0
What else can I help you with?
What is the common name of CH4?
The common name for CH4 is methane.
What is a natural gas with the formula CH4?
CH4 stands for methane.It is a neutral gas.
Common name for methane?
The common name for methane is marsh gas. Methane is a colorless flammable gas and is the main component of natural gas.
What compounds of CH4?
Some common compounds of CH4 include carbon dioxide (CO2), water (H2O), methane (CH4) itself, and carbon monoxide (CO). These compounds are formed by various reactions involving methane as a reactant.
How do you calculate heating value of natural gas?
The net heating value will considering the evaporation of water formed in reaction of natural gas decomposition as follow CnHm+(n+m/4)O2=nO2+m/2H2O For Methane : CH4 we have n=1 " number of carbon m=4 " number of hydrogen then: CH4+(1+4/2)O2 O2+2H2O=CH4+3O2=2H2O Subtracting enthalpy of products from reactants to get enthalpy of decomposition
What is the common name of CH4?
The common name for CH4 is methane.
What is the common name and use of CH4?
The common name for CH4 is methane. It is a colorless and odorless gas that is the main component of natural gas. Methane is used as a fuel for heating and cooking, as well as in the production of chemicals such as ammonia.
What is a natural gas with the formula CH4?
CH4 stands for methane.It is a neutral gas.
Common name for methane?
The common name for methane is marsh gas. Methane is a colorless flammable gas and is the main component of natural gas.
Formula CH4 is called by what name?
The formula CH4 represents methane, which is a simple hydrocarbon gas composed of one carbon atom and four hydrogen atoms. It is the main component of natural gas and is used as a fuel for heating and cooking.
What fuel is methane?
Methane is also known as natural gas. The formula is CH4. A lot of it is burned in home heating units and in stoves.
What compounds of CH4?
Some common compounds of CH4 include carbon dioxide (CO2), water (H2O), methane (CH4) itself, and carbon monoxide (CO). These compounds are formed by various reactions involving methane as a reactant.
How do you calculate heating value of natural gas?
The net heating value will considering the evaporation of water formed in reaction of natural gas decomposition as follow CnHm+(n+m/4)O2=nO2+m/2H2O For Methane : CH4 we have n=1 " number of carbon m=4 " number of hydrogen then: CH4+(1+4/2)O2 O2+2H2O=CH4+3O2=2H2O Subtracting enthalpy of products from reactants to get enthalpy of decomposition
What is the chemical formula of heating gas?
Assuming by heating gas you mean "natural" gas, the the formula would be CH4 which is methane. Natural gas is mostly methane with some other combustible hydrocarbons added in.
What do carbon and methane have in common?
Carbon is a chemical element; methane (CH4) is a chemical compound containing carbon.
Is ch4 a Atom or Molecule?
ch4 is an atom.
Is ch4 molecule polar?
No. CH4 is nonpolar.
