It's covalent
C4H8O2 , CH3-CH2-CH2-COOH Butyric acid and CH3-CH(CH3)-COOH isobutyric acid.
There are 4 isomers of carboxylic acids for this formula CH3-CH2-CH2-CH2-COOH pentanoic acid, CH3-CH(CH3)-CH2-COOH 3-methyl butanoic acid, CH3-CH2-CH(CH3)-COOH 2-methyl butanoic acid and CH3-C(CH3)2-COOH dimethyl propanoic acid.
Its called octanoic acid.There are 8 carbons in the longest chain, therefore it begins with oct.All of the carbon to carbon bonds are single (alkane). Therefore the middle is an.And finally, the subgroup on the end is a carboxylic acid, therefore we add oic acid.Therefore CH3 (CH2)6 COOH is called octanoic acid.
Propene is a covalent compound. It is made up of carbon and hydrogen atoms bonded together through covalent bonds, where electrons are shared between the atoms. Ionic compounds involve the transfer of electrons between a metal and a nonmetal.
Its called octanoic acid.There are 8 carbons in the longest chain, therefore it begins with oct.All of the carbon to carbon bonds are single (alkane). Therefore the middle is an.And finally, the subgroup on the end is a carboxylic acid, therefore we add oic acid.Therefore CH3 (CH2)6 COOH is called octanoic acid.
C4H8O2 , CH3-CH2-CH2-COOH Butyric acid and CH3-CH(CH3)-COOH isobutyric acid.
There are 4 isomers of carboxylic acids for this formula CH3-CH2-CH2-CH2-COOH pentanoic acid, CH3-CH(CH3)-CH2-COOH 3-methyl butanoic acid, CH3-CH2-CH(CH3)-COOH 2-methyl butanoic acid and CH3-C(CH3)2-COOH dimethyl propanoic acid.
Covalent.
The structural formula is CH3COOCH2CH3
Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3
Its called octanoic acid.There are 8 carbons in the longest chain, therefore it begins with oct.All of the carbon to carbon bonds are single (alkane). Therefore the middle is an.And finally, the subgroup on the end is a carboxylic acid, therefore we add oic acid.Therefore CH3 (CH2)6 COOH is called octanoic acid.
Propene is a covalent compound. It is made up of carbon and hydrogen atoms bonded together through covalent bonds, where electrons are shared between the atoms. Ionic compounds involve the transfer of electrons between a metal and a nonmetal.
The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.
Its called octanoic acid.There are 8 carbons in the longest chain, therefore it begins with oct.All of the carbon to carbon bonds are single (alkane). Therefore the middle is an.And finally, the subgroup on the end is a carboxylic acid, therefore we add oic acid.Therefore CH3 (CH2)6 COOH is called octanoic acid.
The compound CH2=CH-CH=CH2 when reacts with HBr gives 1,4 addition product, CH3-CH=CH-CH2Br
Ch3-ch2-ch2-ch2-ch2-ch3
1. hexane: CH3-CH2-CH2-CH2-CH2-CH32. 3-methylpentane: CH3-CH2-CH(CH3)-CH2-CH33. 2-methylpentane: CH3-CH(CH3)-CH2-CH2-CH34. 2,2-dimethylbutane: CH3-C(CH3(CH3))-CH2-CH3