0
A branches alkene of seven carbons. e.g.
CH3-CH=CH-CH(CH3)-CH2-CH3
In modern nomenclature this is 3-methyl-hex-2-ene
It is an iso-heptene.
What else can I help you with?
Continue Learning about Chemistry
Related Questions
Trending Questions
Is element Hf a Metal?
How is silver purified?
How do you get her sexually excited?
What is the chemical formula for club soda?
What is the difference between lyase and ligase enzymes in terms of their functions and mechanisms of action?
Which of the following substances is often used to develop latent fingerprints?
Does dissolving honey in water give a cloudy solution?
Which types of intermolecular forces can exist between molecules of iodine (I2)?
What happens when a piece of aluminum metal is added to dilute hydrochloric acid?
Which kind of force is a dipole force?
What are the oxidation states of halogens?
Sweeteners - artificial?
What is C3PO chemical formula?
Which pellets are called green?
What is the reaction equation for water and sodium carbonate?
What is the molarity of 15 g NaOH in a 100 L aqueous solution?
Why are some water bottles squishy?
How do you get white marks out of black jeans?
What is scooping in chemistry?
What is the force of attraction between cations and anions?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.