answersLogoWhite

0

CH2OCO(CH2)7CH=CH(CH2)7CH3 CH2OH CH3(CH2)7CH=CH(CH2)7COONa

| | +

CHOCO(CH12)12CH3 + 3NaOH ---> CHOH + CH3(CH2)14COONa

| | +

CH2OCO(CH2)16CH3 CH2OH CH3(CH2)16COONa

User Avatar

Wiki User

14y ago

What else can I help you with?

Continue Learning about Natural Sciences

How do you identify triglycerides?

Triglycerides can be identified using several laboratory techniques, with the most common being gas chromatography and high-performance liquid chromatography (HPLC). In these methods, triglycerides are separated based on their fatty acid composition and structure. Additionally, enzymatic assays can measure triglyceride levels in blood samples, providing a quantitative assessment. Chemical methods, such as saponification followed by titration, can also be used to identify and quantify triglycerides in various samples.


What is the reaction of saponification by using ordinary fat?

Saponification is the process of making soap from fats and a strong alkali like sodium hydroxide. When ordinary fat (such as olive oil or coconut oil) is mixed with sodium hydroxide, it undergoes a chemical reaction called saponification, forming soap and glycerin as products. This reaction is commonly used in soap-making industries.


What is the degree of saponification?

Saponification is the process of creating soap. It typically involves reacting a strong alkaline (such as sodium hydroxide, potassium hydroxide, etc.) with a fatty acid or oil. The strong base reacts with the fatty acid to create a salt with a long hydrocarbon chain left over from the fatty acid or oil. Here's the reaction (using lye as an example): (hydrocarbon chain)-COOH + NaOH --> (hydrocarbon chain)-COONa + H2O When the cation bonds with the fatty acid/oil, it creates a new substance that possess the hydrophilic properties of the lipid hydrocarbon chain as well as the hydrophilic properties of the alkali metal (the sodium atom). Therefore, it can mix with both hydrophobic AND hydrophilic substances. Thus, if you need to wash away something greasy (hydrophobic), the hydrophobic chain of the soap will mix with the greasy substance, and a polar substance (such as water) can mix with the hydrophilic end of the soap as well...allowing you to mix grease with soap with water...and wash it away.


What is the equation for photosynthesis using CO2 and H2S?

It is not using H2S gas. It is using H2O liquid.


Balanced equation for the preparation of soap from triacylglycerol?

A balanced equation for the preparation of soap from triacylglycerol is (C18H29O2)3-C3H5O3 + 3KOH -> 3C18H29O2K + HOCH2CH(OH)CH2OH. The acyl portions are all derived from linolenic acid and use potassium hydroxide as the base.

Related Questions

What is the formula to calculate saponification number?

Insoluble soaps are not likely to exist, they won't work when not IN water. For more you can trust on this: his process is called saponification: fat + sodium hydroxide -> Sodium salts of fatty acid (Soap) + glycerol


Describe how soap is manufactured using the sodium hydroxide produced in this process include a reaction equation?

Soap is made through a process called saponification, which involves reacting fats or oils with a strong base like sodium hydroxide to form soap and glycerol. The reaction equation for saponification using sodium hydroxide is: 3R-COOH + 3NaOH → 3R-COONa (soap) + C3H5(OH)3 (glycerol).


Write the equation of the action of pancreatin on a molecule of tristearin?

Tristearin is a type of triglyceride which is found in hard fat deposits. The chemical equation for the action of pancreatin on tristearin is triglyceride + 2H2O --> 2HO(O=C)C17H35 + monoglyceride.


How do you identify triglycerides?

Triglycerides can be identified using several laboratory techniques, with the most common being gas chromatography and high-performance liquid chromatography (HPLC). In these methods, triglycerides are separated based on their fatty acid composition and structure. Additionally, enzymatic assays can measure triglyceride levels in blood samples, providing a quantitative assessment. Chemical methods, such as saponification followed by titration, can also be used to identify and quantify triglycerides in various samples.


How can you represent a proportional relationship using an equation?

You cannot represent a proportional relationship using an equation.


What is the reaction of saponification by using ordinary fat?

Saponification is the process of making soap from fats and a strong alkali like sodium hydroxide. When ordinary fat (such as olive oil or coconut oil) is mixed with sodium hydroxide, it undergoes a chemical reaction called saponification, forming soap and glycerin as products. This reaction is commonly used in soap-making industries.


What is equadtratic equation?

A quadratic equation normally has 2 solutions and can be solved by using the quadratic equation formula.


How do you solve for x using a quadratic equation?

For an equation of the form ax² + bx + c = 0 you can find the values of x that will satisfy the equation using the quadratic equation: x = [-b ± √(b² - 4ac)]/2a


What is the degree of saponification?

Saponification is the process of creating soap. It typically involves reacting a strong alkaline (such as sodium hydroxide, potassium hydroxide, etc.) with a fatty acid or oil. The strong base reacts with the fatty acid to create a salt with a long hydrocarbon chain left over from the fatty acid or oil. Here's the reaction (using lye as an example): (hydrocarbon chain)-COOH + NaOH --> (hydrocarbon chain)-COONa + H2O When the cation bonds with the fatty acid/oil, it creates a new substance that possess the hydrophilic properties of the lipid hydrocarbon chain as well as the hydrophilic properties of the alkali metal (the sodium atom). Therefore, it can mix with both hydrophobic AND hydrophilic substances. Thus, if you need to wash away something greasy (hydrophobic), the hydrophobic chain of the soap will mix with the greasy substance, and a polar substance (such as water) can mix with the hydrophilic end of the soap as well...allowing you to mix grease with soap with water...and wash it away.


How is soap manafactured using sodium hydroxide?

Soap is manufactured in this way using a process called saponification of fats. Fats fall into a category of compounds called esters, molecules formed from an alcohol and a carboxylic acid. In the case of a fat the alcohol is glycerin (glycerol) and the acid is a fatty acid. Here is the generic, two-step equation for the saponification of an ester with a hydroxide (R represents the rest of each acid and ester). OH- + RO2-OR --> RO2H + RO- The ester is split into the corresponding acid and alkoxide ("salt" of an alcohol). RO- + RO2H --> ROH + RO2- Since ethoxides are highly basic they are quickly neutralized by the fatty acid. Resulting in the corresponding alcohol (glycerin) and fatter acid salt (the soap). The glycerin is then separated out.


Derivation of gibbs-duhem-margules equation using gibbs-duhem equation?

Gibbs-duhem-margules equation and its derivation


How can you find a variable in math?

You find, or construct, an equation or set of equations which express the unknown variable in terms of other variables. Then you solve the equation(s), using algebra.You find, or construct, an equation or set of equations which express the unknown variable in terms of other variables. Then you solve the equation(s), using algebra.You find, or construct, an equation or set of equations which express the unknown variable in terms of other variables. Then you solve the equation(s), using algebra.You find, or construct, an equation or set of equations which express the unknown variable in terms of other variables. Then you solve the equation(s), using algebra.