0
What else can I help you with?
What is Kb for (CH3)3N(aq) H2O(l) (CH3)3NH (aq) OH-(aq)?
The Kb for (CH3)3N (trimethylamine) in water is a measure of the strength of the base (CH3)3NH in solution. It is used to calculate the equilibrium concentration of hydroxide ions (OH-) in solution when the base dissociates.
Is (CH3)3N a strong or weak acid or base?
(CH3)3N, also known as trimethylamine, is a weak base. It can accept a proton to form the ammonium ion, but it does not readily donate a proton like a strong base would.
What are the different types of organic reaction?
Addition Reactions - involve the conversion of a π bond into 2 new σ bonds General form: A + B → C Eg. CH3-CH=CH-CH3 + HCl → CH3-CH2-CHCl-CH3 Substitution Reactions - involve the no change in bonding - one σ bond replaces another General form: A + B → C + D Eg. CH3-CHBr-CH2-CH3 + KOH(aq) → CH3-CH(OH)-CH2-CH3 + KBr Elimination Reactions - reverse of addition, in that two σ bonds are lost, replaced by a new π bond General form: A → B + C Eg. CH3-CH(OH)-CH2-CH3 -- conc. H2SO4 --> CH3-CH=CH-CH3 + H2O Rearrangement / Isomerisation - process in which a single substance changes structure, A → B. Such a reaction may involve changes in bond / type, though this is not necessary. These reactions are comparatively rare. Eg. CH3-CH2-CH2-C(OH)=CH2 → CH3-CH2-CH2-C(=O)-CH3 These are the four "prototypical" reactions, though several others which can be categorised as one of these are generally referred to by other names. Eg. CH3-CH(OH)-CH3 -- H2SO4 / K2Cr2O7 --> CH3-C(=O)-CH3 could be described as an elimination reaction, but would usually be called an oxidation Eg. CH3-C(=O)-CH3 -- 1. LiAlH4 2. H^+ / H2O --> CH3-CH(OH)-CH3 could be described as a (nucleophilic) addition reaction, but would usually be called a reduction Eg. CH3-C(=O)-OH + CH3-OH -- H2SO4 / Δ / reflux --> CH3-C(=O)-O-CH3 + H2O could be described as a substitution reaction, but would usually be called a condensation Another important category of organic reactions are straight-forward Lowry-Bronsted acid-base reactions: Eg. (CH3-CH2)3N + HCl → (CH3-CH2)3NH^+ + Cl^- Note that there are also some reactions that are difficult to characterise in a simple way, like the following reactions requiring catalysis: stilbene + ethylene → styrene C6H5-CH=CH-C6H5 + CH2=CH2 → 2 C6H5-CH=CH2 but-1-yne + water → butanone CH3-CH2-C≡CH + H2O → CH3-CH2-C(=O)-CH3 (this is actually an addition reaction followed by an isomerisation) CH3-CH2-C(=O)-CH3 + NH2-OH → CH3-CH2-C(=N-OH)-CH3 + H2O the pinacol to pinacolone rearrangement CH3-C(CH3)(OH)-C(CH3)(OH)-CH3 → CH3-C(CH3)2-C(=O)-CH3 which is an elimination reaction that involves an isomerisation ... I add these last few just to illustrate that the general types are a useful tool / guide for understanding organic chemistry, but they are not the be-all and end-all.
Which compound do not have hydrogen bonding?
Carbon tetrachloride (CCl4) does not have hydrogen bonding because it does not contain hydrogen atoms that are bonded to highly electronegative atoms like oxygen or nitrogen, which are required for hydrogen bonding to occur.
What compound has the most ionic charector?
Theoretically a compound that contains the most electropositive (e.g. Cs or Fr) and the most electronegative (F) atoms will have the greatest ionic character. Therefore most likely CsF or FrF (although FrF would be difficult to obtain, in practice, due to its high radioactivity). Some complex compounds like Cs+[AuF6]-, ((CH3)3C)3N+[SbF6]-, (((CH3)3C)3N+[AuF6]-, have strong ionic character. ...
What is Kb for (CH3)3N(aq) H2O(l) (CH3)3NH (aq) OH-(aq)?
The Kb for (CH3)3N (trimethylamine) in water is a measure of the strength of the base (CH3)3NH in solution. It is used to calculate the equilibrium concentration of hydroxide ions (OH-) in solution when the base dissociates.
Is (CH3)3N a strong or weak acid or base?
(CH3)3N, also known as trimethylamine, is a weak base. It can accept a proton to form the ammonium ion, but it does not readily donate a proton like a strong base would.
What are the different types of organic reaction?
Addition Reactions - involve the conversion of a π bond into 2 new σ bonds General form: A + B → C Eg. CH3-CH=CH-CH3 + HCl → CH3-CH2-CHCl-CH3 Substitution Reactions - involve the no change in bonding - one σ bond replaces another General form: A + B → C + D Eg. CH3-CHBr-CH2-CH3 + KOH(aq) → CH3-CH(OH)-CH2-CH3 + KBr Elimination Reactions - reverse of addition, in that two σ bonds are lost, replaced by a new π bond General form: A → B + C Eg. CH3-CH(OH)-CH2-CH3 -- conc. H2SO4 --> CH3-CH=CH-CH3 + H2O Rearrangement / Isomerisation - process in which a single substance changes structure, A → B. Such a reaction may involve changes in bond / type, though this is not necessary. These reactions are comparatively rare. Eg. CH3-CH2-CH2-C(OH)=CH2 → CH3-CH2-CH2-C(=O)-CH3 These are the four "prototypical" reactions, though several others which can be categorised as one of these are generally referred to by other names. Eg. CH3-CH(OH)-CH3 -- H2SO4 / K2Cr2O7 --> CH3-C(=O)-CH3 could be described as an elimination reaction, but would usually be called an oxidation Eg. CH3-C(=O)-CH3 -- 1. LiAlH4 2. H^+ / H2O --> CH3-CH(OH)-CH3 could be described as a (nucleophilic) addition reaction, but would usually be called a reduction Eg. CH3-C(=O)-OH + CH3-OH -- H2SO4 / Δ / reflux --> CH3-C(=O)-O-CH3 + H2O could be described as a substitution reaction, but would usually be called a condensation Another important category of organic reactions are straight-forward Lowry-Bronsted acid-base reactions: Eg. (CH3-CH2)3N + HCl → (CH3-CH2)3NH^+ + Cl^- Note that there are also some reactions that are difficult to characterise in a simple way, like the following reactions requiring catalysis: stilbene + ethylene → styrene C6H5-CH=CH-C6H5 + CH2=CH2 → 2 C6H5-CH=CH2 but-1-yne + water → butanone CH3-CH2-C≡CH + H2O → CH3-CH2-C(=O)-CH3 (this is actually an addition reaction followed by an isomerisation) CH3-CH2-C(=O)-CH3 + NH2-OH → CH3-CH2-C(=N-OH)-CH3 + H2O the pinacol to pinacolone rearrangement CH3-C(CH3)(OH)-C(CH3)(OH)-CH3 → CH3-C(CH3)2-C(=O)-CH3 which is an elimination reaction that involves an isomerisation ... I add these last few just to illustrate that the general types are a useful tool / guide for understanding organic chemistry, but they are not the be-all and end-all.
what is (3n)(3n-1)?
(3n)(3n-1) = 3n * 3n - 3n * 1 Now, perform the multiplication: (3n * 3n) = 9n^2 (3n * 1) = 3n So, (3n)(3n-1) simplifies to: 9n^2 - 3n
How do you get this 3n plus 2 plus (3n plus 3 - 3n plus 1)?
3n + 2 + (3n + 3 - 3n + 1) = 3n + 2 + (3n + 3 - 3n + 1) = 3n + 2 + (4) = 3n + 6
What is the Greatest Common Factor of 3n2 and 3n?
Is it a. 3n square and 3n ans. 3n b. 3n *2 and 3n ans.3n ans. 3n for both!!
Is 3n the gcf of 3n 7 and 9n?
No. 3n is not a factor of 3n + 7.
Is 3n the gcf of 3n plus 7 and 9n?
No. 3n is not a factor of 3n + 7.
What is the GCF of 3N2 and 3N expressions?
The GCF is 3n.
What is 25-3n?
25-3n = 22
The gcf of the expressions 3n plus 7 and 9n is 3n?
No. 3n isn't a factor of 3n + 7. The GCF of 3n + 7 and 9n is 1.
How do you get 3 to the power of n plus 2 plus (3 to the power of n plus 3 minus 3 to the power of n plus 1)?
3n+2 + (3n+3 - 3n+1) = 3n+1+1 + (3n+1+2 - 3n+1) = 3*3n+1 + (9*3n+1 - 3n+1)= (3+9-1)*3n+1 = 11*3n+1.
