0
The chemical formula of sodium laureth sulfate is CH3(CH2)11(OCH2CH2)nOSO3Na.
This compound is an anionic surfactant.
Wiki User
∙ 9y ago
Wiki User
∙ 14y agoSodium laureth sulphate is both ionic and covalent: It contains sodium ions and laureth sulphate ions, but the latter type of ions contain internal covalent bonds.
Wiki User
∙ 12y agoSodium lauryl sulfate is an ionic compound (an anionic surfactant).
Wiki User
∙ 12y agoIonic
Add your answer:
Earn +20 pts
Are sodium laurel sulfate ans sodium lauryl sulfoacetate the same?
Yes ! Sodium laurel sulfate=Sodium lauryl sulfate=Sodium dodecyl sulfate (CH3(CH2)11OSO3Na). But sodium laureth sulfate is a different compound.
What is the common name of Sodium Laureth Ether Sulphate?
it is ammonium sulfate but the sulfate ion has a 12 carbon long chain hanging where one of the ammoniums should be
Is dove shampoo Sodium Laureth Sulfate free?
No
What does sodium laureth sulfate do for your hair?
it makes our hair shiny and healthy
What is dish soap made out of?
It's made out of water, sodium lauryl sulfrate, sodium laureth sulfate, alcohol, and sodium chloride :)
Is aqua sodium laureth sulfate acid or alkali?
This compound is an anionic detergent.
Are sodium laurel sulfate ans sodium lauryl sulfoacetate the same?
Yes ! Sodium laurel sulfate=Sodium lauryl sulfate=Sodium dodecyl sulfate (CH3(CH2)11OSO3Na). But sodium laureth sulfate is a different compound.
What is the common name of Sodium Laureth Ether Sulphate?
it is ammonium sulfate but the sulfate ion has a 12 carbon long chain hanging where one of the ammoniums should be
Is dove shampoo Sodium Laureth Sulfate free?
No
What does abbreviation SLS stand for?
sodium laureth sulfate
What is the main component of shampoo?
water and sodium laureth sulfate.
What is the difference between sodium sulfite and sodium sulfate?
No, these two chemicals are not the same. The difference is well-explained by the following excerpts from Wikipedia, accessed 2013 Feb 11:"[A generic] chemical formula for sodium laureth sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3Na. Sometimes the number represented by n is specified in the name, for example laureth-2 sulfate. The product is heterogeneous in the number of ethoxyl groups, where n is the mean. ... The related surfactant sodium lauryl sulfate (also known as sodium dodecyl sulfate or SLS) is produced similarly, but without the ethoxylation step."
What does sodium laureth sulfate do for your hair?
it makes our hair shiny and healthy
List of sodium laureth sulfate free shampoos in India?
There are several SLS or sodium laureth sulfate free shampoos that are available in India. These include Pureology Nano Works shampoo and Organix Rejuvenating Cherry Blossom Ginseng shampoo.
What is dish soap made out of?
It's made out of water, sodium lauryl sulfrate, sodium laureth sulfate, alcohol, and sodium chloride :)
Explain how it is possible for a compound to have both ionic and covalent bounds?
Sodium sulfate is ionically bonded between the sodium ion and the sulfate ion. However, the sulfate ion is covalently bonded between the sulfur and the oxygens.
What names are in this compound Na2SO3?
Na2SO4 is the ionic compound sodium sulfate.
