answersLogoWhite

0

The name of this compound is cobalt sulfide.

User Avatar

Wiki User

13y ago

What else can I help you with?

Related Questions

What is the name for the compound CoS?

carbon oxide


What is the name of the compound CoS?

'CoS' is Cobalt sulphide . NOT as you correspondent put it as 'Carbon Monoxide'. Carbon monoxide formula is 'CO'.


What is the chemical formula for the compound cobalt and the sulfur ion?

The chemical formula for the compound of cobalt and sulfur is CoS (cobalt monosulfide).


Is aluminium oxide an element or compound?

Aluminium oxide is a compound 'cos it's made of 2 kinds of atoms. If it has to be an element, it has to be made of same kind of atoms like graphite/diamond/H2(gas).


How do you prove that 2 sin 3x divided by sin x plus 2 cos 3x divided by cos x equals 8 cos 2x?

You need to know the trigonometric formulae for sin and cos of compound angles. sin(x+y) = sin(x)*cos(y)+cos(x)*sin(y) and cos(x+y) = cos(x)*cos(y) - sin(x)*sin(y) Using these, y = x implies that sin(2x) = sin(x+x) = 2*sin(x)cos(x) and cos(2x) = cos(x+x) = cos^2(x) - sin^2(x) Next, the triple angle formulae are: sin(3x) = sin(2x + x) = 3*sin(x) - 4*sin^3(x) and cos(3x) = 4*cos^3(x) - 3*cos(x) Then the left hand side = 2*[3*sin(x) - 4*sin^3(x)]/sin(x) + 2*[4*cos^3(x) - 3*cos(x)]/cos(x) = 6 - 8*sin^2(x) + 8cos^2(x) - 6 = 8*[cos^2(x) - sin^2(x)] = 8*cos(2x) = right hand side.


What is the oxidation number of Co in CoS?

The oxidation number for Co in CoS is +2, a divalent cobalt cation, since the only anion formed from a single sulfur atom has a charge of -2.


What is cos square?

Cos times Cos


Is cos squared x the same as cos x squared?

No. Cos squared x is not the same as cos x squared. Cos squared x means cos (x) times cos (x) Cos x squared means cos (x squared)


What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?

cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.


Cos plus cos plus cos?

3cos


Is COS considered both ionic and covalent bonds?

The electronegativity of Co is 1.9 The electronegativity of S is 2.6 The difference in electronegativities is 2.6 - 1.9 which = 0.7 Generally, the type of bond is characterized by the electronegativity difference according to the following: electronegativity difference: 4.0 1.7 0.3 0.0 |-----ionic-----------|--polar--------|-nonpolar| Yes CoS is an ionic compound. A compound which is formed by a metal (such as cobalt) and a nonmetal (such as sulfur) is an ionic compound.


Cos x - cos x sin2 x equals cos3x?

cos(x)-cos(x)sin2(x)=[cos(x)][1-sin2(x)]cos(x)-cos(x)sin2(x)=[cos(x)][cos2(x)]cos(x)-cos(x)sin2(x)=cos3(x)