No, mostly this is the formula of the hexose monomeric unit of polymeres like cellulose, starch, or other polyglucans, polymannans, polyfructans etc.
C6H10O5-(C6H10O5)n-C6H12O6
Remember: hexa means six in Greek language
The formula that represents an aldehyde is c) C2H4O. Aldehydes have the general formula RCHO, where R is an alkyl or aryl group.
The formula for an aldehyde is c) C2H4O. Aldehydes have the functional group -CHO, and this formula fits that description.
The general formula for an aldehyde is RCHO, where R represents an alkyl or aryl group. This functional group consists of a carbonyl group (C=O) bonded to a hydrogen atom and a substituent attached to the carbonyl carbon.
The pair of formulas that represents the same compound is H2O and H-O-H. Both formulas represent a water molecule, where one oxygen atom is connected to two hydrogen atoms.
BaI2 is ionic. Rest are covalent compounds.
C2h4o
The formula that represents an aldehyde is c) C2H4O. Aldehydes have the general formula RCHO, where R is an alkyl or aryl group.
The formula for an aldehyde is c) C2H4O. Aldehydes have the functional group -CHO, and this formula fits that description.
The formula that represents an aldehyde should be R-CHO. An aldehyde contains a carbonyl center bonded to an R group and a Hydrogen atom.
C2h4o
If you want to ask questions about the "following", then I suggest that you make sure that there is something that is following.
The general formula for an aldehyde is RCHO, where R represents an alkyl or aryl group. This functional group consists of a carbonyl group (C=O) bonded to a hydrogen atom and a substituent attached to the carbonyl carbon.
The pair of formulas that represents the same compound is H2O and H-O-H. Both formulas represent a water molecule, where one oxygen atom is connected to two hydrogen atoms.
You can do it as a decimal or with the percent sign. So both of the following formulas will do the same thing:=A3*12%=A3*0.12You can do it as a decimal or with the percent sign. So both of the following formulas will do the same thing:=A3*12%=A3*0.12You can do it as a decimal or with the percent sign. So both of the following formulas will do the same thing:=A3*12%=A3*0.12You can do it as a decimal or with the percent sign. So both of the following formulas will do the same thing:=A3*12%=A3*0.12You can do it as a decimal or with the percent sign. So both of the following formulas will do the same thing:=A3*12%=A3*0.12You can do it as a decimal or with the percent sign. So both of the following formulas will do the same thing:=A3*12%=A3*0.12You can do it as a decimal or with the percent sign. So both of the following formulas will do the same thing:=A3*12%=A3*0.12You can do it as a decimal or with the percent sign. So both of the following formulas will do the same thing:=A3*12%=A3*0.12You can do it as a decimal or with the percent sign. So both of the following formulas will do the same thing:=A3*12%=A3*0.12You can do it as a decimal or with the percent sign. So both of the following formulas will do the same thing:=A3*12%=A3*0.12You can do it as a decimal or with the percent sign. So both of the following formulas will do the same thing:=A3*12%=A3*0.12
propane
BaI2 is ionic. Rest are covalent compounds.
NO