0
A branches alkene of seven carbons. e.g.
CH3-CH=CH-CH(CH3)-CH2-CH3
In modern nomenclature this is 3-methyl-hex-2-ene
It is an iso-heptene.
What else can I help you with?
Continue Learning about Chemistry
Related Questions
Trending Questions
Where should propane tanks be stored?
How can I effectively clean copper pots using vinegar?
What is the molecular structure of HCl?
What is the boiling point of a celsius scale?
What elements is the most reactive metals?
What is the name of the area of science that studies tiny particles like atoms?
How many covalent bonds does the molecule O2 have?
Is phosphate the same as oil?
What Atoms from which two elements would form ionic bonds?
What is methamophism?
What is the difference between ignition temperature and flash point, and how do they affect the safety of a substance?
Why does a wet covering on a canteen keep the water cool?
What is a radioactive particle that is made up of two neutrons and two protons?
What kind of testing can the Bunsen burner be used for?
What are facts on matter?
Anhydride with ethylene glycol versus phthalic anhydride with glycerol?
How much salt do you use to make salt water?
What does nitrates test for?
How do the PH levels of stomach acid effect the enamel on teeth?
Atomicity of gold?
Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.