0
A branches alkene of seven carbons. e.g.
CH3-CH=CH-CH(CH3)-CH2-CH3
In modern nomenclature this is 3-methyl-hex-2-ene
It is an iso-heptene.
What else can I help you with?
Continue Learning about Chemistry
Related Questions
Trending Questions
Is sodium citrate citrus?
How are electrons shared in a nonpoler covalent bond?
Which type of fatty acid has hydrogen atoms located on the same side of the double bond?
Is F2 a gas at room temperature?
What is the covalent compound NF3?
Word used to describe how a smell can move around?
What is the correct relation between mass number A atomic number Z and neutron number N?
Is samurott strong?
What is the molar mass for the compound CaBr2?
How do you obtain percent yield of a reaction?
What is distillate collected?
What factors affect the properties of gases?
How many atoms are in an element MgNO3 2?
What does the color green smell like?
What is a yellow diamond called?
Is carbon tetra-fluoride a covalent or ionic compound?
What is the name for N4H8?
What household items contain nitrogen?
What is the process of separating a solid from a liquid in a heterogenous mixture?
What Chemicals are used in recycling steel?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.