0
A branches alkene of seven carbons. e.g.
CH3-CH=CH-CH(CH3)-CH2-CH3
In modern nomenclature this is 3-methyl-hex-2-ene
It is an iso-heptene.
What else can I help you with?
Continue Learning about Chemistry
Related Questions
Trending Questions
Is polyethylene glycol used in auto antifreeze?
Chemical formula for Mineral Oil?
Why do you pour water into bleach and not bleach into water?
Whats an advantage for using powdered magnesium for flash photography instead of magnesium ribbon?
How can emission spectrocopy be used to identify metal salts?
What is the most likely that there is more oxygen in water near the surface?
Which class of compounds does ammonia belong?
What foods have citric acid them science project?
Which element is in the same period as phosphorus - carbon nitrogen oxygen and magnesium?
What is a more acidic pH?
What is another word for non-reactive?
How Precipitation is used to extract sucrose from sugar cane?
How to interpret DNA gel electrophoresis results?
Liquid in which a solute dissolves?
What happens to rubidium when it is exposed to air?
Does copper have a nickname?
Is ethyl acetate bad for your health?
Is Mg2 plus A Lewis Acid or Lewis Base?
Which activity could lead to carbon monoxide poisoning and is thus illegal?
How do you remove urine smell from clothing?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.