answersLogoWhite

0

A message box (msg box) is a dialog that displays a message to the user, often used to provide information or alerts, and typically includes options like "OK" or "Cancel." In contrast, an input box prompts the user to enter data, allowing for user input in response to a query or request. While msg boxes are generally for displaying information, input boxes are designed for gathering user input. Both are commonly used in programming to enhance user interaction.

User Avatar

AnswerBot

∙ 1y ago

What else can I help you with?

Related Questions

What is the difference between salt and msg?

The difference between salt and msg is that salt is a natural occurring mineral substance and is needed by the human body. MSG is an artificial chemical that causes problems in the nervous system and brain.


What is the difference between the o2 arena and msg?

to shuvvv it up ur


How can send IM in a network using command prompt?

"msg" command might help. It pops up a message box on the users PC. C:/> msg <user_name> "Hello" "msg" command might help. It pops up a message box on the users PC. C:/> msg <user_name> "Hello"


Is there a link between MSG and insomnia?

There is limited scientific evidence to directly link monosodium glutamate (MSG) with insomnia. Some individuals may report sensitivity to MSG, experiencing symptoms like headaches or sleep disturbances, but these reactions are not universally experienced. Most studies have not found a significant connection between MSG consumption and sleep quality. If someone suspects that MSG affects their sleep, it may be best for them to monitor their intake and consult a healthcare professional.


What others channel's are there on the rogers box that are NBA tv or NBA league pass?

there is tnt,espn,espn2,abc,and msg


what is the chemical formula for-monosodium glutamate?

MSG, 2-aminopentanedioic acid, is C5H8NNaO4 and has a SMILES (simplified molecular input line entry specification) of C(CC(=O)O)C(C(=O)O-)N.[Na+]. A link is provided to the Wikipedia article on MSG.


Does pastrami have MSG?

Is there MSG in pastrami


Why compiler doesn't support space in between character array?

int main (void) { char msg [] = "You are wrong here, spaces are perfectly okay"; puts (msg); return 0; }


Is there msg in ritz crackers?

There's no "monosodium glutamate" listed on the ingredients label on this box before my eyes, so I'd say no--but MSG can be labeled as SEVERAL different things, including "natural flavors," which is the last ingredient listed on the Ritz box. So... until somebody actually hears a direct "no" from Ritz, I'd say yes!


Does most coffee have msg?

Coffee does NOT have MSG.


What are the potential health effects of consuming MSG?

Consuming MSG may cause symptoms like headaches, nausea, and chest pain in some people, known as "Chinese restaurant syndrome." However, scientific research has not conclusively proven a direct link between MSG and these symptoms. It is important to note that MSG is generally recognized as safe by the FDA when consumed in moderate amounts.


What is an Alert in JavaScript?

A JavaScript Alert, called by using the alert(msg); function, creates a dialog window in front of the browser that displays some sort of message (msg) and an OK button. The user much click the OK button in order to do anything else on that page.Additional:alert("Hello World!"); //simply an alert msg with ok buttonconfirm("Are you sure you want to quit?"); // it is a confirmation box with ok and cancel buttonprompt("Enter Your name."); //this one will let you enter something in a box.