0
A branches alkene of seven carbons. e.g.
CH3-CH=CH-CH(CH3)-CH2-CH3
In modern nomenclature this is 3-methyl-hex-2-ene
It is an iso-heptene.
What else can I help you with?
Continue Learning about Chemistry
Related Questions
Trending Questions
Why do heavy atoms tend to undergo fission of fusion?
Is OH- a hydroxide ion?
Are purple and yellow primary colors and what do you get if you mix them together?
Why should you not drink hydrochloric acid?
What is the strongest bond between ionic and peptide?
How do coefficients affect the rate law of a chemical reaction?
Soil analysis of cations and anions?
How much acetic acid is needed to neutralize caustic soda?
When sugar can be dissolve in one cup of water?
What should the oxygen level be for LEL?
Is copper non-metal?
What role does SOCl2 play as a nucleophile in organic chemistry reactions?
Which column on the periodic table contains elements with completely filled outer energy levels?
What is the correct name for HgO compound?
How is the periodic table arranged in terms of their ato mic structures?
What elements helium neon argon and krypton have in common?
Is ruby radioactive?
Is sodium a nonmetal or a metal or a solid or a liquid?
What specific property name is water evaporating?
What is the chemical formula for Bisphenol A?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.