0
What else can I help you with?
What is the chemical formulas for Iodine Crystals?
Formula: I2
What is the chemical name for formula?
chemical formula
The chemical formula for glucose is?
The chemical formula for glucose is C6H12O6.
What is the chemical formula for CF?
The chemical formula for CF is carbon monofluoride.
What is the chemical formula for Fructos?
The chemical formula for Fructose is C6H12O6
What is the chemical formulas for Iodine Crystals?
Formula: I2
What is an augelite?
An augelite is a mineral with monoclinic crystals, with the chemical formula Al2(PO4)(OH)3.
Is marble a smooth and contains shiny crystals?
Marble (with the chemical formula CaCO3) is a crystalline material.
What is the chemical formula for a cloud?
A cloud is composed of water droplets or ice crystals suspended in the atmosphere. So, the chemical formula for a cloud would be H2O (water) or H2O2 (hydrogen peroxide) when in the form of ice crystals.
What is zoisite?
Zoisite is a mineral with orthorhombic crystals, chemical formula Ca2Al3(SiO4)(Si2O7)O(OH).
What is the chemical formula for native selenium?
The chemical formula for element selenium is indicated by se. Native selenium is a rare mineral which does not usually forms good crystals. Hence it is used in the manufacture of specimens
What is the chemical formula of the liquid crystals used in LCD?
The liquid crystals used in LCDs do not have a single chemical formula, as they can be made from various compounds. However, common liquid crystal molecules include mixtures of organic compounds such as p-ethoxybenzylidene-p'-n-butylaniline (EBBA) or 4-cyano-4'-pentylbiphenyl (5CB).
What is autunite?
Autunite is a yellow mineral with tetragonal crystals, chemical formula Ca(UO2)2(PO4)2·10-12H2O.
What is the formula of iodine crystals?
Iodine exists as I2. The crystal of iodine is formed simply by the interaction of iodine molecules as a result of Van de Waals forces, which allows for these molecules to bond together to form a solid.
What is the formula for potassium floride?
The chemical formula of potassium ferrocyanide is K4[Fe(CN)6].3H2O; the crystals are monoclinic.
Chemical formula for drano?
Drano crystals contain 30-60% sodium hydroxide (NaOH) and 15-40% sodium nitrate (NaNO3).
What is the formula for copper sulfate crystals How much water do the 'home grown' crystals contain?
Well the formula is CuSO4
