answersLogoWhite

0

Na2CO3+2(HNO3)=2(NaNO3)+H20+CO2

User Avatar

Wiki User

15y ago

What else can I help you with?

Related Questions

Formula for nitric acid plus sodium carbonate?

The chemical reaction between nitric acid (HNO3) and sodium carbonate (Na2CO3) is: 2 HNO3 + Na2CO3 → 2 NaNO3 + H2O + CO2. In this reaction, nitric acid reacts with sodium carbonate to produce sodium nitrate, water, and carbon dioxide.


What is the product of sodium hydrogen carbonate and nitric acid?

Sodium hydrogen carbonate and nitric acid react to form sodium nitrate, carbon dioxide, and water.


Nitric acid plus sodium hydrogen carbonate?

Sodium Hydrogen Carbonate plus Nitric acid = Sodium Nitrate + Hydrogen + Co2


What salt is produced if sodium carbonate reacts with dilute nitric acid?

Dilute Nitric acid when reacted with Sodium hydroxide will produce Sodium nitrate and Water. NaOH + HNO3 = NaNO3 + H2O.


What is the Name of the salt produced if sodium carbonate reacts with dilute nitric acid?

The salt produced from the reaction of sodium carbonate with dilute nitric acid is sodium nitrate (NaNO3). Water and carbon dioxide gas are also produced as byproducts.


Why does only dilute nitric acid react with dry sodium carbonate?

When sodium bicarbonate reacts with nitric acid, sodium nitrate salt is formed along with carbonic acid (double replacement reaction), which immediately decomposes to water and gaseous carbon dioxide (which explains the fizzing). The concentration of the nitric acid affects the rate of reaction, the more dilute it is, the slower the reaction will progress. The more pure the nitric acid, the faster the reaction will take place.


What does sodium carbonate and nitric acid make?

Sodium carbonate and nitric acid react to form sodium nitrate, carbon dioxide, and water. This is a double displacement reaction where the sodium from sodium carbonate combines with the nitrate from nitric acid to form sodium nitrate, while carbon dioxide and water are byproducts of the reaction.


What is the balance chemical equation for the reaction of Sodium Hydrogen carbonate and Nitric acid?

NaHCO3 + HNO3 = CO2 + H2O + NaNO3


What are the products of nitric acid and sodium carbonate?

When nitric acid reacts with sodium carbonate, the products formed are sodium nitrate, carbon dioxide, and water. The balanced chemical equation for this reaction is: 2HNO3 + Na2CO3 → 2NaNO3 + CO2 + H2O.


What is the word equation for nitric acid and calcium carbonate?

The word equation for the reaction between nitric acid and calcium carbonate is: nitric acid + calcium carbonate → calcium nitrate + carbon dioxide + water.


What kind of reaction is nitric acid and potassium carbonate is?

This is considered an acid/base reaction.


What is the name of the salt that is formed by nitric acid and calcium carbonate?

The salt formed by nitric acid and calcium carbonate is calcium nitrate. It is created when nitric acid reacts with calcium carbonate, which is a common chemical reaction used in various industries.