4-methyl-4-nonene
CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3
The (CH3) is a methyl group stemming from the CH just before it (#4).
- single bond
= double bond.
The IUPAC name of a compound with the structure "structure to IUPAC name converter" is not provided as it is not a valid chemical structure. Please provide a specific chemical structure for accurate naming.
Collagen is a primary protein structure, composed of three polypeptide chains that form a unique triple helical structure. This triple helical structure is considered the primary structure of collagen.
What sentence structure is this? - It is a simple structure for an interrogative sentence.
A crystalline structure refers to the arrangement of atoms in a material, while a crystal structure specifically refers to the arrangement of atoms in a crystal. In other words, all crystals have a crystalline structure, but not all materials with a crystalline structure form crystals.
structure is the shape of anything
A structure that is a member of another structure is a structure within a structure.
the difference between an organisational structure and a matrix structure is that a matrix structure is a combined structure whereas an organisational structure is in a vertical order and has different levels.
What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.What is the DNA structure of a brontosaurus.
Primary structure: The linear sequence of amino acids in a protein. Secondary structure: Local folding patterns such as alpha helices and beta sheets. Tertiary structure: Overall 3D shape of a single protein molecule. Quaternary structure: Arrangement of multiple protein subunits in a complex.
surface structure is a structure at the surface
There are more people in the hierarchical structure then the matrix structure. The matrix structure is more complex than the hierarchical structure
reliance fresh structure reliance fresh structure reliance fresh structure
The structure tag is a type. The structure variable is an instance of that type.
hotel structure is a structure composes of many organizations
Celia does not have a structure. It is the only cell part that does not have a structure.
capital structure decisions are structure with decisions
cells structure you