0

Subjects>Science>Earth Science

What is the chemical formula for ammonium hydrogan sulfate?

Anonymous

∙ 12y ago

Updated: 6/18/2024

NaHSO4

Wiki User

∙ 12y ago

What else can I help you with?

Continue Learning about Earth Science

Formula for ammonium hydrogen sulfate?

The chemical formula for ammonium hydrogen sulfate is (NH4)HSO4. It is also known as ammonium bisulfate.

What is the chemical formula for ammonium tetraoxosulphate vi?

it is same as ammonium sulphate, (NH4)2SO4

What is the chemical formula for Ammonium Laureth Sulfate?

The chemical formula for Ammonium Laureth Sulfate is CH3(CH2)10CH2(OCH2CH2)nOSO3NH4, where n is the number of ethylene oxide units.

The formula for ammonium sulfate is?

The formula for ammonium sulfate is (NH4)2SO4, which represents two ammonium ions (NH4+) and one sulfate ion (SO4^2-).

What is the formula for ammonium bisulfate?

The chemical formula of sodium bisulfate is NaHSO4.

Related Questions

What is the chemical formula of ammonia sulfate?

The chemical formula for ammonium sulfate is (NH4)2SO4.

What is the chemical formula for Ammoinium Sulfate?

The chemical formula for ammonium sulfate is (NH4)2SO4.

Whats the observation for ammonium sulfate?

The chemical formula of ammonium sulfate is (NH4)2SO4.

What are the rules in writing chemical formula of ammonium sulphate?

The chemical formula of ammonium sulfate is (NH4)2SO4.

What is the chemical composition for ammonium sulfate?

The chemical formula of ammonium sulfate is (NH4)2SO4.

What is the symbol of formula for ammonium sulphate?

The chemical formula for ammonium sulfate is (NH4)2SO4.

What is ammonium sulfate's chemical formula?

(NH4)2SO4

Formula for ammonium hydrogen sulfate?

The chemical formula for ammonium hydrogen sulfate is (NH4)HSO4. It is also known as ammonium bisulfate.

What is the chemical formula for ammonium tetraoxosulphate vi?

it is same as ammonium sulphate, (NH4)2SO4

What is the formula for ammonium aluminum sulfate?

The chemical formula for ammonium aluminum sulfate is (NH4)Al(SO4)2.

What is the Chemical formula of sulphate of ammonia?

The chemical formula of ammonium sulfate is (NH4)2SO4.

What is the chemical formula for amonium sulphate?

The chemical formula for ammonium sulfate is (NH4)2SO4. It consists of two ammonium ions (NH4+) and one sulfate ion (SO4^2-).

Trending Questions

How does air temperature and air pressure affect your flexibility? What is the area of Earth that examines the physical and biological changes that have occurred in the Earth's past? Where does the chemical reaction between thyroglobulin and iodine take place? What equipment is used for geothermal energy? Would C-Br bond be polar? What is it called when there is a group of hurricanes? What are thermal convection that drives plate motion caused by? What is an important foundation of environmental science? What is the difference between creep slump. And runoff? What type of weather happens during spring? Worlds most natural place? Do clouds have weight? Has there ever been a Hurricane Beverly? What is the order of reaction of the reaction between potassium permanganate and oxalic acid? How does mulch help conserve soil? Where does erosion happen? Is oxygen polar or non polar? Describe wegener's hypothesis of continental drift? Water held in the atmosphere in the form of gas is called? What types of soil found in tamilnadu?

Resources

Top Categories

Product

Company

Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.