answersLogoWhite

0

ca3[po4]2

User Avatar

Wiki User

12y ago

What else can I help you with?

Related Questions

What is the chemical formula of superphosphate?

Ca(H2PO4)2(s)+2CaSO4.2H2O(s)


What is the chemical formula for fertilizer?

The chemical formula for fertilizer can vary depending on the type of fertilizer. However, common fertilizers like ammonium nitrate have the chemical formula NH4NO3, while urea fertilizer has the formula CO(NH2)2.


What is the chemical formula for ammonia fertilizer?

The chemical formula for ammonia fertilizer is NH3, which represents the compound's one nitrogen atom bonded to three hydrogen atoms.


Manufacturing process of single super phosphate?

Single superphosphate is made by reacting phosphate rock with sulfuric acid to produce phosphoric acid. This phosphoric acid is then mixed with phosphate fertilizer to produce single superphosphate. The mixture is granulated and dried before being ready for use as a fertilizer.


What is the chemical formula for chilean nitrate?

The chemical formula for Chilean nitrate is NaNO 3. This specific formula is often used as a high nitrogen fertilizer and is a type of sodium nitrate.


K2SO4 is a formula to what?

K2SO4 is the chemical formula for Potassium sulfate.


What is the chemical formula for potassium and sulfate?

K2S-Potassium Sulfide!!! HOPE THAT HELPS!!! kuz i got an A for that answer!!!


What is the chemical formula for iron (II) sulfate and what are its common uses?

The chemical formula for iron (II) sulfate is FeSO4. It is commonly used as a nutritional supplement for iron deficiency in humans and as a fertilizer for plants.


What is the chemical formula for iron(II) sulfate and what are its common uses?

The chemical formula for iron(II) sulfate is FeSO4. It is commonly used as a nutritional supplement for iron deficiency in humans and as a fertilizer for plants.


What is the formula for ammonium thiosulfate?

The chemical formula for ammonium thiosulfate is (NH4)2S2O3. It is a colorless crystalline solid often used in photographic fixers and fertilizer products.


What is ammonia in chemical formula?

Ammonia is represented by the chemical formula NH3, which indicates that it contains one nitrogen atom and three hydrogen atoms. It is a colorless gas with a pungent smell and is commonly used in household cleaning products and as a fertilizer.


What are fertilizer bonds?

you mean what chemical bonds? it depends on the fertilizer, nor is the formula always available to the public Sounds like a cute nickname for D-grade or slightly above D-grade debentures--manure is a fertilizer, hence the reference.