answersLogoWhite

0

I assume you mean CH2=C=CH2 or 1,2-propadiene. The molecule has two equally electronegative substituents attached to the central carbon, so no it is not polar. If it was CH2=C=O, then yes it would be polar, because the oxygen atom pulling the electron cloud toward itself, thus making it slightly negative which make he molecule polar.

User Avatar

Wiki User

15y ago

What else can I help you with?

Related Questions

How many sigma and pi bond in H2C equals C equals CH2?

There are 5 sigma bonds and 1 pi bond in the molecule H2C=CH2. The sigma bonds are the single bonds between the carbon atoms and hydrogen atoms, and the carbon atoms are connected by a double bond which consists of 1 sigma bond and 1 pi bond.


What is ch2 equals c-ch3-ch2-ch2-ch3?

The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br


What are the structural isomers for C6H10?

1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3


What type of molecule is C20H40O2?

Well, it's organic. Past that it's difficult to say with certainty. It could be a cyclic diether or diol, it could be an ester, it could be an alkene diether or diol ... the molecular formula alone doesn't provide enough information to be sure.


Is cf3cl polar or nonpolar?

CF3Cl is a polar molecule. There are 3 C-F polar bond and 1 C-Cl polar bond. Since the difference in electronegative between C and F is not the same as that of C and Cl, therefore their bond polarities are not the same which results in the compound is a polar molcule.


What is propene condensed structural formula?

Ch2chch3 c=c-c


Is c f c l3 a polar molecule?

Yes, carbon tetrachloride (CCl₄) is a polar molecule. Despite having polar bonds between carbon and chlorine, the molecule has a symmetrical tetrahedral shape, which causes the dipole moments to cancel out. As a result, CCl₄ is considered a nonpolar molecule overall.


Is O-C-S molecule polar?

Yes, the OCS molecule is polar due to the difference in electronegativity between the oxygen and sulfur atoms. This causes a separation of charge within the molecule, resulting in an overall polar nature.


What is this C-C-C-O-C-C?

this is nothing actually is... CH3-CH2-CH2-O-CH2-CH3 ethyl methyl ether....


In a polar molecule such as water?

D. both b and c


Is C2HBr polar or nonpolar?

It's polar because there is an uneven distribution of charge and Br is relatively electronegative compared to C (as opposed to H, which has an electronegativity that is fairly close to C).


What is the condensed structural formula for the alkane heptane which has a molecule formula of C7H16?

What is the molecular shape of C7H16OH? This as an alcohol made from an alkane ( all bonds single) …...H...H…H….H….H….H..…H H…C...C….C...C….C....C....C...O…H …...H...H…H.…H….H….H..…H