answersLogoWhite

0

Subjects
>
Science
>
Chemistry

Chemistry

Delve into the study of matter, its properties, composition, structure, and the changes it undergoes during chemical reactions. Chemistry is the central science connecting other scientific disciplines.

221k
Questions
Q: Why does this criss cross method give is a valid formula for an ionic compound
1 answer
Q: Why does copper carbonate decompose easily
1 answer
Q: What do Stoichiometry calculations require
1 answer
Q: What type of bond is Br and Br
1 answer
Q: Where does respiration the process of releasing energy from the combination of oxygen and glucose occur
1 answer
Q: What does 2-chloro-3-ethylpentane look like
1 answer
Q: What is the chemical formula of copper matte
2 answers
Q: What is a cation and were can you find it in the periodic table of elements
3 answers
Q: What is non acidic soap
1 answer
Q: How did alchemy differ from the science of chemistry
1 answer
Q: WHAT ARE THE TWO PRODUCTS MADE WHEN A FUELS BURNS COMPLETLY
1 answer
Q: Is triglyceride hydrophobic
7 answers
Q: What is the balanced symbol equation for the thermal decomposition of copper carbonate
1 answer
Q: What scientists call stuff
1 answer
Q: Why is the theoretical yield of a reaction determined only by the amount of the limiting reactant
2 answers
Q: Explain why the formula for aluminium chloride is AlCl3
1 answer
Q: Does barium sulphite precipitate when barium chloride is added to sodium sulphite solution
1 answer
Q: How many periods and groups are there in the periodic table
7 answers
Q: What the equation for the reaction catalyzed by catalase
7 answers
Q: What state of matter is copper at room temperature of 25 degrees celsius
1 answer
Q: What is difference between a substance that is solube in water and one that is insolube in water
5 answers
Q: What elements is carbon made of
2 answers
Q: What do you call something found in nature that people can use
1 answer
Q: How many grams are there in 3.3 x 1023 molecules of N2I6
6 answers
Q: What is the formula for sulfur hexachloride
1 answer
Q: What group of elements on the periodic table give electrons
2 answers
Q: What are the four types of carbon compounds found in living things
2 answers
Q: What is methylcellulose made from
1 answer
Q: Why is the well method used more often than the creaming method
1 answer
Q: Which subomatic particles are rearrange when chemical bonds are formed and broken
1 answer
Q: If a process does not require oxygen it is what
1 answer
Q: What is the process of dissolving called
13 answers
Q: What do you think the diagram would look like if a catalyst were added
1 answer
Q: What 2 things does a formula tell you
1 answer
Q: What is the color
2 answers
Q: What do all compounds have in common
2 answers
Q: What type of chemical reaction is ATP H2O - ADP Pi energy
3 answers
Q: What relationships are needed to convert 1.5 grams of carbon to the number of carbon atoms
2 answers
Q: How many is 26 fluid ounces
1 answer
Q: Which of these is a solution several different kinds of nuts in a jar a box full of pens and pencils chocolate syrup in a glass of milk or a denim jacket with a leather caller
2 answers
Q: What are three agents of chemical weathering
2 answers
Q: What is the highest priority substituent in CH3CH2CH2-CH2CH(CH3)2-CC-CH2CH2Br- CH2Cl
1 answer
Q: Examples chemiluminescent light sources
1 answer
Q: What is the balanced equation for ammonium phosphate in an aqueous solution
1 answer
Q: How are formulas for ionic and covalent compounds written
1 answer
Q: What is the chemical formula for two hydrogen and one sulfur
2 answers
Q: What are two ways to improperly dispose hazardous waste
1 answer
Q: What causes a change in state
2 answers
Q: Why is sugar cane will not run out
1 answer
Q: Is a common bond all military professionals share based on the mutual accountability that comes with self-regulation
2 answers
Previous809810811812813814815816817818Next
Trending Questions
what The use of alcohol burner? Many metals are described as ductile which means they can be .? What is prestic made from? How can you tell if a mixture is acidic or basic? What does it mean to have high thermal energy? Write the net ionic equation of the reaction BaCl2 with Na2CO3? Why is it important to report your presence at the appropriate assembly point? What sweetener integrates chlorine atoms? Which element of satire makes something seem less important than it really is? How old is Emma off of H20? Why is iron disposable? What are common alkalines? What is the formula of an neon ion? Where would you find 79 percent nitrogen 16 percent oxygen 4.5 percent carbon dioxide? What does 2NaO mean? How do you condensation reaction and hydrolysis differ? What happens to thermal energy in beakers as water cool down to room temperature? How should one properly treat lye burns to minimize damage and promote healing? Element used to make permanent magnets? What is the red stuff in a thermometer?

Resources

Leaderboard All Tags Unanswered

Top Categories

Algebra Chemistry Biology World History English Language Arts Psychology Computer Science Economics

Product

Community Guidelines Honor Code Flashcard Maker Study Guides Math Solver FAQ

Company

About Us Contact Us Terms of Service Privacy Policy Disclaimer Cookie Policy IP Issues
Answers Logo
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.