answersLogoWhite

0

k2cr2o7+FeSO4+H2SO4 --> Cr2(SO4)3+Fe2(SO4)3+K2SO4+H2O

User Avatar

Wiki User

16y ago

What else can I help you with?

Continue Learning about Natural Sciences
Related Questions

How we Balance of redox equation by oxidation number method?

To balance a redox equation using the oxidation number method, assign oxidation numbers to each element in the reactants and products, identify the elements undergoing oxidation and reduction, write half-reactions for oxidation and reduction, balance the atoms in each half-reaction, balance the charges by adding electrons, multiply the half-reactions to make the electrons cancel out, and then add the balanced half-reactions to obtain the overall balanced redox equation.


Which is the first step to follow when using the oxidation-number-change method to balance a redox equation?

The first step is to write the unbalanced skeleton equation for the redox reaction, showing the reactants and products.


How do you write a balanced equation for the oxidation of sucrose?

how do you write the balance equation of sucrose?


The oxidation number of sulfur in H2 SO4 is?

The oxidation number of sulfur in H2SO4 is +6. This is because hydrogen has an oxidation number of +1 and oxygen has an oxidation number of -2, so by the rules of oxidation numbers, sulfur must have an oxidation number of +6 to balance the equation.


What is the oxidation number for O in H2O2?

The oxidation number of O in H2O2 is -1. Each hydrogen atom has an oxidation number of +1, and since the overall molecule has a neutral charge, the oxidation number of oxygen must be -1 for the equation to balance.


What is the oxidation number of nitrogen in NO?

The oxidation number of nitrogen in NO is +2. This is because oxygen has an oxidation number of -2, and since the overall charge of NO (nitrogen monoxide) is 0, the nitrogen atom must have an oxidation number of +2 to balance the equation.


What is the Oxidation state for manganese in MnO2?

The oxidation state for manganese in MnO2 is +4. Oxygen typically has an oxidation state of -2, so the sum of the oxidation states in MnO2 would be 0. Since there are two oxygen atoms with an oxidation state of -2 each, the manganese atom must have an oxidation state of +4 to balance the equation.


What are the four steps of the oxidation number?

Identify the atoms in the compound Assign oxidation numbers to each atom based on electronegativity and known rules Sum the oxidation numbers to match the overall charge of the compound Balance the equation if necessary to ensure conservation of charge


Why numbers in balanced equation are consistent with changes in oxidation numbers?

This is because when we balance a redox reaction, the stoichiometric coefficients are such that the total positive Oxidation number in the reaction and the Total negative Oxidation number corresponds to the net charge of the reaction.


What is the oxidation number of this metal VOCl3?

The oxidation number of V in VOCl3 can be calculated using the sum of oxidation numbers method. Since the total oxidation number of the compound is 0 (neutral compound), and the oxidation number of Cl is -1, the oxidation number of V will be +5.


What are the two methods for balancing the chemical equation?

The two methods for balancing a chemical equation are the inspection method and the algebraic method. In the inspection method, you visually adjust the coefficients of the chemical compounds to achieve balance. In the algebraic method, you set up mathematical equations based on the number of atoms of each element on both sides of the equation and solve for the coefficients.


What is the easiest way to balance a chemical equation?

The easiest way to balance a chemical equation is by using the trial-and-error method. Start by balancing the most complex or uncommon elements first, then adjust the coefficients until the number of atoms on both sides of the equation is equal.