0
What else can I help you with?
How many single bonds in NO3?
(NO3)- has three single bonds.
What is the formula for the salt which contains both Ca and NO3 ions?
The formula for the salt containing both Ca and NO3 ions would be Ca(NO3)2. This is because calcium (Ca) has a 2+ charge and nitrate (NO3) has a 1- charge, so to balance the charges, you need two NO3 ions for each Ca ion.
What is the formula for the ionic compounds formed by magnesium ions and calcium ions with nitrate ions?
The formula for the ionic compound formed by magnesium ions (Mg2+) and nitrate ions (NO3-) is Mg(NO3)2. The formula for the ionic compound formed by calcium ions (Ca2+) and nitrate ions (NO3-) is Ca(NO3)2.
When Al(NO3)3 is separated into its ions how is it written?
Al(NO3)3(aq) ===> Al^3+(aq) + 3NO3^-(aq) is how aluminum nitrate ionizes in aqueous media.
What is the empirical formula and name for the compound for Co NO3 2?
The empirical formula for Co(NO3)2 is Co(NO3)2. The compound is named cobalt(II) nitrate.
The correct name for NO3?
NO3 is known as nitrate.
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
What is the formula of iron and nitrate?
Iron nitrates are: - Fe(II)(NO3)2 - Fe(III)(NO3)3
What is the chemical formula for nitrate?
The formula for the nitrate ion is NO3 -1.
What is compound name for NO3?
Chromium (III) Nitrate
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the name for the formula NO3?
NO3 is commonly known as nitrate.
What is the product if you multiply Mg by NO3?
Mg(NO3)2
What is the product of NO3 and iron II?
the equation would look like: 2(NO3) + Fe --> Fe(NO3)2 the 2 in front of the NO3 is there to balance the equation.
What the name of Al(NO3)3?
Al(NO3)3 is aluminum nitrate.
What is the formula of mercurous nitrate?
Hg22+ + NO3- -----> Hg2(NO3)2
How many single bonds in NO3?
(NO3)- has three single bonds.
