answersLogoWhite

0

Inhaling

User Avatar

Wiki User

13y ago

What else can I help you with?

Related Questions

How do you spell taking in air?

When you breathe in air, the process is called inhalingor inhalation.Breathing out is exhaling, and the overall process is known as respiration.


What is act of taking in air as the diaphragm contract and pulls downward called?

The act of taking in air as the diaphragm contracts and moves downward is called inhalation. During inhalation, the chest cavity expands, creating a vacuum that draws air into the lungs. This process allows for oxygen to enter the body and be distributed to the cells for respiration.


What was the open-air market to all Greek City-states?

The open air market to all Greek cities was called Agora and every day life was taking place there. The Roman equivalent was called Forum.


Why are aveoli called the functional units of the lungs?

Because they are the lining of the lungs that begin the process of taking oxygen out of the air and into the blood stream. They are the parts that actually coe into contact with the "air" and are therefore called the functional part of the lungs.


What is the name of the part of an air gun at the tip of the barrel used for taking aim?

The one in the front is called the "Front Sight". The one in the back is called the "Rear Sight".


What is the amount of air hat can be exhaled with the greatest possible exhalation after the deepest inhalation called?

The amount of air that can be exhaled after the deepest inhalation is called the vital capacity. It is the maximum amount of air a person can exhale after taking the deepest breath possible. It is an important measure of lung function.


Why is the valve stem not taking in air?

The valve stem may not be taking in air because it could be damaged, clogged, or not properly connected to the air source.


What is the process of taking in air into your body and giving it out is called?

Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O


What is taking away the oxygen called?

Removing oxygen from a particular environment is called deoxygenation. This process can lead to asphyxiation or suffocation if the oxygen is not replenished.


Which structure actively helps in taking the air out of lungs?

i think diaphragm helps in taking air out o f lungs


Is parachite called air resistance?

No. But it's designed to do its job by taking advantage of air resistance.


What are the changes taking place in your body including breathing in and out?

At the time of breathing diaphragm streaches and air comes in containing oxygen, as diaphragm constricts air containing carbon di oxide air comes out.This process is called as breathing.