0
What else can I help you with?
Is Mg(NO3)2 polar or non polar?
MgBr2 is ionic, and so would be considered polar.
Is Pb NO3 2 soluble in water and why?
I don't know because my chemistry teacher is greedy
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
What is compound name for NO3?
Chromium (III) Nitrate
Is HNO3 a polar or nonpolar covalent?
A fast way to answer it is that HNO3 is soluble in water and water is polar so HNO3 is polar Another explanation is that HNO3's H will form dipole hydrogen bonds with other molecules (IMF) thus is considered as polar
Is Mg(NO3)2 polar or non polar?
MgBr2 is ionic, and so would be considered polar.
Is Pb NO3 2 soluble in water and why?
I don't know because my chemistry teacher is greedy
Is copper nitrate polar or non polar?
Copper nitrate, Cu(NO3)2, is a polar molecule. This is because the nitrate (NO3) ions have a negative charge due to the presence of the oxygen atoms, while the copper ion (Cu) has a positive charge. The difference in electronegativity between copper and nitrogen/oxygen atoms results in an uneven distribution of electrons, making the molecule polar.
The correct name for NO3?
NO3 is known as nitrate.
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the name for the formula NO3?
NO3 is commonly known as nitrate.
What is the product if you multiply Mg by NO3?
Mg(NO3)2
Is HNO3 a polar or nonpolar covalent?
A fast way to answer it is that HNO3 is soluble in water and water is polar so HNO3 is polar Another explanation is that HNO3's H will form dipole hydrogen bonds with other molecules (IMF) thus is considered as polar
