0
Ch3CH(OH)(CH2)3CH3
What else can I help you with?
Why 1-hexanol has higher boiling point than 3-hexanol?
1-Hexanol has a higher boiling point than 3-hexanol because 1-hexanol has a straight chain structure that allows for stronger intermolecular interactions such as hydrogen bonding. In contrast, 3-hexanol has a branched chain structure which disrupts the formation of hydrogen bonds, leading to weaker intermolecular forces and a lower boiling point.
Why is 4-hexanol an incorrect name....what is the correct name for this alcohol?
It is incorrect because the OH should always be on the lowest carbon number (You can number from either end: Left or Right) The correct name (counting from right to left) would be 3-hexanol Counting from the left the OH is on Carbon 4 Counting from the Right it is on Carbon 3 You use the smallest number... H H H OH H H | | | | | | H - C - C - C - C - C - C - H | | | | | | H H H H H H
Structural formula of 3-chloro 2-methyl 1-butanol?
A structural formula diagram of 3-chloro-2-methyl-1-butanol would include HO with a line drawn from it. Attached to the line would be offshoots which represented the methyl and butanol.
What are the possible isomers for C6H12O?
There are 5 different carbon backbone structures including benzine that are possible isomers of C6H12O. Of these 5, the benzine ring can only form -OH compounds with the formula C6H12O so there is only one benzine isomer. The linear carbon chain can form 3 different isomers with a double bonded oxygen; an aldehyde and 2 ketones (on the first, second, or third carbon). It can also form 15 different alkene isomers with an -OH functional group (hyrdoxyl) in different positions on the chain and a double bond on the first, second or third carbon in the chain. This gives 18 total possible isomers of C6H12O with the linear 6 carbon chain. There are two variation with a five carbon chain and a methyl group on the second and the third carbon in the chain. There is a 4 carbon chain variation with an ethyl on the second carbon in the chain. Both the five and four carbon chain variations can make different isomers with a double bonded oxygen in various locations and alkene variations with a double bond in the carbon chain and an -OH functional group (hyrdoxyl) in different positions on the chains. Over all there are over 60 different isomers of C6H12O that are possible.
What is C6h12OH?
It is an alcohol, with the name 'Hexanol'. However, it then depends on the position in the chain of the alcohol functional group. So you can have Hexan-1-ol ( on the end carbon_ Hexan-2-ol ( on the 2nd. carbon in the chain) Hexan-3-ol ( on the 3rd. carbon in the chain). There is neither hexan-4-ol, nor hexan-5-ol , because they are mirror images of '-2ol' and '-3ol'. Structures Hexan-1-ol CH3-CH2-CH2-CH2-CH2-CH2OH Hexan-2-ol CH3-CH2-CH2-CH2-CH(OH)-CH3 Hexan-3-ol CH3-CH2-CH2-CH(OH)-CH2-CH3
Why 4-hexanol incorrect name?
The name "4-hexanol" is incorrect because it does not follow the IUPAC nomenclature rules for numbering carbon atoms in a chain. In this case, "hexanol" implies a six-carbon chain with an alcohol functional group, but the numbering should start from the end nearest the functional group. If the alcohol is on the fourth carbon, the proper name would actually be "2-hexanol" or "3-hexanol," depending on the structure. Thus, the correct name should reflect the position of the hydroxyl group accurately.
Why 1-hexanol has higher boiling point than 3-hexanol?
1-Hexanol has a higher boiling point than 3-hexanol because 1-hexanol has a straight chain structure that allows for stronger intermolecular interactions such as hydrogen bonding. In contrast, 3-hexanol has a branched chain structure which disrupts the formation of hydrogen bonds, leading to weaker intermolecular forces and a lower boiling point.
Lucas' reagent reaction with 3-methyl-1-hexanol?
In the Lucas reagent test, 3-methyl-1-hexanol would react through an SN1 mechanism where the hydroxyl group is replaced by a chlorine atom, forming 3-chloro-3-methylhexane. The reaction rate depends on the stability of the carbocation intermediate, which for secondary alcohols like 3-methyl-1-hexanol is faster compared to primary alcohols.
Why is 4-hexanol an incorrect name....what is the correct name for this alcohol?
It is incorrect because the OH should always be on the lowest carbon number (You can number from either end: Left or Right) The correct name (counting from right to left) would be 3-hexanol Counting from the left the OH is on Carbon 4 Counting from the Right it is on Carbon 3 You use the smallest number... H H H OH H H | | | | | | H - C - C - C - C - C - C - H | | | | | | H H H H H H
Is 2-bromo-3-methyl-3-hexanol secondary?
Yes, 2-bromo-3-methyl-3-hexanol is classified as a secondary alcohol. In this compound, the hydroxyl (-OH) group is attached to a carbon that is bonded to two other carbon atoms, which characterizes it as secondary. The presence of the bromo group at the second position and the methyl group at the third position does not change the classification of the alcohol.
What is structural formula of 3-oxopentanal?
The structural formula of 3-oxopentanal is CH3CH2CH2COCHO.
What is the Structural formula for 3-methyl-1-butene?
structural formula of c5h10
What is the structural formula of 3 pentanone?
Ch3ch2coch2ch3
What are the 3 structural adaptations of chameleon?
eyes skin tongue
What are the types of disequilibrium in bop?
There are 3 types of disequilibrium's in balance of payments:- 1) cyclical disequilibrium 2) secular disequilibrium 3) structural disequilibrium structural disequilibrium at:-a) goods level b) at factors level
What is the structural formula for 3-heptanol?
The structural formula for 3-heptanol is CH3(CH2)5CH(OH)CH3. It has a chain of 7 carbon atoms with a hydroxyl group (OH) attached to the third carbon atom.
Are Inherited behaviors that help animals survive are called structural adaptations?
nope there called behavioural adaptations. there are 3 kinds of adaptations: structural behavioural physiological
