There are 4 boron atoms in a molecule of borax (Na2B4O7·10H2O).
darna
The man you are referring to is Democritus, an Ancient Greek philosopher who proposed the concept of atoms as indivisible particles that make up all matter in the universe. Democritus believed that everything is composed of these tiny, unchangeable particles.
No. The sun produces energy by fusion. It is joining hydrogen atoms into larger helium atoms, which releases energy. Man-made nuclear reactors produce energy by fission. They break large atoms into smaller atoms, which also releases energy.
Yes. Three different atoms by element, but the count is...... 6 carbon atoms. 12 hydrogen atoms. 6 oxygen atoms. The compound is glucose.
The binary compound formula for plumbic bromide is PbBr2.
The chemical formula for Lead (II) Bromide is - PbBr2
Check the spelling
Propene has 3 carbon atoms.
Your formulas are not correct.
There are 4 boron atoms in a molecule of borax (Na2B4O7·10H2O).
darna
NI(NO3)3+pbbr4nibr3+pb(no3)4
A man from Greek
Sucralose is a sweetener that integrates chlorine atoms. It is an artificial sweetener that is made by replacing three hydroxyl groups on a sucrose molecule with chlorine atoms.
The chemical formula for lead (IV) bromide is PbBr4. It is composed of one lead (Pb) ion with a charge of +4, and four bromine (Br) ions with a charge of -1 each.
john dalton