answersLogoWhite

0

The limitations of rules of priority include their potential rigidity, which can lead to unjust outcomes when strict adherence to established hierarchies fails to consider unique circumstances. Additionally, these rules may not account for evolving societal values or the complexities of individual cases, leading to inconsistencies in application. Furthermore, reliance on priority rules can sometimes overlook the importance of equitable considerations, favoring procedural over substantive justice.

User Avatar

AnswerBot

2mo ago

What else can I help you with?

Related Questions

What are the business benefit and limitations of Rick Dalzell's strategies?

high priority answer


Do rules and limitations contribute to a person's happiness?

sure


What was the first priority for the settlers who moved to the frontier?

follow the rules of the u.s. government


What was the first priority for settlers who moved to the frontier?

follow the rules of the u.s. government


Rule 190 of rules of civil procedure?

Rule 190. Discovery limitations


Can I borrow from my IRA?

Yes, you can borrow from your IRA, but there are specific rules and limitations to follow.


What is the highest priority substituent in CH3CH2CH2-CH2CH(CH3)2-CC-CH2CH2Br- CH2Cl?

The highest priority substituent in this compound is the bromine atom (Br) attached to the carbon chain. This is determined based on the priority rules of the IUPAC nomenclature, where halogens have higher priority than alkyl groups or functional groups.


What are the limitations of CSS?

Limitations are: Ascending by selectors is not possible Limitations of vertical control No expressions No column declaration Pseudo-class not controlled by dynamic behavior Rules, styles, targeting specific text not possible.


When simplifying an expression you perform which operations inside grouping symbols first?

Within parentheses or similar symbols, the same rules apply as when you don't have parentheses. For example, multiplication and division have a higher priority (or precedence) than addition and subtraction.Within parentheses or similar symbols, the same rules apply as when you don't have parentheses. For example, multiplication and division have a higher priority (or precedence) than addition and subtraction.Within parentheses or similar symbols, the same rules apply as when you don't have parentheses. For example, multiplication and division have a higher priority (or precedence) than addition and subtraction.Within parentheses or similar symbols, the same rules apply as when you don't have parentheses. For example, multiplication and division have a higher priority (or precedence) than addition and subtraction.


How do you use boundless in a sentence?

Some of the rules had strict limitations while others were boundless.


Is there a statute of limitations on a misdeminor probation violation in westchester county n.y.?

Probation violation is not subject to a statute of limitations. You were fully aware of breaking the rules and will have to pay the consequences.


What is the number in front of the R in the R configuration?

The number refers to the priority of the substituents attached to the chiral center in a molecule. It is used to determine the R or S configuration based on the Cahn-Ingold-Prelog priority rules.