answersLogoWhite

0

(NH4)2O

Ammonium is NH4+ Oxygen is O-2 When you use the criss cross method you switch the charges and put the NH4 in bracketssicne it is a polyatomic ion and it has set ratios.

Added:I'm very sorry to inform you that ammonium oxide does NOT exist!

Even the ammonium hydroxide, much better known as ammonia, doesn't exist.

Citation in wikipedia:

Ammonium hydroxide, also known as ammonia water, ammonical liquor, ammonia liquor, aqua ammonia, or aqueous ammonia, is a solution of ammonia in water. It can be denoted by the symbols NH3(aq). Although its name suggests a salt with composition [NH4+][OH−], it is not actually possible to isolate samples of NH4OH - it exists only in dilute aqueous solutions.

NH4+ is not an alkali metal, though it forms halogenides, nitrates and other salts like K+ and Na+.

In a 1M ammonia solution, about 0.42% of the ammonia is converted to ammonium, NH4+, equivalent to a pH of 11.63.

NH3 + H2O NH4+ + OH−.

The base ionization constant is

Kb = [NH4+][OH-]/[NH3] = 1.8×10−5

User Avatar

Wiki User

15y ago

What else can I help you with?

Related Questions

what is the chemical name for (NH4)2O?

This formula is for ammonium oxide.


What is the ionic formula for ammonium oxide?

There is a compound ammonium hydoxide, NH4OH (cannot be isolated - only in solution) there is no ammonium oxide, if there wrer it would have the forula (NH4)2O


What is NH4 and K2O?

NH4 is the chemical formula of the ammonium ion.K2O is the chemical formula of the potassium oxide.


The total number of atoms in one molecule of ammonium oxide?

Ammonium oxide has the chemical formula (NH4)2O. In one molecule of ammonium oxide, there are 13 atoms: 2 nitrogen atoms, 8 hydrogen atoms, and 3 oxygen atoms.


What is NH42O?

NH4NO3 is the chemical formula for ammonium nitrate. It is a commonly used fertilizer and explosive due to its high nitrogen content.


Is ammonium oxide covalent or ionic?

Ammonium oxide is ionic. It is formed by the reaction between ammonium ions (NH4+) and oxide ions (O2-), resulting in the transfer of electrons from the ammonium ion to the oxide ion, forming an ionic bond.


What are the formulas for barium fluoride sodium oxide iron sulfate and ammonium sulfate?

The formula for barium fluoride is BaF₂, for sodium oxide is Na₂O, for iron sulfate is FeSO₄, and for ammonium sulfate is (NH₄)₂SO₄. Each formula represents the composition of the respective compound, indicating the elements and their ratios.


What is the chemical formula for Ammonium Laureth Sulfate?

The chemical formula for Ammonium Laureth Sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3NH4, where n is the number of ethylene oxide units.


What is the chemical formula for NH4 and NO3?

NH4NO3 - ammonium nitrate. (since the valencies of both radical are 1).


Is ammonia and ammonium hydro oxide are same?

No, ammonia (NH3) is a compound composed of nitrogen and hydrogen, while ammonium hydroxide (NH4OH) is a solution of ammonia in water. Ammonium hydroxide is a weak base due to the presence of ammonium ions in solution.


Is ammonia reacts with oxygen to form ammonium oxide?

No, ammonia does not react with oxygen to form ammonium oxide. Ammonia is a compound composed of nitrogen and hydrogen (NH3), while ammonium oxide does not exist as a stable compound.


How can you separate ammonium chloride and copper oxide?

Ammonium chloride is water-soluble whereas copper oxide is not. You can separate them by dissolving the mixture in water, then filtering it. The filtrate solution will contain ammonium chloride and the residue will contain copper oxide.