0

Subjects>Science>Earth Science

What is the chemical formula for ammonium hydrogan sulfate?

Anonymous

∙ 12y ago

Updated: 6/18/2024

NaHSO4

Wiki User

∙ 12y ago

What else can I help you with?

Continue Learning about Earth Science

Formula for ammonium hydrogen sulfate?

The chemical formula for ammonium hydrogen sulfate is (NH4)HSO4. It is also known as ammonium bisulfate.

What is the chemical formula for ammonium tetraoxosulphate vi?

it is same as ammonium sulphate, (NH4)2SO4

What is the chemical formula for Ammonium Laureth Sulfate?

The chemical formula for Ammonium Laureth Sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3NH4, where n is the number of ethylene oxide units.

The formula for ammonium sulfate is?

The formula for ammonium sulfate is (NH4)2SO4, which represents two ammonium ions (NH4+) and one sulfate ion (SO4^2-).

What is the formula for ammonium bisulfate?

The chemical formula of sodium bisulfate is NaHSO4.

Related Questions

What is the chemical formula of ammonia sulfate?

The chemical formula for ammonium sulfate is (NH4)2SO4.

What is the chemical formula for Ammoinium Sulfate?

The chemical formula for ammonium sulfate is (NH4)2SO4.

Whats the observation for ammonium sulfate?

The chemical formula of ammonium sulfate is (NH4)2SO4.

What are the rules in writing chemical formula of ammonium sulphate?

The chemical formula of ammonium sulfate is (NH4)2SO4.

What is the chemical composition for ammonium sulfate?

The chemical formula of ammonium sulfate is (NH4)2SO4.

What is the symbol of formula for ammonium sulphate?

The chemical formula for ammonium sulfate is (NH4)2SO4.

What is ammonium sulfate's chemical formula?

(NH4)2SO4

Formula for ammonium hydrogen sulfate?

The chemical formula for ammonium hydrogen sulfate is (NH4)HSO4. It is also known as ammonium bisulfate.

What is the chemical formula for ammonium tetraoxosulphate vi?

it is same as ammonium sulphate, (NH4)2SO4

What is the formula for ammonium aluminum sulfate?

The chemical formula for ammonium aluminum sulfate is (NH4)Al(SO4)2.

What is the Chemical formula of sulphate of ammonia?

The chemical formula of ammonium sulfate is (NH4)2SO4.

What is the chemical formula for amonium sulphate?

The chemical formula for ammonium sulfate is (NH4)2SO4. It consists of two ammonium ions (NH4+) and one sulfate ion (SO4^2-).

Trending Questions

What is the formula of the hydride formed by sulfur? Why do sandstones cemented with calcite usually weather much more rapidly than sandstone cemented by silica? How does saving energy reduce carbon dioxide emmisions? Is their hurricane that starts with a C? What is wind blowing towards land? What are the roles of density and Earth's rotation in atmospheric circulation? What is essential for all life on earth? How altitude and latitude affect temperature? Where else is water found on earth? What is a perma frost? Where is the largest store of nitrogen? Is amethyst fluorescent? What are the method of collecting undisturbed soil sample? What happens if you mix lemon juice and sodium hydroxide? Why is copper heated in an atmosphere of hydrogen to make it oxygen free? What is the name of the point on the surface of the earth's surface that is directly above the hypocenter or focus or where an earthquake or underground explosion originated? What are silicate minerals? What is the ultimate source of energy that drives the process in the rock cycle when hot material rising in the Earth generates uplift which in turn promotes erosion? What sedimentary rock can be burned? How can ice cores be used to tell us how earths climate has changed over time?

Resources

Top Categories

Product

Company

Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.