NaHSO4
The chemical formula for ammonium hydrogen sulfate is (NH4)HSO4. It is also known as ammonium bisulfate.
it is same as ammonium sulphate, (NH4)2SO4
The chemical formula for Ammonium Laureth Sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3NH4, where n is the number of ethylene oxide units.
The formula for ammonium sulfate is (NH4)2SO4, which represents two ammonium ions (NH4+) and one sulfate ion (SO4^2-).
The chemical formula of sodium bisulfate is NaHSO4.
The chemical formula for ammonium sulfate is (NH4)2SO4.
The chemical formula for ammonium sulfate is (NH4)2SO4.
The chemical formula of ammonium sulfate is (NH4)2SO4.
The chemical formula of ammonium sulfate is (NH4)2SO4.
The chemical formula of ammonium sulfate is (NH4)2SO4.
The chemical formula for ammonium sulfate is (NH4)2SO4.
(NH4)2SO4
The chemical formula for ammonium hydrogen sulfate is (NH4)HSO4. It is also known as ammonium bisulfate.
it is same as ammonium sulphate, (NH4)2SO4
The chemical formula for ammonium aluminum sulfate is (NH4)Al(SO4)2.
The chemical formula of ammonium sulfate is (NH4)2SO4.
The chemical formula for ammonium sulfate is (NH4)2SO4. It consists of two ammonium ions (NH4+) and one sulfate ion (SO4^2-).