(pi/12) sin(pi)=0 cos(pi)=-1 Therefore, cos(pi -pi/12) = -cos(pi/12) pi/12=pi/3 -pi/4 cos(pi/12) = cos(pi/3 - pi/4) = cos(pi/3)cos(pi/4)+sin(pi/3) sin(pi/4) cos(pi/3)=1/2 sin(pi/3)=sqrt(3)/2 cos(pi/4)= sqrt(2)/2 sin(pi/4) = sqrt(2)/2 cos(pi/3)cos(pi/4)+sin(pi/3) sin(pi/4) = (1/2)(sqrt(2)/2 ) + (sqrt(3)/2)( sqrt(2)/2) = sqrt(2)/4 + sqrt(6) /4 = [sqrt(2)+sqrt(6)] /4 Therefore, cos(pi/12) = (sqrt(2)+sqrt(6))/4 -cos(pi/12) = -(sqrt(2)+sqrt(6))/4 cos(11pi/12) = -(sqrt(2)+sqrt(6))/4
How do you find the height of a cylinder if the surface area is 312 inches and the radius is 2 inches?
Entire surface area = (2*pi*4)+(4*pi*height) = 312 (4*pi*height) = 312-(2*pi*4) (4*pi*height) = 286.8672588 Divide both sides by 4*pi to find the height:- height = 22,82817112 inches Check: (2*pi*4)+(4*pi*22.82817112) = 312 square inches Formula: (2*pi*radius2)+(diameter*pi*height) = area
What is the exact value of the expression cos 7pi over 12 cos pi over 6 -sin 7pi over 12 sin pi over 6?
cos(a)cos(b)-sin(a)sin(b)=cos(a+b) a=7pi/12 and b=pi/6 a+b = 7pi/12 + pi/6 = 7pi/12 + 2pi/12 = 9pi/12 We want to find cos(9pi/12) cos(9pi/12) = cos(3pi/4) cos(3pi/4)= cos(pi-pi/4) cos(pi)cos(pi/4)-sin(pi)sin(pi/4) cos(pi)=-1 sin(pi)=0 cos(pi/4) = √2/2 sin(pi/4) =√2/2 cos(pi)cos(pi/4)-sin(pi)sin(pi/4) = - cos(pi/4) = -√2/2
What is the piston area of a cylinder bore of 2 inches?
Area = (Pi/4)*(dia2) = (Pi/4)*22 = (Pi/4)*4 = Pi sq.in = 3.1416 square inches.
What are the distinct fourth root of -1?
The four roots are cos(theta)+i*sin(theta) where theta = pi/4, 3*pi/4, 5*pi/4 and 7*pi/4.
What is the formula of pi?
4-(4/3)+(4/5)-(4/7)+(4/9)-(4/11)....=pi There are no non-infinite serieses known for finding pi
Hydrogen bond length will NOT be 1 independent of the nature of donor and acceptor atoms 2 dependent on donor and acceptor atoms 3 dependent on the solvent in which the molecule is dissolved 4?
1
What is Tan pi over 4?
tangent of pi/4 = 1
Will the sum of two irrational numbers always be rational?
Consider pi and 4 - pi. 4 - pi + pi = 4, which is clearly rational. However, both pi and 4 - pi are irrational, as you can verify. plz to be lerning numburs Then consider pi + pi = 2pi, which is clearly irrational. The sum of two irrational numbers, therefore, may or may not be rational.
What is the ratio of the surface area of the sphere to its volume?
The surface area of a sphere with radius 'R' is 4(pi)R2 The volume of the same sphere is (4/3)(pi)R3 . Their ratio is (4 pi R2)/(4/3 pi R3) = (12 pi R2)/(4 pi R3) = 3/R
What is the formula for finding surface area of a sphere?
4 πr2π is pi... Also it is 4(pi(r^2))
