answersLogoWhite

0

4-methyl-4-nonene

CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3

The (CH3) is a methyl group stemming from the CH just before it (#4).

- single bond

= double bond.

User Avatar

Wiki User

15y ago

What else can I help you with?

Related Questions

What is meant by a structure within a structure?

A structure that is a member of another structure is a structure within a structure.


What is the difference between a matrix structure and a organisational structure?

the difference between an organisational structure and a matrix structure is that a matrix structure is a combined structure whereas an organisational structure is in a vertical order and has different levels.


Can you give a hard science question?

What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.


Differentiate the four types of protein structure?

Primary structure: The linear sequence of amino acids in a protein. Secondary structure: Local folding patterns such as alpha helices and beta sheets. Tertiary structure: Overall 3D shape of a single protein molecule. Quaternary structure: Arrangement of multiple protein subunits in a complex.


What is surface structure in engineering?

surface structure is a structure at the surface


What is the difference between hierarchy and matrix structure?

There are more people in the hierarchical structure then the matrix structure. The matrix structure is more complex than the hierarchical structure


Organisational structure of reliance fresh?

reliance fresh structure reliance fresh structure reliance fresh structure


What is the difference between the structure tag and structure variable?

The structure tag is a type. The structure variable is an instance of that type.


What is a hotel structure?

hotel structure is a structure composes of many organizations


What is the structure of to celia?

Celia does not have a structure. It is the only cell part that does not have a structure.


What is capital structure decisions?

capital structure decisions are structure with decisions


What does structure you?

cells structure you