0
What else can I help you with?
What is the difference between salt and msg?
The difference between salt and msg is that salt is a natural occurring mineral substance and is needed by the human body. MSG is an artificial chemical that causes problems in the nervous system and brain.
What is the difference between the o2 arena and msg?
to shuvvv it up ur
How can send IM in a network using command prompt?
"msg" command might help. It pops up a message box on the users PC. C:/> msg <user_name> "Hello" "msg" command might help. It pops up a message box on the users PC. C:/> msg <user_name> "Hello"
What others channel's are there on the rogers box that are NBA tv or NBA league pass?
there is tnt,espn,espn2,abc,and msg
Does pastrami have MSG?
Is there MSG in pastrami
what is the chemical formula for-monosodium glutamate?
MSG, 2-aminopentanedioic acid, is C5H8NNaO4 and has a SMILES (simplified molecular input line entry specification) of C(CC(=O)O)C(C(=O)O-)N.[Na+]. A link is provided to the Wikipedia article on MSG.
Does most coffee have msg?
Coffee does NOT have MSG.
Why compiler doesn't support space in between character array?
int main (void) { char msg [] = "You are wrong here, spaces are perfectly okay"; puts (msg); return 0; }
What are the potential health effects of consuming MSG?
Consuming MSG may cause symptoms like headaches, nausea, and chest pain in some people, known as "Chinese restaurant syndrome." However, scientific research has not conclusively proven a direct link between MSG and these symptoms. It is important to note that MSG is generally recognized as safe by the FDA when consumed in moderate amounts.
Is there msg in ritz crackers?
There's no "monosodium glutamate" listed on the ingredients label on this box before my eyes, so I'd say no--but MSG can be labeled as SEVERAL different things, including "natural flavors," which is the last ingredient listed on the Ritz box. So... until somebody actually hears a direct "no" from Ritz, I'd say yes!
Is there Msg in all corn oil?
NOT ORGANIC OR NO MSG
What does MSG contain?
MSG stands for monosodium glutamate.
