Create
0
Log in
Subjects
>
Science
>
Chemistry
What is 2-2-4-4-tetramethylpentane?
Anonymous
∙
14y ago
Updated: 5/28/2024
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
Wiki User
∙
14y ago
Copy
Show More Answers (1)
Add Your Answer
What else can I help you with?
Search
Continue Learning about Chemistry
Related Questions
Trending Questions
You would like to know how does chemistry apply to economics and the vice versa that is the economic importance of chemistry like the commercial use of heterocyclic compounds?
A 0.200M solution of sodium carbonate Na2CO3 is made by dissolving 5.30g of the solid in water and making up the mark in a standard flask What volume must the flask be?
How much oxygen gas in grams can be prepared from 86.8 g of potassium chlorate?
What is the precise mass of the proton and how is it determined?
Is there a print of The hand is quicker than the rye?
What is an example of a conjugate acid base pair?
What type of charged ionwill potassium become when it gives up one electron?
If iron rusts would it be a chemical change?
Why does OH and OR group activate the benzene ring?
Are ionic compounds metal?
Why is copper a much denser material than oxygen?
Is iron softer than potassium?
Is it true if A Compound Whose Molecule Contain One Born Atom And Three Fluorine Atoms Would Be Named Monoborn Fluoride?
What is the formula of lead iodide and sodium nitrate?
What is the mass of 30.0mL of a solution with a density of 1.60g mL?
What are examples of pure carbon?
Is bituminous coal a hard coal or a soft coal?
What happens to the energy of the universe during physical or chemical process?
Why do you need more oxygen at lower temperatures?
Is soft drinks acid?