0
+6: Oxygen in oxyanions is assumed to have an oxidation state of -2; there are four such oxygen atoms, for a total of -8, and the SO4 anion has a charge of -2. This means that the sulfur atom must have an oxidation state of +6, because +6 added to - 8 = -2.
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
What is the oxidation number of O in SO4?
Oxygen atoms are generally considered to have an oxidation number of -2 in all oxyanions such as sulfate.
What is the oxidation number for Al2O3?
+3 for Al and -2 for O is the oxidation number for Al2O3.
What is the oxidation number of Cr in Cr2(SO4)3?
Chromium is a useful element. It shows +2 in this compound.
What is Oxidation numbers for SO4?
This should be SO4-2 ion. sulfur shows +6 in this ion.
What is the oxidation numbers for SO4?
This should be SO4-2 ion. sulfur shows +6 in this ion.
What is the oxidation number of O in SO4?
Oxygen atoms are generally considered to have an oxidation number of -2 in all oxyanions such as sulfate.
What is the oxidation number for Al2O3?
+3 for Al and -2 for O is the oxidation number for Al2O3.
What is the oxidation number of Cr in Cr2(SO4)3?
Chromium is a useful element. It shows +2 in this compound.
What is the oxidation numbers for SO4?
This should be SO4-2 ion. sulfur shows +6 in this ion.
What is Oxidation numbers for SO4?
This should be SO4-2 ion. sulfur shows +6 in this ion.
WHAT IS THE OXIDATION NUMBER OF AL2(SO4)3?
Aluminium is a light metal. Al shows +3 in aluminium sulfate.
What is the new oxidation number for cr2o7-2 plus 8h plus 3so3-2 2cr3 plus 3sov-2 plus 4h20?
oxidation number of S is +6.It oxidize into SO4 ^-2
What is the oxidation number of S in the compound Na2 SO4?
This is a ionic compound too. Sulfur shows +6 in sulfate ion.
What is the oxidation number of Ca So4?
Since the SO4-2 ions have two negative charges and oxygen atoms in almost all compounds have two negative charges each, the sulfur atoms have an oxidation number of -2 -4(-2) = +6.
What is the oxidation state of each element in (SO4)2-?
SO4^2- has a net negative 2 charge.each O = 2-S = 6+
What is the oxidation state of ZnSO4?
zn is equal to +2 and so4 is equal to -2. those are the oxidation numbers. dont worry its correct
Balance an equation by oxidation method?
k2cr2o7+FeSO4+H2SO4 --> Cr2(SO4)3+Fe2(SO4)3+K2SO4+H2O
