The name of this compound is cobalt sulfide.
'CoS' is Cobalt sulphide . NOT as you correspondent put it as 'Carbon Monoxide'. Carbon monoxide formula is 'CO'.
The oxidation number for Co in CoS is +2, a divalent cobalt cation, since the only anion formed from a single sulfur atom has a charge of -2.
The electronegativity of Co is 1.9 The electronegativity of S is 2.6 The difference in electronegativities is 2.6 - 1.9 which = 0.7 Generally, the type of bond is characterized by the electronegativity difference according to the following: electronegativity difference: 4.0 1.7 0.3 0.0 |-----ionic-----------|--polar--------|-nonpolar| Yes CoS is an ionic compound. A compound which is formed by a metal (such as cobalt) and a nonmetal (such as sulfur) is an ionic compound.
cos
The chemical formula for cobalt(II) sulfide is CoS. It consists of one cobalt atom and one sulfur atom.
carbon oxide
'CoS' is Cobalt sulphide . NOT as you correspondent put it as 'Carbon Monoxide'. Carbon monoxide formula is 'CO'.
The chemical formula for the compound of cobalt and sulfur is CoS (cobalt monosulfide).
Aluminium oxide is a compound 'cos it's made of 2 kinds of atoms. If it has to be an element, it has to be made of same kind of atoms like graphite/diamond/H2(gas).
You need to know the trigonometric formulae for sin and cos of compound angles. sin(x+y) = sin(x)*cos(y)+cos(x)*sin(y) and cos(x+y) = cos(x)*cos(y) - sin(x)*sin(y) Using these, y = x implies that sin(2x) = sin(x+x) = 2*sin(x)cos(x) and cos(2x) = cos(x+x) = cos^2(x) - sin^2(x) Next, the triple angle formulae are: sin(3x) = sin(2x + x) = 3*sin(x) - 4*sin^3(x) and cos(3x) = 4*cos^3(x) - 3*cos(x) Then the left hand side = 2*[3*sin(x) - 4*sin^3(x)]/sin(x) + 2*[4*cos^3(x) - 3*cos(x)]/cos(x) = 6 - 8*sin^2(x) + 8cos^2(x) - 6 = 8*[cos^2(x) - sin^2(x)] = 8*cos(2x) = right hand side.
The oxidation number for Co in CoS is +2, a divalent cobalt cation, since the only anion formed from a single sulfur atom has a charge of -2.
Cos(Theta) X Cos(Theta) = Cos^(2)[Theta].
Cos times Cos
No. Cos squared x is not the same as cos x squared. Cos squared x means cos (x) times cos (x) Cos x squared means cos (x squared)
The electronegativity of Co is 1.9 The electronegativity of S is 2.6 The difference in electronegativities is 2.6 - 1.9 which = 0.7 Generally, the type of bond is characterized by the electronegativity difference according to the following: electronegativity difference: 4.0 1.7 0.3 0.0 |-----ionic-----------|--polar--------|-nonpolar| Yes CoS is an ionic compound. A compound which is formed by a metal (such as cobalt) and a nonmetal (such as sulfur) is an ionic compound.
cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.
3cos