0
What else can I help you with?
How man boron atoms are in a molecule of borax?
There are 4 boron atoms in a molecule of borax (Na2B4O7·10H2O).
Who is the man who clarified the difference of molecules and atoms?
darna
Who was the man who lived from 460 BC - 370 BC and was among the first to suggest the idea of atoms?
The man you are referring to is Democritus, an Ancient Greek philosopher who proposed the concept of atoms as indivisible particles that make up all matter in the universe. Democritus believed that everything is composed of these tiny, unchangeable particles.
Are the nuclear reactors the same processes occurring in the sun and reactors?
No. The sun produces energy by fusion. It is joining hydrogen atoms into larger helium atoms, which releases energy. Man-made nuclear reactors produce energy by fission. They break large atoms into smaller atoms, which also releases energy.
Is a compound with the formula C6H12O6 made up of 3 atoms?
Yes. Three different atoms by element, but the count is...... 6 carbon atoms. 12 hydrogen atoms. 6 oxygen atoms. The compound is glucose.
What is the binary compound formula for plumbic bromide?
The binary compound formula for plumbic bromide is PbBr2.
What is the formula for lead bromide?
The chemical formula for Lead (II) Bromide is - PbBr2
How man atoms does A1Sn have?
Check the spelling
How man carbons does propene have?
Propene has 3 carbon atoms.
When this equation is balanced what is the coefficient for ni(no3)3. ni(no3)3 plus pbbr4 -- and gt nibr3 plus pb(no3)4?
Your formulas are not correct.
How man boron atoms are in a molecule of borax?
There are 4 boron atoms in a molecule of borax (Na2B4O7·10H2O).
Who is the man who clarified the difference of molecules and atoms?
darna
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
Who discovered atoms can be cut into smaller pieces?
A man from Greek
What sweetener integrates chlorine atoms?
Sucralose is a sweetener that integrates chlorine atoms. It is an artificial sweetener that is made by replacing three hydroxyl groups on a sucrose molecule with chlorine atoms.
What is lead (IV) bromide formula?
The chemical formula for lead (IV) bromide is PbBr4. It is composed of one lead (Pb) ion with a charge of +4, and four bromine (Br) ions with a charge of -1 each.
Who is the man that proposed that atoms join together to make up compounds?
john dalton
