answersLogoWhite

0

CH is a covalent bond, specifically a single covalent bond between the carbon and hydrogen atoms. This type of bond involves the sharing of electrons between the atoms.

User Avatar

AnswerBot

∙ 2y ago

What else can I help you with?

Related Questions

Is CH single bond or double bond?

CH compound does not exist. So it has no bonds.


What type of bond is in a lipid?

Nonpolar CH bonds. Ester linkages occur.


What type of bond is CHOH?

CH-OH is a covalent bond. In this bond, carbon shares electrons with oxygen and hydrogen to form a molecular structure.


What is the correct name for the compound CH3CH2CH(DOUBLE BOND)CH-CH2-CH(DOUBLE BOND)CH-CH?

You think probable to cycloocta-1,5-diene.


In organic chemistry what kind of bond is a peptide bond?

This type of bond exists in proteins, it is amide bond formed between nitrogen atom of one molecule and carbonyl carbon of 2nd molecule , as R-CO-NH-CH(R)-CO-


What is the structural and bond line formula for but-1-ene?

But-1-ene is an alkene with the molecular formula C₄H₈. Its structural formula can be represented as CH₂=CH-CH₂-CH₃, indicating a double bond between the first and second carbon atoms. The bond line formula, which simplifies the representation, is depicted as a zigzag line starting from the left, with the first carbon having a double bond to the second carbon.


What are CH and OH bonds?

Ch and OH bonds are covalent in nature. Ch bond is non -polar while OH bond is polar covalent bond.


What is the structural formula of propyne?

The chemical formula of propyne is CH3C≡CH.


Is C and H in methane CH4 an example of a hydrogen bond?

No, the bond between carbon and hydrogen in methane (CH₄) is a covalent bond, not a hydrogen bond. A hydrogen bond is a type of intermolecular force that occurs between a hydrogen atom bonded to a highly electronegative atom (like oxygen or nitrogen) and a neighboring electronegative atom.


What is the of 4 4?

4-methyl-4-nonene CH3-CH2-CH2-CH(CH3)=CH-CH2-CH2-CH2-CH3 The (CH3) is a methyl group stemming from the CH just before it (#4). - single bond = double bond.


What is angle between ch bond in alkane?

The bond angle between two CH bonds in an alkane is approximately 109.5 degrees. This is because the bonds are arranged tetrahedrally around the carbon atom, resulting in a bond angle of 109.5 degrees.


What type of compound is ch-o-ch-ch-ch?

The compound CH-O-CH-CH-CH is an ether, which is a type of organic compound containing an oxygen atom bonded to two carbon atoms in an alkyl chain. Ethers are characterized by the -O- functional group.