How do you draw 2-4-diethyl-4-ethoxyhexane?

Answer 1

Basically, it's a hexene molecule (6 carbons, C-C-C-C-C=C, the double bond comes from it being an ALKENE, this is obvious from the -ene on the end of the word hexene) with two(di-) methyl groups on it (Methyl being CH3). the numbers describe where exactly the methyl groups and hexene double bond are located on the structure. If you number each carbon 1 to 6 from right to left, you know which carbon to put the methyls on (3-4). The 2 states where the double bond is located, which is between carbon 2 and 3. Here's an example.

C1-C2=C3-C4-C5-C6

Each number shows where exactly each substituent group goes. I put the double bond in at 2, the methyl groups (CH3) would be bonded by their carbon to carbons 3 and 4 on the hexene chain above.

I am unable to draw an example of this molecule's shape and I can't find a picture of it on the internet but so long as you draw in a methyl group on carbon's 3 and 4 in the numbered Hexene chain above, you should have the correct structure.

Hope this helped.

Answer 2

To draw 2-4-diethyl-4-ethoxyhexane, start by drawing hexane. Now place an ethyl group on the second hexane and the fourth. Also, place an O atom. single bonded to the 4th carbon. Bond an ethyl group to the O atom.

Answer 3

i am not sure but i think it is : c c c c c c c c

Answer 4

It should be C7H16

Answer 5

CH3-CH(CH3)-CH(CH3)-CH2-CH(CH3)-CH3