0

Subjects>Science>Earth Science

What is the chemical formula for Ca S?

Anonymous

∙ 14y ago

Updated: 6/15/2024

CaS is the chemical formula for calcium sulphide.

NB The elemental letters should NOT be separated by spaces. 'Ca S' is incorrect. I should be written as ' CaS'.

lenpollock ∙

Lvl 16

∙ 1y ago

What else can I help you with?

Continue Learning about Earth Science

What is the chemical formula for calcium metal?

What Is The Formula What Is The Formula What Is The Formula For Calcium Phosphate ?

What is the chemical formula for ca and clo3?

The chemical formula for calcium is Ca, and the chemical formula for chlorate is ClO3.

What is the chemical formula calcium nitrate?

The chemical formula of calcium nitrate is Ca(NO3)2.

What is the chemical formula for calcium and sulfur?

The chemical formula for calcium is Ca and for sulfur is S. When combined, calcium and sulfur form the compound calcium sulfide with the chemical formula CaS.

What is the chemical formula of chloride of lime?

The chemical formula of chloride of lime is Ca(ClO)2.

Related Questions

What is the chemical formula for calcuim and sulfur?

You're really asking what are the chemical symbols for calcium and sulfur. They are Ca and S.

What is chemical formula for Ca and P04?

The chemical formula for calcium is Ca. The chemical formula for phosphate is PO4.

What is the chemical formula for calcium metal?

What Is The Formula What Is The Formula What Is The Formula For Calcium Phosphate ?

What is the chemical formula of superphosphate?

Ca(H2PO4)2(s)+2CaSO4.2H2O(s)

Calcium cyanide chemical formula?

Formula for calcium nitride: Ca3N2

What is the chemical formula for ca and clo3?

The chemical formula for calcium is Ca, and the chemical formula for chlorate is ClO3.

What is the chemical formula for calcium and cyanide?

The chemical formula for calcium is Ca, and the chemical formula for cyanide is CN. When combined, the formula for calcium cyanide is Ca(CN)2.

What is the chemical formula of calcium and hydroxide?

Calcium Hydroxide has a molecular formula of Ca(OH)2. The structural formula is H-O-Ca-O-H.

What is the chemical formula of calcium hypophosphite?

The chemical formula of calcium hypophosphite is Ca(H2PO2)2.

Formula for Calcium Hydroxide?

The Chemical equation of calcium hydroxide is Ca(OH)2

What is the chemical formula for ca and co3?

The chemical formula for calcium is Ca and the chemical formula for carbonate is CO3. When combined, they form calcium carbonate with the chemical formula CaCO3.

What is the chemical formula of calcium hydroxichloride?

The chemical formula of calcium hydroxychloride is Ca(OH)Cl.

Trending Questions

Where was the last blizzard and when? How does the air dryer cause the system to lose pressure? What is solder melting point? Where is sulfur dioxide most commonly found? What wsas Geothermal power is produced in? When does hydrogen expand? The melting point of sulfur is 115 C What is the corresponding Fahrenheit temperature? When does spring acid show occur? Which instrument does not belong and why. Anemometer barometer thermometer seismometer? What challenges do climbers face at the bottom of Mount Everest, and how do they overcome them to reach the summit? Is iodine monochloride a metal polar molecule polyatomic ion or nonpolar molecule? Is Laural caverns airy? How many people died of tornadoes in 1953? What is California's state gemstone? Is it true that sedimentary rock means rock made from fire? What era had a layer of iridium deposited all over Earth? What is the balanced equation for calcium carbonate reacts with sulfur dioxide and oxygen to produce calcium sulfate and carbon dioxide? Which layer of the atmosphere is closest to space? What is the scientific explanation of chlorine and coke chemical reaction? How long does brass take to decompose?

Resources

Top Categories

Product

Company

Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.