0
How do you calculate the percent composition of sodium laureth sulfate?
Wiki User
∙ 9y ago
Na2SO4 = 46+32+64 = 142
Na = 46/142 * 100 = 32.39 %
S = 32/142 * 100 = 22.54 %
O = 64/142 * 100 = 45.08 %
Wiki User
∙ 13y ago
Wiki User
∙ 9y agoThe molar mass of dibasic sodium phosphate or (Na2HPO4) is 141.96 grams/mole.The molar masses of the individual elements are:Na= 22.99 grams H= 1.008 grams P= 30.97 grams O= 16.00 grams Now just divide the mass of each element present in the compound by the molar mass and multiply by 100 for the percent composition.
Wiki User
∙ 8y agoAnonymous
NA3(PO4)
Add your answer:
Earn +20 pts
What is chemical formula of soap Dove?
sodium laureth sulfate, Cocamidopropyl Betaine,Polyquaternium-10, Methylisothiazolinon, Yellow 6 - CI 15985, Citric Acid, Fragrance....
Chemical composition of epsom salt?
Was: the composition of epsom salt is magnesium hydroxide and hydrochloric acid Should be: Epsom Salts are Magnesium sulfate, usually with some water attached to it. Magnesium hydroxide is a base, hydrochloric acid is an acid. When Hydrochoric acid is not in water, it's a gas at normal temperatures - thus not able to be made into a dry powder. Acid + Base = salt + water. In this case it would make Magnesium Chloride + water.
What are the names of list of salts in chemistry?
Very simple: a list of metallic salts ! A metellic salt has the general composition MeAn (An is the anion).
Why drinking magnesium sulfate solution is effective in the treatment of barium poisoning?
This is possible because the baruim sulfate formed is insoluble.
What are the ingredients in epsom salt?
Epsom salt is hydrated magnesium sulfate - MgSO4.7H2O.
What is percent composition of aluminum sulfate?
the percentage composition of aluminum sulfate is 342
Is dove shampoo Sodium Laureth Sulfate free?
No
What does abbreviation SLS stand for?
sodium laureth sulfate
What is the main component of shampoo?
water and sodium laureth sulfate.
What does sodium laureth sulfate do for your hair?
it makes our hair shiny and healthy
Is sodium laureth sulfate an ionic or covalent compound?
The chemical formula of sodium laureth sulfate is CH3(CH2)11(OCH2CH2)nOSO3Na.This compound is an anionic surfactant.
Is aqua sodium laureth sulfate acid or alkali?
This compound is an anionic detergent.
What is the chemical formula for Ammonium Laureth Sulfate?
oh that's easy. (NH4)2SO4
List of sodium laureth sulfate free shampoos in India?
There are several SLS or sodium laureth sulfate free shampoos that are available in India. These include Pureology Nano Works shampoo and Organix Rejuvenating Cherry Blossom Ginseng shampoo.
What is the common name of Sodium Laureth Ether Sulphate?
it is ammonium sulfate but the sulfate ion has a 12 carbon long chain hanging where one of the ammoniums should be
Are sodium laurel sulfate ans sodium lauryl sulfoacetate the same?
Yes ! Sodium laurel sulfate=Sodium lauryl sulfate=Sodium dodecyl sulfate (CH3(CH2)11OSO3Na). But sodium laureth sulfate is a different compound.
Which shampoo ingredients are too harsh and cause scalp itch?
sodium laureth sulfate is the most common
