0
A branches alkene of seven carbons. e.g.
CH3-CH=CH-CH(CH3)-CH2-CH3
In modern nomenclature this is 3-methyl-hex-2-ene
It is an iso-heptene.
What else can I help you with?
Continue Learning about Chemistry
Related Questions
Trending Questions
What sodas have citric acid in them?
Where can one purchase an acetylene torch?
What is the chemical formula for copper (II) sulfide?
Does the salt and ice challenge hurt?
How many atoms are present in 3.14g of Cu?
What is the percentage of sulfur in carbon disuphide?
What causes the differences in melting points and boiling points between ionic and covalent compounds molecular substances?
Why is hot tap water bad for you?
Is sulfuric acid in water a chemical change?
The electron cloud contains which atomic particles?
What are the differences between IR and UV spectroscopy and how do they each contribute to the analysis of chemical compounds?
What is one way you you can change water vapor from a gas to a liquid?
What type of reaction is PbSO4 plus Fe?
After removing the leaf from the ethanol it is put into warm water why?
The simplest and the most common monosaccharide is a six-carbon sugar called?
Is gasoline evaporating a chemical or physical change?
Type of energy transformed into thermal energy in a toaster?
Why would teenagers have toilet paper tubes stuffed with dryer sheets and a bottle of peroxide?
Is chicken cooking in a oven a physical or chemical change?
What percentage of alcohol in the body's blood determines intoxication if given a Breathalyzer test?
Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.