Create
0
Log in
Subjects
>
Science
>
Chemistry
What is 2-2-4-4-tetramethylpentane?
Anonymous
∙
14y ago
Updated: 5/28/2024
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
Wiki User
∙
14y ago
Copy
Show More Answers (1)
Add Your Answer
What else can I help you with?
Search
Continue Learning about Chemistry
Related Questions
Trending Questions
What does sodium and chloride make together?
How many grame are in 2.4 moles of sulfur?
What elements are in ammonia?
Why must atomic and ionic radii be estimated?
What name is given to those metal oxides which show basic as well acidic behaviour?
In hydrochloric acid the hydrogen atom orients itself?
If you mix pink and yellow what color do you get?
Is petroleum jelly slippery?
Can water form hydrogen bonds form with itself?
Is DNA charged in any way?
What element is the most common that erodes to form rust?
How to do nomenclature for dummies: Can you provide a simplified explanation on how to properly name chemical compounds?
Why do stains affect clothes?
Is cobalt 2 chloride ionic?
Is wood being chopped an exothermic or endothermic reaction?
Which are the secondary color?
What is the difference between molar concentration and molarity, and how do they relate to each other in the context of solution chemistry?
How much is 95 Fahrenheit in Celsius?
Why does Tiffanys jewelry say 925?
Is sugarcane acidic or alkaline?