k2cr2o7+FeSO4+H2SO4 --> Cr2(SO4)3+Fe2(SO4)3+K2SO4+H2O
how do you write the balance equation of sucrose?
To balance the equation Br₂ + Br⁻ + BrO₃⁻, you can follow these steps: Start by identifying the oxidation states of bromine in each species. Br₂ is in the 0 oxidation state, Br⁻ is -1, and BrO₃⁻ has bromine in the +5 oxidation state. Balancing the half-reactions for reduction and oxidation, you find that the balanced equation is: 3 Br₂ + 6 Br⁻ + 6 H₂O → 6 BrO₃⁻ + 12 H⁺.
The overall redox reaction of Cr2O7 + Br is not a balanced equation. To balance the equation, the half-reactions for the oxidation and reduction of each element need to be determined and balanced first.
No because you always keep an equation in balance when solving it
The oxidation state of a transition metal in a compound can be determined by analyzing the overall charge of the compound and the known oxidation states of the other elements present. First, assign oxidation states to the non-metal elements based on common oxidation states. Then, set up an equation where the sum of the oxidation states equals the total charge of the compound. By solving this equation, you can find the oxidation state of the transition metal.
To balance a redox equation using the oxidation number method, assign oxidation numbers to each element in the reactants and products, identify the elements undergoing oxidation and reduction, write half-reactions for oxidation and reduction, balance the atoms in each half-reaction, balance the charges by adding electrons, multiply the half-reactions to make the electrons cancel out, and then add the balanced half-reactions to obtain the overall balanced redox equation.
The first step is to write the unbalanced skeleton equation for the redox reaction, showing the reactants and products.
how do you write the balance equation of sucrose?
To balance the equation Br₂ + Br⁻ + BrO₃⁻, you can follow these steps: Start by identifying the oxidation states of bromine in each species. Br₂ is in the 0 oxidation state, Br⁻ is -1, and BrO₃⁻ has bromine in the +5 oxidation state. Balancing the half-reactions for reduction and oxidation, you find that the balanced equation is: 3 Br₂ + 6 Br⁻ + 6 H₂O → 6 BrO₃⁻ + 12 H⁺.
The oxidation number of sulfur in H2SO4 is +6. This is because hydrogen has an oxidation number of +1 and oxygen has an oxidation number of -2, so by the rules of oxidation numbers, sulfur must have an oxidation number of +6 to balance the equation.
The oxidation number of O in H2O2 is -1. Each hydrogen atom has an oxidation number of +1, and since the overall molecule has a neutral charge, the oxidation number of oxygen must be -1 for the equation to balance.
The oxidation number of nitrogen in NO is +2. This is because oxygen has an oxidation number of -2, and since the overall charge of NO (nitrogen monoxide) is 0, the nitrogen atom must have an oxidation number of +2 to balance the equation.
The oxidation state for manganese in MnO2 is +4. Oxygen typically has an oxidation state of -2, so the sum of the oxidation states in MnO2 would be 0. Since there are two oxygen atoms with an oxidation state of -2 each, the manganese atom must have an oxidation state of +4 to balance the equation.
Identify the atoms in the compound Assign oxidation numbers to each atom based on electronegativity and known rules Sum the oxidation numbers to match the overall charge of the compound Balance the equation if necessary to ensure conservation of charge
This is because when we balance a redox reaction, the stoichiometric coefficients are such that the total positive Oxidation number in the reaction and the Total negative Oxidation number corresponds to the net charge of the reaction.
The oxidation number of V in VOCl3 can be calculated using the sum of oxidation numbers method. Since the total oxidation number of the compound is 0 (neutral compound), and the oxidation number of Cl is -1, the oxidation number of V will be +5.
The two methods for balancing a chemical equation are the inspection method and the algebraic method. In the inspection method, you visually adjust the coefficients of the chemical compounds to achieve balance. In the algebraic method, you set up mathematical equations based on the number of atoms of each element on both sides of the equation and solve for the coefficients.