Create
0
Log in
Subjects
>
Science
>
Chemistry
What is 2-2-4-4-tetramethylpentane?
Anonymous
∙
15y ago
Updated: 5/28/2024
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
Wiki User
∙
15y ago
Copy
Show More Answers (1)
Add Your Answer
What else can I help you with?
Search
Continue Learning about Chemistry
Related Questions
Trending Questions
Is tyrosine a polar or nonpolar amino acid?
What burns faster white candles or colored ones?
Is 15 dm3 chemical or physical?
What does the symbol KM stand for in the periodic table?
How does the vapor pressure of water at 10 degrees celsius compare with its vapor pressure at 50 degrees celsius?
What is Certifying Officer's maximum level of pecuniary liability with regards to erroneous payments?
When you mix salt and chlorine what does it become?
Is oxidized wine a homogeneous mixture?
What is the first reaction to occur during glycolysis?
Why does methanol mix completely with ethanol?
Why does sodium bond with chlorine?
What does an acid plus base make?
What are the key differences in the chemistry between soap and detergent?
How many bonds can hydrogen form in a molecule?
What should be done to flasks as part of the cleanup in a lab?
Is p-toluidine soluble in HCl?
Is it safe to use dry ice in a pool?
Human blood contains about 1.34 micrograms of iron per deciliter How many grams of iron are in 1.00 mL of human blood?
Nonpolar organic molecules are good examples of?
What are the benefits of using a citric cleaner for household cleaning tasks?