answersLogoWhite

0

CaS is the chemical formula for calcium sulphide.

NB The elemental letters should NOT be separated by spaces. 'Ca S' is incorrect. I should be written as ' CaS'.

User Avatar

lenpollock

Lvl 17
1y ago

What else can I help you with?

Related Questions

What is the chemical formula for calcuim and sulfur?

You're really asking what are the chemical symbols for calcium and sulfur. They are Ca and S.


What is chemical formula for Ca and P04?

The chemical formula for calcium is Ca. The chemical formula for phosphate is PO4.


What is the chemical formula for calcium metal?

What Is The Formula What Is The Formula What Is The Formula For Calcium Phosphate ?


What is the chemical formula of superphosphate?

Ca(H2PO4)2(s)+2CaSO4.2H2O(s)


Calcium cyanide chemical formula?

Formula for calcium nitride: Ca3N2


What is the chemical formula for ca and clo3?

The chemical formula for calcium is Ca, and the chemical formula for chlorate is ClO3.


What is the chemical formula for calcium and cyanide?

The chemical formula for calcium is Ca, and the chemical formula for cyanide is CN. When combined, the formula for calcium cyanide is Ca(CN)2.


What is the chemical formula of calcium and hydroxide?

Calcium Hydroxide has a molecular formula of Ca(OH)2. The structural formula is H-O-Ca-O-H.


What is the chemical formula of calcium hypophosphite?

The chemical formula of calcium hypophosphite is Ca(H2PO2)2.


Formula for Calcium Hydroxide?

The Chemical equation of calcium hydroxide is Ca(OH)2


What is the chemical formula for ca and co3?

The chemical formula for calcium is Ca and the chemical formula for carbonate is CO3. When combined, they form calcium carbonate with the chemical formula CaCO3.


What is the chemical formula of calcium hydroxichloride?

The chemical formula of calcium hydroxychloride is Ca(OH)Cl.