answersLogoWhite

0

Use the working definition of pH used in General Chemistry classes:

pH = -log([H+])

and the equilibrium constant for ionization of water:

[H+][OH-]=10-14

(Here [] denotes concentration in Molarity)

For moderate concentrations of NaOH (like 10-4-ish M and up, we can neglect the [OH-] from the actual ionization of water (since 10-7 is the maximum this concentration could be, when the NaOH concentration is 0, and even this is much less than the concentration of NaOH). Then we can say:

10-14=[H+][OH-]=[H+][NaOH] and then pH=-log[H+]=-log(10-14/[NaOH])

Just as an example, a 0.5 M solution has a pH of approximately -log(10-14/0.5) which is about 13

User Avatar

Wiki User

15y ago

What else can I help you with?

Related Questions

Does sodium hydroxide have pH 7?

No, sodium hydroxide (NaOH) does not have a pH of 7. Sodium hydroxide is a strong base and has a pH greater than 7. The pH of a solution of sodium hydroxide depends on its concentration. A 0.1 M solution of NaOH has a pH of 13.


Which has a high pH level sodium hydroxide or potassium hydroxide?

Both are strong bases and a solution of either will have a high pH.


What is the specific gravity of sodium hydroxide?

What is the pH of sodium hydroxide? What I determined from a wide range pH paper is that the pH of a .1 M solution of sodium hydroxide was that between 11 and 12.


What is the pH of sodium hidroxide?

Sodium hydroxide is alkaline and so its pH must be above 7. It is not a strong base so its pH may be 9 approximately.


A solution of sodium hydroxide in water is most likely to have a pH close to?

A solution of sodium hydroxide in water will have a pH close to 14, as sodium hydroxide is a strong base that dissociates completely in water to produce hydroxide ions, increasing the pH.


Can I lower the pH of sodium hydroxide with water?

No, adding water to sodium hydroxide will not lower the pH. Sodium hydroxide is a strong base, and when dissolved in water, it dissociates to produce hydroxide ions, which make the solution more basic. To lower the pH of a sodium hydroxide solution, you would need to add an acid to neutralize the base.


What has the highest pH value acetic acid or sodium hydroxide or sodium carbonate or sulphuric acid?

sodium hydroxide


A solution of sodium hydroxide in water most likely to have a pH close to?

A solution of sodium hydroxide in water will have a pH greater than 7, typically ranging from 12 to 14. Sodium hydroxide is a strong base that dissociates completely in water to produce hydroxide ions, leading to a high pH.


What has a pH of 14?

A substance with a pH of 14 is considered highly basic or alkaline. It indicates a strong concentration of hydroxide ions in the solution. Examples of substances with pH 14 include sodium hydroxide and potassium hydroxide.


What is sodium hydroxide in a PH scale?

Sodium Hydroxide or NaOH is a highly basic compound. On the pH scale it has a pH of 14.


What is sodium hydroxide pH level?

pH level is a measure of acidity, the simplest way to understand it is the lower the pH value the more acid something is, and the higher the pH value the more alkali something is. Finaly a value of pH 7 is neutral (neither acid or alkali).pH does not show the amount of Sodium Hydroxide present, however the pH would increase if Sodium Hydroxide was added because Sodium Hydroxide is alkali.The pH of concentrated (1 M) Sodium Hydroxide is 14.


What is pH of 1n sodium hydroxide?

The pH of 1N sodium hydroxide (NaOH) is approximately 14 because sodium hydroxide is a strong base that dissociates completely in water to form hydroxide ions. The concentration of hydroxide ions in a 1N solution is high, resulting in a highly alkaline pH of 14.