answersLogoWhite

0

The process of breathing is also called respiration. It involves two main phases: inhalation, where oxygen is taken into the lungs, and exhalation, where carbon dioxide is expelled from the body. This process is essential for gas exchange, allowing oxygen to enter the bloodstream and carbon dioxide to be removed.

User Avatar

AnswerBot

3mo ago

What else can I help you with?

Related Questions

What is the breathing process in plant called?

photolysis


Is the nose is an organ?

Yes, it is, though debatable, the nose could also be called a passageway, this "organ" is used in the respiratory system, and the process of breathing.


What is an inward breath called?

An inward breath is called inhalation. It is the process of breathing in air into the lungs.


The procss of breathing is also called?

respiration


What is the process called when the carbon dioxide leaves the animal?

breathing


What is the process of taking in air into your body and giving it out is called?

Respiration or breathing. respiration is the more scientific term. The scientific formula for respiration is O2+C6H12O6(glucose)=CO2+H2O


What is respiration its not breathing but what is it?

The definition of respiration is the action of breathing. It cab also refer to a process in living organisms involving the production of energy.


what is to breath?

The opposite to breathing in


What is the differances between breathing and respiration?

What is the difference between breathing and respiration? Both breathing and respiration are required for all living organisms. Generally, breathing and respiration are often considered the same. However, there is a great difference between these two words. Breathing is a constant process where you breathe in and out constantly through out the day. It is a process of taking in oxygen and expelling carbon dioxide. Respiration is a process where the body breaks down the oxygen, so that the cells in the body can use it. It is a part of metabolic process also known as catabolic process of a cellular activity where energy molecule is released while carbon dioxide and water are produced. Breathing is a physical process and respiration is a chemical process. Breathing is a process of taking oxygen into the lungs while respiration is taking the oxygen from the lungs into the blood stream or to the cells.


What is The first stage of voice production which is also known as breathing?

The first stage of voice production, also known as breathing, is called respiration. During this stage, air is inhaled and exhaled to supply the vocal cords with the necessary airflow for speaking or singing. Proper breathing techniques are essential for good vocal production.


What are the changes taking place in your body including breathing in and out?

At the time of breathing diaphragm streaches and air comes in containing oxygen, as diaphragm constricts air containing carbon di oxide air comes out.This process is called as breathing.


Is respiration and breathing same process?

Repiration and Breathing are not the same process. Respiration is converting glucose to useable energy.