Pinacol is the common name for a dihydric alcohol having I.U.P.A.C. name
2,3-dimethyl-2,3-butadiol
A secondary alcohol can be converted to a tertiary alcohol by subjecting it to an acid-catalyzed rearrangement reaction known as a pinacol rearrangement. In this process, the secondary alcohol undergoes a rearrangement to form a more stable tertiary alcohol through a carbocation intermediate.
Addition Reactions - involve the conversion of a π bond into 2 new σ bonds General form: A + B → C Eg. CH3-CH=CH-CH3 + HCl → CH3-CH2-CHCl-CH3 Substitution Reactions - involve the no change in bonding - one σ bond replaces another General form: A + B → C + D Eg. CH3-CHBr-CH2-CH3 + KOH(aq) → CH3-CH(OH)-CH2-CH3 + KBr Elimination Reactions - reverse of addition, in that two σ bonds are lost, replaced by a new π bond General form: A → B + C Eg. CH3-CH(OH)-CH2-CH3 -- conc. H2SO4 --> CH3-CH=CH-CH3 + H2O Rearrangement / Isomerisation - process in which a single substance changes structure, A → B. Such a reaction may involve changes in bond / type, though this is not necessary. These reactions are comparatively rare. Eg. CH3-CH2-CH2-C(OH)=CH2 → CH3-CH2-CH2-C(=O)-CH3 These are the four "prototypical" reactions, though several others which can be categorised as one of these are generally referred to by other names. Eg. CH3-CH(OH)-CH3 -- H2SO4 / K2Cr2O7 --> CH3-C(=O)-CH3 could be described as an elimination reaction, but would usually be called an oxidation Eg. CH3-C(=O)-CH3 -- 1. LiAlH4 2. H^+ / H2O --> CH3-CH(OH)-CH3 could be described as a (nucleophilic) addition reaction, but would usually be called a reduction Eg. CH3-C(=O)-OH + CH3-OH -- H2SO4 / Δ / reflux --> CH3-C(=O)-O-CH3 + H2O could be described as a substitution reaction, but would usually be called a condensation Another important category of organic reactions are straight-forward Lowry-Bronsted acid-base reactions: Eg. (CH3-CH2)3N + HCl → (CH3-CH2)3NH^+ + Cl^- Note that there are also some reactions that are difficult to characterise in a simple way, like the following reactions requiring catalysis: stilbene + ethylene → styrene C6H5-CH=CH-C6H5 + CH2=CH2 → 2 C6H5-CH=CH2 but-1-yne + water → butanone CH3-CH2-C≡CH + H2O → CH3-CH2-C(=O)-CH3 (this is actually an addition reaction followed by an isomerisation) CH3-CH2-C(=O)-CH3 + NH2-OH → CH3-CH2-C(=N-OH)-CH3 + H2O the pinacol to pinacolone rearrangement CH3-C(CH3)(OH)-C(CH3)(OH)-CH3 → CH3-C(CH3)2-C(=O)-CH3 which is an elimination reaction that involves an isomerisation ... I add these last few just to illustrate that the general types are a useful tool / guide for understanding organic chemistry, but they are not the be-all and end-all.
This reaction was first described by Wilhelm Rudolph Fitting in 1860. the pinacol rearrangement or pinacolone rearrangement is a method for converting a 1,2-diol to a carbanyly compound in a organic chemistry. This 1,2 rearrangement take place under acidi condition. the name reaction come from the rearrangement of pinacol to pinacolone.
Comes from greek word 'pinax'
I don't really understand your question but pinacol (a diol) rearranges itself to form a carbonyl compound under acidic conditions. One of the OH groups becomes protonated and leaves as H2O forming a tertiary carbocation. A methyl group migrates over to the carbocation leaving a positive charge on the carbon with the remaining OH group. One of the lone pairs on the oxygen forms a double bond with the carbon. The proton on the oxygen then leaves to form a carbonyl compound called pinacolone. Check this out for more info. http://en.wikipedia.org/wiki/Pinacol_rearrangement
A secondary alcohol can be converted to a tertiary alcohol by subjecting it to an acid-catalyzed rearrangement reaction known as a pinacol rearrangement. In this process, the secondary alcohol undergoes a rearrangement to form a more stable tertiary alcohol through a carbocation intermediate.
Addition Reactions - involve the conversion of a π bond into 2 new σ bonds General form: A + B → C Eg. CH3-CH=CH-CH3 + HCl → CH3-CH2-CHCl-CH3 Substitution Reactions - involve the no change in bonding - one σ bond replaces another General form: A + B → C + D Eg. CH3-CHBr-CH2-CH3 + KOH(aq) → CH3-CH(OH)-CH2-CH3 + KBr Elimination Reactions - reverse of addition, in that two σ bonds are lost, replaced by a new π bond General form: A → B + C Eg. CH3-CH(OH)-CH2-CH3 -- conc. H2SO4 --> CH3-CH=CH-CH3 + H2O Rearrangement / Isomerisation - process in which a single substance changes structure, A → B. Such a reaction may involve changes in bond / type, though this is not necessary. These reactions are comparatively rare. Eg. CH3-CH2-CH2-C(OH)=CH2 → CH3-CH2-CH2-C(=O)-CH3 These are the four "prototypical" reactions, though several others which can be categorised as one of these are generally referred to by other names. Eg. CH3-CH(OH)-CH3 -- H2SO4 / K2Cr2O7 --> CH3-C(=O)-CH3 could be described as an elimination reaction, but would usually be called an oxidation Eg. CH3-C(=O)-CH3 -- 1. LiAlH4 2. H^+ / H2O --> CH3-CH(OH)-CH3 could be described as a (nucleophilic) addition reaction, but would usually be called a reduction Eg. CH3-C(=O)-OH + CH3-OH -- H2SO4 / Δ / reflux --> CH3-C(=O)-O-CH3 + H2O could be described as a substitution reaction, but would usually be called a condensation Another important category of organic reactions are straight-forward Lowry-Bronsted acid-base reactions: Eg. (CH3-CH2)3N + HCl → (CH3-CH2)3NH^+ + Cl^- Note that there are also some reactions that are difficult to characterise in a simple way, like the following reactions requiring catalysis: stilbene + ethylene → styrene C6H5-CH=CH-C6H5 + CH2=CH2 → 2 C6H5-CH=CH2 but-1-yne + water → butanone CH3-CH2-C≡CH + H2O → CH3-CH2-C(=O)-CH3 (this is actually an addition reaction followed by an isomerisation) CH3-CH2-C(=O)-CH3 + NH2-OH → CH3-CH2-C(=N-OH)-CH3 + H2O the pinacol to pinacolone rearrangement CH3-C(CH3)(OH)-C(CH3)(OH)-CH3 → CH3-C(CH3)2-C(=O)-CH3 which is an elimination reaction that involves an isomerisation ... I add these last few just to illustrate that the general types are a useful tool / guide for understanding organic chemistry, but they are not the be-all and end-all.