answersLogoWhite

0

It's covalent

User Avatar

Wiki User

14y ago

What else can I help you with?

Related Questions

What is the chemical formula for butyric acid?

C4H8O2 , CH3-CH2-CH2-COOH Butyric acid and CH3-CH(CH3)-COOH isobutyric acid.


How many carboxylic acids have the formula C5H10O2?

There are 4 isomers of carboxylic acids for this formula CH3-CH2-CH2-CH2-COOH pentanoic acid, CH3-CH(CH3)-CH2-COOH 3-methyl butanoic acid, CH3-CH2-CH(CH3)-COOH 2-methyl butanoic acid and CH3-C(CH3)2-COOH dimethyl propanoic acid.


Is CH3 Cl ionic or covalent?

Covalent.


What is the chemical formula of ethyl ethanoic?

The structural formula is CH3COOCH2CH3


Is propene ionic or covalent?

Propene is a covalent compound. It is made up of carbon and hydrogen atoms bonded together through covalent bonds, where electrons are shared between the atoms. Ionic compounds involve the transfer of electrons between a metal and a nonmetal.


What is ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch2-ch2-ch2-ch2-ch2-ch2-cooh?

Its called octanoic acid.There are 8 carbons in the longest chain, therefore it begins with oct.All of the carbon to carbon bonds are single (alkane). Therefore the middle is an.And finally, the subgroup on the end is a carboxylic acid, therefore we add oic acid.Therefore CH3 (CH2)6 COOH is called octanoic acid.


What is the structure for octane?

Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3


What is ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch2-ch2-ch2-ch2-ch2-ch2-ch2-ch2-cooh?

Its called octanoic acid.There are 8 carbons in the longest chain, therefore it begins with oct.All of the carbon to carbon bonds are single (alkane). Therefore the middle is an.And finally, the subgroup on the end is a carboxylic acid, therefore we add oic acid.Therefore CH3 (CH2)6 COOH is called octanoic acid.


What is condensed formula for 2 3 3 4 tetramethylnonane?

The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.


What is ch2 equals c-ch3-ch2-ch2-ch3?

The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br


What are the structural isomers for C6H10?

1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3


What is the proper configuration of a straight chain isomer of hexane?

Ch3-ch2-ch2-ch2-ch2-ch3