0

Subjects>Science>Earth Science

What is the chemical formula for Ca S?

Anonymous

∙ 14y ago

Updated: 6/15/2024

CaS is the chemical formula for calcium sulphide.

NB The elemental letters should NOT be separated by spaces. 'Ca S' is incorrect. I should be written as ' CaS'.

lenpollock ∙

Lvl 16

∙ 1y ago

What else can I help you with?

Continue Learning about Earth Science

What is the chemical formula for calcium metal?

What Is The Formula What Is The Formula What Is The Formula For Calcium Phosphate ?

What is the chemical formula for ca and clo3?

The chemical formula for calcium is Ca, and the chemical formula for chlorate is ClO3.

What is the chemical formula calcium nitrate?

The chemical formula of calcium nitrate is Ca(NO3)2.

What is the chemical formula for calcium and sulfur?

The chemical formula for calcium is Ca and for sulfur is S. When combined, calcium and sulfur form the compound calcium sulfide with the chemical formula CaS.

What is the chemical formula of chloride of lime?

The chemical formula of chloride of lime is Ca(ClO)2.

Related Questions

What is the chemical formula for calcuim and sulfur?

You're really asking what are the chemical symbols for calcium and sulfur. They are Ca and S.

What is chemical formula for Ca and P04?

The chemical formula for calcium is Ca. The chemical formula for phosphate is PO4.

What is the chemical formula for calcium metal?

What Is The Formula What Is The Formula What Is The Formula For Calcium Phosphate ?

What is the chemical formula of superphosphate?

Ca(H2PO4)2(s)+2CaSO4.2H2O(s)

Calcium cyanide chemical formula?

Formula for calcium nitride: Ca3N2

What is the chemical formula for ca and clo3?

The chemical formula for calcium is Ca, and the chemical formula for chlorate is ClO3.

What is the chemical formula for calcium and cyanide?

The chemical formula for calcium is Ca, and the chemical formula for cyanide is CN. When combined, the formula for calcium cyanide is Ca(CN)2.

What is the chemical formula of calcium and hydroxide?

Calcium Hydroxide has a molecular formula of Ca(OH)2. The structural formula is H-O-Ca-O-H.

What is the chemical formula of calcium hypophosphite?

The chemical formula of calcium hypophosphite is Ca(H2PO2)2.

Formula for Calcium Hydroxide?

The Chemical equation of calcium hydroxide is Ca(OH)2

What is the chemical formula for ca and co3?

The chemical formula for calcium is Ca and the chemical formula for carbonate is CO3. When combined, they form calcium carbonate with the chemical formula CaCO3.

What is the chemical formula of calcium hydroxichloride?

The chemical formula of calcium hydroxychloride is Ca(OH)Cl.

Trending Questions

Is the greenhouse effect good or bad? What kind of environment does an arthropod live in? What thunder is created by? What types of landforms are in Oklahoma? What body of water is located along the eastern edge of the Indian subcontinent? Why nail surface uneven? Why do east and south asia firm a region? Why is coquina classified as an organic rock with a granular texture? Why is the seismograph important today? Would tropical soil be formed by weathering? Are properties affected by changes in temperature and and pressure? How do plate tectonics explain the formation of metamorphic rocks? Streak of a diamond? What do scientists use to classify seismic waves? What is the color of deep well water? WHAT IS THE NON EXAMPLE OF WEATHERING? What are Examples of stewardship? Is PF3 a compound or element? Can lighting strike houses? What is 200 miles per hour of wind like?

Resources

Top Categories

Product

Company

Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.