0
The chemical formula for Amyl cinnamal, which I am pretty positive is the same substance as Hexyl cinnamal is C15H20O.
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
Is Hexyl Cinnamal ionic or covalent?
Ionic
What is the condensed structural formula of hexyl acetate?
Ch3c(=o)(-o-)ch2ch2ch2ch2ch2ch3
What is the chemical name for formula?
chemical formula
What is the chemical formula for SnCl4?
That is the chemical formula. SnCl4 is the chemical formula for tin(IV) chloride.
What are the examples of salt and their chemical formula?
Copper sulfate, chemical formula CuSO4Sodium chloride, chemical formula NaClSodium chromate, chemical formula H2CrO4Mercury sulfide, chemical formula HgSCalcium carbonate,CaCO3
Is Hexyl Cinnamal ionic or covalent?
Ionic
Is hexyl cinnamal an acid?
Hexyl cinnamal, also known as hexyl cinnamaldehyde, is not an acid. It is an organic compound known as an aldehyde, which is a type of carbonyl compound. It is commonly used as a fragrance ingredient in cosmetics and personal care products.
What is the condensed structural formula of hexyl acetate?
Ch3c(=o)(-o-)ch2ch2ch2ch2ch2ch3
How do you draw hexyl acetate?
Hexyl acetate or hexyl ethanoate: CH3COOCH2CH2CH2CH2CH2CH3
What is the formula for chemical energy?
Energy has no chemical formula as it is not a chemical.
What is the chemical name for formula?
chemical formula
What is the chemical formula for SnCl4?
That is the chemical formula. SnCl4 is the chemical formula for tin(IV) chloride.
What are the examples of salt and their chemical formula?
Copper sulfate, chemical formula CuSO4Sodium chloride, chemical formula NaClSodium chromate, chemical formula H2CrO4Mercury sulfide, chemical formula HgSCalcium carbonate,CaCO3
Is CO2 an example of a chemical equation or a chemical formula?
It is a chemical formula.
What is chemical formula for soap nut powder?
it has no chemical formula. it is a mixture. only compounds have a chemical formula.
What is chemical formula for cysteine?
The chemical formula of cysteine is HO2CCH(NH2)CH2SH.
What is the chemical composition of cassia auriculata?
di-(2-ethyl) hexyl phthalate (1) is the Chemical composition of Cassia Auriculata. I found this information from http://www.diatea.com . There is more information about the Cassia Auriculata FLowers in this website. Check it out.
