answersLogoWhite

0

The IUPAC name of this 'khat'-like (cathinone) drug is

(±)-1-(4-methylphenyl)-2-methylaminopropan-1-oneformula and group names beneath it between (..) marks

CH3-(paraC6H4)-C(=O)-CH(CH3)-(NHCH3)

(methyl...phenyl....propan-1-on.....methylamino)

User Avatar

Wiki User

15y ago

What else can I help you with?

Related Questions

What in mdma?

MDMA is an abbreviation for 3,4-Methylenedioxymethamphetamine which is one single chemical. (C11H15NO2) Just like Water is name for the chemical dihydrogenmonoxide. (chemical formula: H2O) Ecstasy is the name for 3,4-Methylenedioxymethamphetamine (MDMA for short) (Chemical formula: C11H15NO2) They are their own chemicals. For example if someone gives you a bottle of alcohol and calls it water they are lying or they don't know what water is, just like if someone gives you something that isn't MDMA and call it Ecstasy, they are lying or they don't know what Ecstasy is.


From what chemical did ecstasy made from?

MDMA (methalynedioxymethamphetamine)


Scientific name of ecstasy?

Ecstasy is MDMA which stands for the chemical name of 3,4-methylenedioxy-methamphetamine.


Does mdpv have ecstasy in it and is it legal?

MDPV is a completely different and separate chemical from ecstasy (MDMA), and is schedule I (no legal use) in the US


What is the formula for chemical energy?

Energy has no chemical formula as it is not a chemical.


What is the chemical name for formula?

chemical formula


The chemical formula for glucose is?

The chemical formula for glucose is C6H12O6.


What is the chemical formula for a ribose?

the chemical formula for a ribose is C12H22O11.


What is the chemical formula of mannose?

The chemical formula of mannose is C6H12O6.


What is the chemical formula for CF?

The chemical formula for CF is carbon monofluoride.


What is the chemical formula for Fructos?

The chemical formula for Fructose is C6H12O6


What is the chemical formula for ethanal?

The chemical formula of ethanal (acetic aldehyde) is CH3CHO.