0
What else can I help you with?
What ester does butyric acid and amyl alcohol form?
Amyl butyrate, CH3[CH2]2C(=O)-O[CH2]4CH3, IUPAC name: pentyl butanoate This ester has a smell reminiscent of pear or apricot. This chemical is used as an flavour added to cigarette- and pipe tobaccos.
Can iso amyl alcohol replace phenol in DNA extraction?
Iso amyl alcohol can be used as a substitute for phenol in DNA extraction procedures, especially for organic extraction methods. It helps in separating DNA from other cellular components. However, keep in mind that the effectiveness of iso amyl alcohol may vary depending on the specific protocol and sample type being used.
What type of flame would have for the combustion of amyl alcohol have?
The combustion of amyl alcohol would produce a blue flame. This is because the blue flame indicates that complete combustion is occurring, where all the fuel is burning efficiently with enough oxygen.
Three components in correct order of administration utilized in the treatment for cyanide exposure.?
Amyl nitrite, sodium nitrite, sodium thiosulfate
How much does electricity cost in one month?
It actually depends on how much you you it so If you use it a lot it's gonna cost a lot and if you use it less it's gonna cost less
How much is your amyl upright piano worth?
About 400.00 depending on condition
What is amyl?
An amyl is a dated name in organic chemistry for pentyl.
What is the meaning of the root word amyl?
The root word "amyl" refers to a group of organic compounds containing five carbon atoms. It is often found in the names of chemical compounds like amyl alcohol or amyl nitrite.
What is the birth name of Max Amyl?
Max Amyl's birth name is Chiapale, Max Gabriel Emmanuel Louis.
When did Max Amyl die?
Max Amyl died on March 2, 1982, in Limoges, Haute-Vienne, France.
What does amyl nitrite show up as in a drug test?
Amyl nitrite isn't typically tested for, and therefore it does not show up.
When was Max Amyl born?
Max Amyl was born on May 11, 1921, in Marseille, Bouches-du-Rhne, France.
What is a nitrate stimulant?
amyl nitrate
Does amyl nitrite show in drug test?
Amyl nitrite is not typically included in standard drug tests as it is not a controlled substance. However, it is important to note that amyl nitrite can cause a false positive result for drugs like amyl nitrate, amphetamine, and ecstasy on some drug tests due to chemical similarities.
What has the author Benjamin Owen Isaac written?
Benjamin Owen Isaac has written: 'The thermal decomposition of amyl phosphonium salts and amyl bromides'
What is the Formula of amyl acetate?
The formula for amyl acetate is CH3COOC5H11P.S. If you ever want to know anything else like this, just search the compound (enter "amyl acetate" into the "Enter a question here..." box).
What ester does butyric acid and amyl alcohol form?
Amyl butyrate, CH3[CH2]2C(=O)-O[CH2]4CH3, IUPAC name: pentyl butanoate This ester has a smell reminiscent of pear or apricot. This chemical is used as an flavour added to cigarette- and pipe tobaccos.
