0
How many hydrogen atoms are present in 3-methyl-4-propyl-3-octene?
Wiki User
∙ 15y ago
CH3CH2C(CH3)C(CH2CH2CH3)CH2CH2CH2CH3
24 hydrogen
Wiki User
∙ 15y ago
Wiki User
∙ 14y ago8. The number of hydrogen atoms in an alkane having n carbon atoms is 2n + 2 hydrogen atoms.
Add your answer:
Earn +20 pts
How many hydrogen atoms are present in the molecule 2 5 dimethyloctane?
This molecule contains 22 hydrogen atoms.
How many hydrogen atom are present in H2 SO 4?
2 hydrogen atoms
How many hydrogen atoms does caffeine has?
To answer your question on how many hydrogen atoms are there in caffeine, the scientific answer would be 10 atoms of hydrogen.
How many hydrogen atoms are present in a hydrocarbon chain of five carbons joined to each other by single covalent bonds?
This compound would be pentane and would have 12 hydrogen atoms.
How many atoms are present in the formula of ammoium nitrate?
Nine atoms represent the empirical formula of ammonium nitrate. Namely, 2 nitrogen atoms, 3 oxygen atoms and 4 hydrogen atoms.
How many hydrogen atoms are present in a water molecule?
there are 2 atoms of hydrogen in water
How many hydrogen atoms are present i H2SOn4?
1 Hydrogen atom is present in H2SOn4.
How many atoms of hydrogen are present in the present in the reactants and in the products?
2
How many atoms in a particle does hydrogen have?
Hydrogen exists as H2 which is a molecule. There are thus two atoms present.
How many hydrogen atoms are present in 2.00mg of aspartame?
The amount of hydrogen atoms that are present in 2.00 mg of aspartame are 2.167*10^22.
How many hydrogen atoms are present in 4C2H5OH?
24
How many molecules are present in a molecule of hydrogen?
there are 2 atoms of hydrogen in water
How many hydrogen atoms are present in the molecule 2 5 dimethyloctane?
This molecule contains 22 hydrogen atoms.
How many hydrogen in a chemical formula?
The number of hydrogen atoms of present in a hydrogen molecule are 2.
How many atoms of hydrogen are present in nh3 molecule?
2
How many atoms of hydrogen are present in NH4 2S?
8
How many hydrogen atom are present in H2 SO 4?
2 hydrogen atoms
