0

Subjects>Science>Earth Science

What is the chemical formula for Ca S?

Anonymous

∙ 14y ago

Updated: 6/15/2024

CaS is the chemical formula for calcium sulphide.

NB The elemental letters should NOT be separated by spaces. 'Ca S' is incorrect. I should be written as ' CaS'.

lenpollock ∙

Lvl 16

∙ 1y ago

What else can I help you with?

Continue Learning about Earth Science

What is the chemical formula for calcium metal?

What Is The Formula What Is The Formula What Is The Formula For Calcium Phosphate ?

What is the chemical formula for ca and clo3?

The chemical formula for calcium is Ca, and the chemical formula for chlorate is ClO3.

What is the chemical formula calcium nitrate?

The chemical formula of calcium nitrate is Ca(NO3)2.

What is the chemical formula for calcium and sulfur?

The chemical formula for calcium is Ca and for sulfur is S. When combined, calcium and sulfur form the compound calcium sulfide with the chemical formula CaS.

What is the chemical formula of chloride of lime?

The chemical formula of chloride of lime is Ca(ClO)2.

Related Questions

What is the chemical formula for calcuim and sulfur?

You're really asking what are the chemical symbols for calcium and sulfur. They are Ca and S.

What is chemical formula for Ca and P04?

The chemical formula for calcium is Ca. The chemical formula for phosphate is PO4.

What is the chemical formula for calcium metal?

What Is The Formula What Is The Formula What Is The Formula For Calcium Phosphate ?

What is the chemical formula of superphosphate?

Ca(H2PO4)2(s)+2CaSO4.2H2O(s)

Calcium cyanide chemical formula?

Formula for calcium nitride: Ca3N2

What is the chemical formula for ca and clo3?

The chemical formula for calcium is Ca, and the chemical formula for chlorate is ClO3.

What is the chemical formula for calcium and cyanide?

The chemical formula for calcium is Ca, and the chemical formula for cyanide is CN. When combined, the formula for calcium cyanide is Ca(CN)2.

What is the chemical formula of calcium and hydroxide?

Calcium Hydroxide has a molecular formula of Ca(OH)2. The structural formula is H-O-Ca-O-H.

What is the chemical formula of calcium hypophosphite?

The chemical formula of calcium hypophosphite is Ca(H2PO2)2.

Formula for Calcium Hydroxide?

The Chemical equation of calcium hydroxide is Ca(OH)2

What is the chemical formula for ca and co3?

The chemical formula for calcium is Ca and the chemical formula for carbonate is CO3. When combined, they form calcium carbonate with the chemical formula CaCO3.

What is the chemical formula of calcium hydroxichloride?

The chemical formula of calcium hydroxychloride is Ca(OH)Cl.

Trending Questions

What is the texture of chalky soil? What is the layer of rock and soil that groundwater flows through called? Is lead nitrate soluble in cold water? Is soap bubbles a compound or a element? What is the number of formula units that are in 5.68 moles of magnesium oxide? Which branch of earth science includes the study of volcanoes and earthquakes? What is the natural way the earth recycles solid waste is known as? What set of conditions produce the driest air? What are the biotic and abiotic factors of a everglades ecosystem? What is the halo that is around the sun at 45 degrees from the sun? What causes air to sink near the latitude 30 N (and 30 S)? How much does a drum weigh with it full of soil? What is fish larvae? How much ferrous sulfate is 27 mg elemental iron? What happened at Box Flat Colliery? How many seasons was what i like about you on tv? What is the main mineral type that the oceanic plates are made of? What does an oxygen meter measure? What is the formula for permanganate and ammonium? What is Gravitational Deposition?

Resources

Top Categories

Product

Company

Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.