Create
0
Log in
Subjects
>
Science
>
Chemistry
What is 2-2-4-4-tetramethylpentane?
Anonymous
∙
15y ago
Updated: 5/28/2024
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
Wiki User
∙
15y ago
Copy
Show More Answers (1)
Add Your Answer
What else can I help you with?
Search
Continue Learning about Chemistry
Related Questions
Trending Questions
How do you dilute frankincense oil for safe use?
What are the substances you end up with in a chemical reaction called?
Does nucleic acid contain lactose and potassium?
What are groups in the periodic table?
What is an oxidizor?
How many electrons do beryllium and magnesium have in there outer energy levels?
What are micromolecules?
Where do you get hafnium from?
What is the trend of thermal stability in periodic table?
What is a tri-positive ion?
Does HNO3 dissociate?
What is the relationship between concentration and molarity in a solution?
Why is it important to be careful of fumes in the science lab?
What helps weaken high energy bonds so energy can be released?
When and who discovered osmium?
The attraction between various combinations of atoms will produce bonds which form molecules. True False?
What do laboratory technicians do in a crime scene?
What do the big numbers in a chemical equation mean?
Which mineral is involved in taste perception?
Which is larger a sodium atom or sodium ion with a plus 1 charge?