answersLogoWhite

0

Lead(IV) bromide (PbBr₄) consists of one lead atom and four bromine atoms. Therefore, in a single formula unit of PbBr₄, there are a total of 5 atoms (1 Pb + 4 Br).

User Avatar

AnswerBot

9mo ago

What else can I help you with?

Continue Learning about Natural Sciences

Why pbbr4 and pbi4 are unstable?

PbBr4 and PbI4 are unstable due to the high oxidation state of lead (Pb) in these compounds, which makes them prone to reduction. Lead typically exhibits stable oxidation states of +2 and +4, but in these tetrahalides, the +4 state is less stable due to the larger size and lower electronegativity of bromine and iodine, which can lead to bond weakening. Additionally, the formation of stable lower oxidation state compounds, such as PbBr2 or PbI2, is thermodynamically favored, contributing to the instability of PbBr4 and PbI4.


How man boron atoms are in a molecule of borax?

There are 4 boron atoms in a molecule of borax (Na2B4O7·10H2O).


Who is the man who clarified the difference of molecules and atoms?

darna


Who was the man who lived from 460 BC - 370 BC and was among the first to suggest the idea of atoms?

The man you are referring to is Democritus, an Ancient Greek philosopher who proposed the concept of atoms as indivisible particles that make up all matter in the universe. Democritus believed that everything is composed of these tiny, unchangeable particles.


How man atoms are in the world?

Estimating the number of atoms in the world is challenging, but scientists approximate that there are around (10^{50}) to (10^{80}) atoms in the observable universe. This vast range accounts for the immense variety of matter, including stars, planets, and interstellar gas. To put it in perspective, a single grain of sand contains roughly (10^{19}) atoms, illustrating just how numerous they are on a cosmic scale.

Related Questions

What is the binary compound formula for plumbic bromide?

The binary compound formula for plumbic bromide is PbBr2.


Why pbbr4 and pbi4 are unstable?

PbBr4 and PbI4 are unstable due to the high oxidation state of lead (Pb) in these compounds, which makes them prone to reduction. Lead typically exhibits stable oxidation states of +2 and +4, but in these tetrahalides, the +4 state is less stable due to the larger size and lower electronegativity of bromine and iodine, which can lead to bond weakening. Additionally, the formation of stable lower oxidation state compounds, such as PbBr2 or PbI2, is thermodynamically favored, contributing to the instability of PbBr4 and PbI4.


What is the formula for lead bromide?

The chemical formula for Lead (II) Bromide is - PbBr2


How man atoms does A1Sn have?

Check the spelling


How man carbons does propene have?

Propene has 3 carbon atoms.


When this equation is balanced what is the coefficient for ni(no3)3. ni(no3)3 plus pbbr4 -- and gt nibr3 plus pb(no3)4?

Your formulas are not correct.


How man boron atoms are in a molecule of borax?

There are 4 boron atoms in a molecule of borax (Na2B4O7·10H2O).


Who is the man who clarified the difference of molecules and atoms?

darna


What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?

NI(NO3)3+pbbr4nibr3+pb(no3)4


Who discovered atoms can be cut into smaller pieces?

A man from Greek


What sweetener integrates chlorine atoms?

Sucralose is a sweetener that integrates chlorine atoms. It is an artificial sweetener that is made by replacing three hydroxyl groups on a sucrose molecule with chlorine atoms.


What is lead (IV) bromide formula?

The chemical formula for lead (IV) bromide is PbBr4. It is composed of one lead (Pb) ion with a charge of +4, and four bromine (Br) ions with a charge of -1 each.