0
What else can I help you with?
What is a molecule represented by?
A molecule is represented by a group of atoms bonded together to form a chemical structure. This representation can vary depending on the method used: for example, a molecular formula shows the types and numbers of atoms in the molecule, while a structural formula shows the arrangement of atoms and bonds.
What is the difference between a simple and structural formula?
Complete Structural FormulaH H H H| | | |H-C-C-C-C-H| | | |H H H HCondensed Structural FormulaCH3CH2CH2CH3orCH3(CH2)2CH3
What is the structural formula of a butanol molecule?
Assuming you want the structural formula of 'Butan-1-ol' it is CH3CH3CH3CH2OH
The type of formula that shows the arrangements of atoms and bonds is called?
The empiracle formula shows the ratio of the individual elements in a compound, and the molecular formula shows the actual number of each elemental atom in each molecule (which will be equal to the empiracle formula or a whole number multiple of it). However, it is the structural formula that shows how the individual atoms are connected.
Describe the differences between molecular formulas and structural formulas for molecular compounds?
A molecular formula lists the numbers of the atoms of a specific element in a compound. A structural formula is a picture of how the atoms in a specific molecule are connected, with each atom represented by its chemical symbol. For example, oxygen's molecular formula is O2. Its structural formula is O-O.
What does a structural formula shows about a molecule of a compound?
The structural formula show the spatial aspect of the molecule.
What does structural formula show about a molecule of a compound?
The structural formula show the spatial aspect of the molecule.
Expanded structural formula?
Certainly! An expanded structural formula shows all atoms and bonds in a molecule. It provides a detailed visual representation of how atoms are connected within a compound. This type of formula is useful for understanding the arrangement of atoms in a molecule.
Explain the difference between molecule and formula unit?
The formula unit is the representation of a molecule.
What is the difference between structural and condensed formula?
The structural formula show the position of atoms in a molecule.
How does a complete structural formula differ from a condensed structural formula?
------ The condensed structural formula is simply a shortened version of the complete structural formula. -------The complete formula indicates all of the carbon and hydrogen atoms. The condenced formula groups the hydrogen atoms with each of the carbon atoms.
What is the difference between a chemical formulamolecular formula and a structural formula?
A structural formula represents the molecule graphically, whereas the other does not.
What is the advantage of using a structural formula over a molecular formula?
A molecular formula indicates the numbers of atoms of each element in the molecule, but a structural formula also indicates the arrangement of the atoms in the molecule. For example, H2O is the molecular formula for water, but H-O-H is the structural formula, showing how the hydrogen and oxygen atoms are arranged in the molecule.
The formula shows how atoms are arranged within a molecule or ion?
A structural formula
What formula shows the location of the atoms to another in a molecule an shows the number and location of bonds?
That is a structural formula. For example, the chemical formula for water is H2O and its structural formula is H-O-H, which shows how the atoms are arranged in the molecule.
What is the difference between a structural formula and a molecular model?
A chemical formula is the number of atoms in a substance, and is the same as a molecular formula (provided the substance is a molecule - if not, it has no molecular formula). A structural formula shows how the atoms are linked, and there are different interpretations of this: eg C3H8O2 is the chemical formula of 1,2 propan di-ol, which is the same as the chemical formula of 1,1 propan di-ol the structural formula however is CH2OHCHOHCH3 for 1,2 propan di-ol and CH(OH)2CH2CH3 for 1,1 propan di-ol. A displayed formula shows all the bonds: ........H..OH...H.............O-H...H...H ........|....|.....|..................|....|.....| ....H-C.-.C.-.C.-.H.....H-O-C.-.C.-.C.-.H ........|....|.....|..................|....|.....| ....H-O...H....H.................H...H....H 1,2 propan di-ol........1,1 propan di-ol ---------------------------------- Some chemicals, such as table salt, have no molecule. Thus, they only have chemical formula but not molecular formula. The chemical formula of table salt is NaCl. There are other salts, such as Na2SO4, MgSO4, etc. (If you hear people saying "the salt molecule has the formula of NaCl...", believe me, they do not know what they are talking about.) Some compounds exist as molecules- discrete entities, such as water. This kind of compounds have molecular formula. Water's is H2O. Structural formula? Never heard of.
What is a molecule represented by?
A molecule is represented by a group of atoms bonded together to form a chemical structure. This representation can vary depending on the method used: for example, a molecular formula shows the types and numbers of atoms in the molecule, while a structural formula shows the arrangement of atoms and bonds.
