0
A branches alkene of seven carbons. e.g.
CH3-CH=CH-CH(CH3)-CH2-CH3
In modern nomenclature this is 3-methyl-hex-2-ene
It is an iso-heptene.
What else can I help you with?
Continue Learning about Chemistry
Related Questions
Trending Questions
Would you expect the air pressure in a valley that's below sea level to be higher or lower than air pressure at sea level?
Is coconut water ferments a physical or chemical change?
Which word used to describe metals means?
What are albumin blood buffers?
Why were gold copper and silver among the earliest elements discovered?
How much potassium in tonic water?
How many unpaired electrons does copper have?
Can a element be broken down into compounds?
Does boiling water affect its pH?
Why written small c before cGMP?
What are Niobium's physical and chemical properties?
How many atoms of argon are in one mole?
What is a common use of silicon?
Why argon gas is a monoatomic gas?
What period is the name He element in?
What are insoluble solids?
How you separate aluminum and common salt?
Which of the following is true regarding hydrogen fuel cells and hydrogen fusion?
Where is oil stored?
What is the use of plutonium in a nuclear bomb?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.