0
I assume you mean CH2=C=CH2 or 1,2-propadiene. The molecule has two equally electronegative substituents attached to the central carbon, so no it is not polar. If it was CH2=C=O, then yes it would be polar, because the oxygen atom pulling the electron cloud toward itself, thus making it slightly negative which make he molecule polar.
What else can I help you with?
How many sigma and pi bond in H2C equals C equals CH2?
There are 5 sigma bonds and 1 pi bond in the molecule H2C=CH2. The sigma bonds are the single bonds between the carbon atoms and hydrogen atoms, and the carbon atoms are connected by a double bond which consists of 1 sigma bond and 1 pi bond.
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
Is cf3cl polar or nonpolar?
CF3Cl is a polar molecule. There are 3 C-F polar bond and 1 C-Cl polar bond. Since the difference in electronegative between C and F is not the same as that of C and Cl, therefore their bond polarities are not the same which results in the compound is a polar molcule.
Is C2HBr polar or nonpolar?
It's polar because there is an uneven distribution of charge and Br is relatively electronegative compared to C (as opposed to H, which has an electronegativity that is fairly close to C).
What is H2CN2 plus heat equals N2 plus CH2?
The equation H2CN2 + heat = N2 + CH2 represents the thermal decomposition of hydrogen cyanide into nitrogen gas and methylene (CH2) radicals. This reaction occurs at high temperatures to break the H-C and C-N bonds, forming the new products.
How many sigma and pi bond in H2C equals C equals CH2?
There are 5 sigma bonds and 1 pi bond in the molecule H2C=CH2. The sigma bonds are the single bonds between the carbon atoms and hydrogen atoms, and the carbon atoms are connected by a double bond which consists of 1 sigma bond and 1 pi bond.
What is ch2 equals c-ch3-ch2-ch2-ch3?
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
What are the structural isomers for C6H10?
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3
What type of molecule is C20H40O2?
When it is linear and saturated it might be CH3(CH2)18COOH standing for arachidic acid, eicosanoic acid.CH3(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-(CH2)-C(OH)(=O).
Is cf3cl polar or nonpolar?
CF3Cl is a polar molecule. There are 3 C-F polar bond and 1 C-Cl polar bond. Since the difference in electronegative between C and F is not the same as that of C and Cl, therefore their bond polarities are not the same which results in the compound is a polar molcule.
What is propene condensed structural formula?
Ch2chch3 c=c-c
Is c f c l3 a polar molecule?
Yes, carbon tetrachloride (CCl₄) is a polar molecule. Despite having polar bonds between carbon and chlorine, the molecule has a symmetrical tetrahedral shape, which causes the dipole moments to cancel out. As a result, CCl₄ is considered a nonpolar molecule overall.
Is O-C-S molecule polar?
Yes, the OCS molecule is polar due to the difference in electronegativity between the oxygen and sulfur atoms. This causes a separation of charge within the molecule, resulting in an overall polar nature.
What is this C-C-C-O-C-C?
this is nothing actually is... CH3-CH2-CH2-O-CH2-CH3 ethyl methyl ether....
In a polar molecule such as water?
D. both b and c
Is C2HBr polar or nonpolar?
It's polar because there is an uneven distribution of charge and Br is relatively electronegative compared to C (as opposed to H, which has an electronegativity that is fairly close to C).
What is the condensed structural formula for the alkane heptane which has a molecule formula of C7H16?
What is the molecular shape of C7H16OH? This as an alcohol made from an alkane ( all bonds single) …...H...H…H….H….H….H..…H H…C...C….C...C….C....C....C...O…H …...H...H…H.…H….H….H..…H
