answersLogoWhite

0

....H

Cl C H

....H

Ignore the "." they were just to get the H's in the right place

Hope that's useful

If you cant read this, its because I made it on a computer, it may not be readable on things like ipods

User Avatar

Wiki User

13y ago

What else can I help you with?

Continue Learning about Chemistry

What is the condensed structural formula of 4ethyl 2 2dimethlyoctane?

CH3C(CH3)2CH2CH(CH2CH3)CH2CH2CH2CH3 Remember, whatever is in brackets is connected to the carbon before it.


How does the structural diagram of methane compare with the model?

The structural diagram of methane consists of a central carbon atom bonded to four hydrogen atoms in a tetrahedral arrangement. The structural model represents this geometry in a three-dimensional space, with the carbon atom at the center and the four hydrogen atoms positioned at the corners of a tetrahedron. The model provides a visual representation of how the atoms are arranged in space, giving a clearer understanding of the molecule's structure.


What visual representation describes the structural elements of plot?

A traditional visual representation that describes the structural elements of plot is the plot diagram, which typically includes the exposition, rising action, climax, falling action, and resolution. This diagram helps to visually show how the elements of a story arc fit together to create a coherent narrative.


What is the significance of the tetrahedral crystal field diagram in understanding the structural properties of certain compounds?

The tetrahedral crystal field diagram is important for understanding the arrangement of electrons in certain compounds. It helps predict the structural properties of these compounds, such as their color and magnetic behavior, by showing how the d orbitals of the central metal ion interact with surrounding ligands in a tetrahedral geometry.


Structural formula of 3-chloro 2-methyl 1-butanol?

A structural formula diagram of 3-chloro-2-methyl-1-butanol would include HO with a line drawn from it. Attached to the line would be offshoots which represented the methyl and butanol.

Related Questions

Carbohydrate structural diagram of monomer?

name a structural carbohydrate ?


This formula is a diagram showing the bonding between atoms?

The formula that is a diagram showing the bonding between atoms is called the structural formula. An example of structural formula would be for acetone OC(CH3)2.


What is the condensed structural formula of 4ethyl 2 2dimethlyoctane?

CH3C(CH3)2CH2CH(CH2CH3)CH2CH2CH2CH3 Remember, whatever is in brackets is connected to the carbon before it.


How does the structural diagram of methane compare with the model?

The structural diagram of methane consists of a central carbon atom bonded to four hydrogen atoms in a tetrahedral arrangement. The structural model represents this geometry in a three-dimensional space, with the carbon atom at the center and the four hydrogen atoms positioned at the corners of a tetrahedron. The model provides a visual representation of how the atoms are arranged in space, giving a clearer understanding of the molecule's structure.


What is the chemical formula for beryllium fluoride and what is its structural diagram?

BeF2; for the structure see: http://en.wikipedia.org/wiki/Beryllium_fluoride.


What visual representation describes the structural elements of plot?

A traditional visual representation that describes the structural elements of plot is the plot diagram, which typically includes the exposition, rising action, climax, falling action, and resolution. This diagram helps to visually show how the elements of a story arc fit together to create a coherent narrative.


What is the significance of the tetrahedral crystal field diagram in understanding the structural properties of certain compounds?

The tetrahedral crystal field diagram is important for understanding the arrangement of electrons in certain compounds. It helps predict the structural properties of these compounds, such as their color and magnetic behavior, by showing how the d orbitals of the central metal ion interact with surrounding ligands in a tetrahedral geometry.


Why you study about shear force and bending moment?

The importance of shear force and bending moment diagram in mechanics lies in structural design and in deflection of beams.


What is maxwell's diagram?

Maxwell's diagram is a method of graphical analysis of internal forces within a truss. It is a composite diagram which combines into one all the separate force polygons for the individual joints of a truss. in laymen's terms it's a method used by structural/civil engineers to determine the internal forces in a truss.


Structural formula of 3-chloro 2-methyl 1-butanol?

A structural formula diagram of 3-chloro-2-methyl-1-butanol would include HO with a line drawn from it. Attached to the line would be offshoots which represented the methyl and butanol.


What is collaboration diagram?

A collaboration diagram, also known as a communication diagram, is a type of UML (Unified Modeling Language) diagram that illustrates the interactions and relationships between objects in a system. It focuses on the messages exchanged between objects and how they collaborate to achieve a particular functionality. Unlike sequence diagrams that emphasize the time sequence of messages, collaboration diagrams highlight the structural organization of the objects involved, making it easier to visualize their connections and interactions.


What are the structural adaptations of a fish?

Its webbed feet & its skin covered with slime fluid to keep skin moist