ca3[po4]2
Ca3(PO4)2
Formula: NH4NO3
NH4NO3
The chemical formula for Chilean nitrate is NaNO 3. This specific formula is often used as a high nitrogen fertilizer and is a type of sodium nitrate.
K2S-Potassium Sulfide!!! HOPE THAT HELPS!!! kuz i got an A for that answer!!!
chemical formula
Ca(H2PO4)2(s)+2CaSO4.2H2O(s)
Formula: NH4NO3
NH4NO3
The chemical formula for Chilean nitrate is NaNO 3. This specific formula is often used as a high nitrogen fertilizer and is a type of sodium nitrate.
K2S-Potassium Sulfide!!! HOPE THAT HELPS!!! kuz i got an A for that answer!!!
you mean what chemical bonds? it depends on the fertilizer, nor is the formula always available to the public Sounds like a cute nickname for D-grade or slightly above D-grade debentures--manure is a fertilizer, hence the reference.
CO(NH2)2
Energy has no chemical formula as it is not a chemical.
chemical formula
That is the chemical formula. SnCl4 is the chemical formula for tin(IV) chloride.
Copper sulfate, chemical formula CuSO4Sodium chloride, chemical formula NaClSodium chromate, chemical formula H2CrO4Mercury sulfide, chemical formula HgSCalcium carbonate,CaCO3
It is a chemical formula.