Create
0
Log in
Subjects
>
Science
>
Chemistry
What is 2-2-4-4-tetramethylpentane?
Anonymous
∙
14y ago
Updated: 5/28/2024
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
Wiki User
∙
14y ago
Copy
Show More Answers (1)
Add Your Answer
What else can I help you with?
Search
Continue Learning about Chemistry
Related Questions
Trending Questions
Is a sunshine heating up a rock will it be chemical or physical or biological?
What is sodium hydroxide in a PH scale?
Is shampoo a acid base or neutral?
In which industry used potassium nitrate?
Is alkaline flammable?
Is silver chloride a nonmetal?
Why is physic is better than applied physic?
FAQwhat's the difference between nickel silver and silver?
How would brackish water taste?
Is glittery red nail polish homogeneous or heterogeneous mixture?
How many atomic shells in sodium?
What is the evacuation distance for a 3088 gallon tank that is 4.1 x 21.3 feet and has a 7055 lb propane mass?
What color does blue and green and pink make when mixed together?
Preliminary test for the identification of acetate ion?
Is deionized water the same as reverse osmosis water?
How do you calculate the activity coefficient in a solution?
What is the pKa value of water and how does it impact its chemical properties?
Can water temperature get warmer than 1000 degrees Celsius?
How does rate constant change with temperature?
What is citric acid used for in cleaning?