0
A branches alkene of seven carbons. e.g.
CH3-CH=CH-CH(CH3)-CH2-CH3
In modern nomenclature this is 3-methyl-hex-2-ene
It is an iso-heptene.
What else can I help you with?
Continue Learning about Chemistry
Related Questions
Trending Questions
How long are Blood samples good for testing?
What is the formula for when carbon combusts?
What three states led the nation in SO2 emissions in 2004?
Why do you pair up the first two electrons in an atom?
What is the oxidation number of NiO2?
What process would be used to perceive a lipid-base food?
What are good methods for rust prevention?
How is it possoble to predict if a bond is ionic or covalent?
How many carbons in lactate?
How does hair color remover work?
Is the epsom salt is the same diShwasher salt?
Why is dietary fluoride important for the body?
Is chlorinated water bad for your diamond rings?
The quantum model suggests that electrons?
What is uses in materials in the bathroom?
How do you differentiate between glucose solution and sucrose solution?
Are enzymes destroyed after one use?
What is the balanced equation for the reaction of phosphoric acid and aluminum?
What is the most efficient way to convert molar mass from grams per mole (g/mol) to atomic mass units (amu) using a g/mol to amu calculator?
What compound is P2O5?
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.