CH3CH2C(CH3)C(CH2CH2CH3)CH2CH2CH2CH3
24 hydrogen
There are 2 hydrogen atoms present in sulfuric acid (H2SO4).
By looking at an actual chemical formula for a compound, we could tell you how many hydrogen atoms there are per molecule (or at least per formula unit) of that compound.Without the specific chemical formula, we can't. So the question is meaningless ... how many hydrogen atoms are present in a chemical formula depends on what the chemical formula is.
Ammonia has one nitrogen atom and three hydrogen atoms, so there are a total of 4 atoms in a molecule of ammonia.
In 2,5-dimethyloctane, there are 22 hydrogen atoms. Each methyl (CH3) group has 3 hydrogen atoms, so for two methyl groups, it would be 2 x 3 = 6 hydrogen atoms. Octane has 16 hydrogen atoms. Therefore, 6 + 16 = 22 hydrogen atoms in total for 2,5-dimethyloctane.
To answer your question on how many hydrogen atoms are there in caffeine, the scientific answer would be 10 atoms of hydrogen.
There are 10 hydrogen atoms present in 4C2H5OH.
there are 2 atoms of hydrogen in water
1 Hydrogen atom is present in H2SOn4.
There are 2 hydrogen atoms present in sulfuric acid (H2SO4).
2
The amount of hydrogen atoms that are present in 2.00 mg of aspartame are 2.167*10^22.
Hydrogen exists as H2 which is a molecule. There are thus two atoms present.
there are 2 atoms of hydrogen in water
The number of hydrogen atoms of present in a hydrogen molecule are 2.
2
There are 8 atoms of hydrogen present in NH4 2S. This is because there are 4 hydrogen atoms in each ammonium ion (NH4+) and there are 2 ammonium ions in NH4 2S.
The number of hydrogen atoms is 2,773.10e23.