Subjects>Science>Chemistry

Does flucloxacillin contain sulphurs

Anonymous

∙ 10y ago

Updated: 6/2/2024

Yes, the chemical formula for flucloxacillin is C19H17ClFN3O5S. There is one sulfur atom in each molecule. In pharmacy it is used as an antibiotic.

Wiki User

∙ 10y ago

What else can I help you with?

Continue Learning about Chemistry

What is sulfurs nickname?

Sulfur is often referred to as "brimstone" due to its distinctive yellow color and associations with fire and destruction.

Do amines contain oxygen?

Not necessarily. Amines contain nitrogen, but many do not contain oxygen.

Do alkanes contain phosphorus?

No. alkanes contain only hydrogen and carbon.

Does chlorophyll contain magnesium?

Yes, chlorophyll does contain magnesium.

Does tin contain lead?

No, tin does not contain lead. Tin is a separate element from lead and does not naturally contain lead in its composition.

What antibiotic is used to treat osteomyelitis?

erythromycin, ciprofloxacin, clindamycin, cefuroxine, flucloxacillin erythromycin, ciprofloxacin, clindamycin, cefuroxine, flucloxacillin erythromycin, ciprofloxacin, clindamycin, cefuroxine, flucloxacillin erythromycin, ciprofloxacin, clindamycin, cefuroxine, flucloxacillin

Does Flucloxacillin affect the contraceptive implant?

There are no known drug interactions be2ween flucloxacillin and the contraceptive implant.

Can you take Ibuprofen with penicillin and flucloxacillin?

Hi, i was told by my doctor that ibuprofen was fine to take with with my flucloxacillin.

What is the description of sulphurs appearance?

Sulphur is a pale yellow odorless crystal.

Can you take simvastatins and flucloxacillin together?

yes

What does flucloxacillin?

Viral Infections (NOT DENTAL USED)

Can you take flucloxacillin when pregnant?

No you cannot take flucloxacillin when pregnant. the leaflet says, 'do not take if you are pregnant or think you may be pregnant' therefore i wouldn't take it.

Can i eat cheese whilst taking flucloxacillin?

Yes, you can eat cheese while taking flucloxacillin. There are no known interactions between flucloxacillin and cheese. However, if you have specific dietary restrictions or allergies, it's always best to consult your healthcare provider for personalized advice.

Can you take flucloxacillin for tonsillitis?

Amoxicullin is best but flucloxacillin can be used to. most GP'S will proscribe amoxicilin unless you are unable to take any medication containing penicillin.

Can you take flucloxacillin tablets whilst pregnant?

yes

What is a bacterial infection medication that starts with a f?

flucloxacillin

Can you take flucloxacillin for gum infection?

Can you take flucloxacillin for infection of the gum

Trending Questions

How many elements in PbI2? Is petroleum gas same as liquefied petroleum gas? Parts of a car start to go rusty is this a useful or harmful reaction? Why should the pupils not use pairs of the same type of metals for the clock? Is vinegar more acidic than sulphuric acid? What function does the nucleus serve? How many electrons in 2.9 grams of copper? How do you remove suede stains? What is the highest priority substituent in CH3CH2CH2-CH2CH(CH3)2-CC-CH2CH2Br- CH2Cl? What is the total number of atoms in glucose? Is there a product to get floor glue off a cement floor? Why was atomism largely ignored during the Middle Ages? What is salkowski's reaction and its mechanism? How many years will chernobyl be radioactive? What is the equilibrium constant for the reaction so2 (g) no2 (g) so3 (g) no (g)? What All minerals share the following characteristics except that of? How can Chloroform reaction performed by methanol? Why filtering cannot be used to make sea water fit to drink? How do we get chlorine from the earth? What is the substance in Creatine that makes it a performance enhancer?