Create
0
Log in
Subjects
>
Science
>
Chemistry
What is 2-2-4-4-tetramethylpentane?
Anonymous
∙
14y ago
Updated: 5/28/2024
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
Wiki User
∙
14y ago
Copy
Show More Answers (1)
Add Your Answer
What else can I help you with?
Search
Continue Learning about Chemistry
Related Questions
Trending Questions
Does SeF6 have lone pairs?
What acid is produce in cutting onions?
Does polonium form ionic or covalent bonds?
Why acetic acid is mixed in the preparation of glucosazone?
How do you calculate the total yield of a multistep reaction?
What are the examples of materials at home that use chemical energy?
How does the decrease in activity coefficients correspond to the increase in ionic strength?
Will an object become positivley or negatively charged if it gains electrons?
A piece of solid gold that changes from a solid to a liquid is a physical or chemical change?
What is the most common gas people breathe?
Is zinc oxide soluble in water?
What is the reduction equation for MnO4- to Mn2 plus?
Where on periodic table can you find alkali metals?
Is the element neon dangerous?
Is a quarter an element or mixture or compound?
How many joules of heat are requied to melt 40 g of ice at 0 C?
Is common salt and sodium chloride the same?
What is the Lewis structure for P2H4?
How much heat is required to raise the temp of 106g of aluminum from 96 degree celsius to 121 degree celsius?
How many electrons does a aluminum atom lose to form an ion?