Wiki User
β 8y agoNa2SO4 = 46+32+64 = 142
Na = 46/142 * 100 = 32.39 %
S = 32/142 * 100 = 22.54 %
O = 64/142 * 100 = 45.08 %
Wiki User
β 12y agoWiki User
β 9y agoThe molar mass of dibasic sodium phosphate or (Na2HPO4) is 141.96 grams/mole.The molar masses of the individual elements are:Na= 22.99 grams H= 1.008 grams P= 30.97 grams O= 16.00 grams Now just divide the mass of each element present in the compound by the molar mass and multiply by 100 for the percent composition.
Wiki User
β 7y agoAnonymous
NA3(PO4)
sodium laureth sulfate, Cocamidopropyl Betaine,Polyquaternium-10, Methylisothiazolinon, Yellow 6 - CI 15985, Citric Acid, Fragrance....
Was: the composition of epsom salt is magnesium hydroxide and hydrochloric acid Should be: Epsom Salts are Magnesium sulfate, usually with some water attached to it. Magnesium hydroxide is a base, hydrochloric acid is an acid. When Hydrochoric acid is not in water, it's a gas at normal temperatures - thus not able to be made into a dry powder. Acid + Base = salt + water. In this case it would make Magnesium Chloride + water.
Very simple: a list of metallic salts ! A metellic salt has the general composition MeAn (An is the anion).
This is possible because the baruim sulfate formed is insoluble.
Epsom salt is hydrated magnesium sulfate - MgSO4.7H2O.
the percentage composition of aluminum sulfate is 342
sodium laureth sulfate
No
water and sodium laureth sulfate.
it makes our hair shiny and healthy
The chemical formula of sodium laureth sulfate is CH3(CH2)11(OCH2CH2)nOSO3Na.This compound is an anionic surfactant.
This compound is an anionic detergent.
oh that's easy. (NH4)2SO4
There are several SLS or sodium laureth sulfate free shampoos that are available in India. These include Pureology Nano Works shampoo and Organix Rejuvenating Cherry Blossom Ginseng shampoo.
it is ammonium sulfate but the sulfate ion has a 12 carbon long chain hanging where one of the ammoniums should be
Yes ! Sodium laurel sulfate=Sodium lauryl sulfate=Sodium dodecyl sulfate (CH3(CH2)11OSO3Na). But sodium laureth sulfate is a different compound.
sodium laureth sulfate is the most common