0
A branches alkene of seven carbons. e.g.
CH3-CH=CH-CH(CH3)-CH2-CH3
In modern nomenclature this is 3-methyl-hex-2-ene
It is an iso-heptene.
What else can I help you with?
Continue Learning about Chemistry
Related Questions
Trending Questions
What is the classification of kalium durule?
Can you mix colors and whites in the dryer?
Does paper decay?
Do glucose molecule have potential energy?
What are Six example of a chemical changes?
Is destiny a chemical or physical property?
What is the typical types of representative particles used in chemistry calculations?
What region of the world is oxygen found in?
What determines the number of different atoms of each type in a binary ionic compound?
What is the oxidation number in SO32?
What would happen if is not soluble in the solvent?
What are the 3 examples of Dilute Solution?
Is octadecane non polar?
Do dry cleaners have to pay tax on their purchase of hangers and plastic bags in NYC?
What is 34crnimo6?
Where does glycol sis take place?
Why do lipids make paper translucent?
When Salt dissolving water physical change or chemical change?
Explain why liquids and gases are easier to compress compared to solids?
What are the benefits of using an 18 10 stainless steel frying pan for cooking?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.