0
Yes, I suppose so looking at the stable, quite ionic, polar (S-O) group in it:
CH2=CHCH2-S+(-O-)-S-CH2CH=CH2
What else can I help you with?
Is 1-naphthylamine is soluble in water?
Diphenylamine is only slightly soluble in water, but more soluble in polar organic solvents.
Is siderite soluble in water?
Siderite is not soluble in water.
Why is triethylamine soluble in water?
This compound is slightly soluble in water
Why wood not dissolve in water?
cellulose is not water soluble, starch is water soluble.
Is NH4Br soluble or insoluble?
It is soluble
Simplest empirical formula for allicin?
C6H10OS2. Molecular and empirical are the same for Allicin.
Is chlorine a water-soluble or fat-soluble?
Water soluble.
How are fat soluble and water soluble absorbed?
fat soluble vitamins are stored in our fat tissues and water soluble vitamins are soluble in water.
Is folate water soluble or fat soluble?
Water soluble.
Is folate water soluble or fat soluble?
Folate is water soluble.
Is magnesium water soluble or fat soluble?
Magnesium is water soluble. Like sodium , a pieces of magnesium will dissolve in water , rorelease hydrogen and form a soluble of the hydroxide. Mg(s) + 2H2O(l) = Mg(OH)2(aq) + H(g) NB THe reaction is NOT very vigorous, but is observable.
What is an allicin?
An allicin is an organic compound, Latin name diallyl thiosulfinate, obtained from garlic.
What is allicin?
An allicin is an organic compound, Latin name diallyl thiosulfinate, obtained from garlic.
Is chromium iii acetate soluble or not soluble?
soluble in water.
Are minerals fat-soluble or water soluble?
minerals are usually water soluble
Is biotin water soluble or fat soluble?
Biotin is a water-soluble vitamin.
Is phosphorus fat or water soluble?
water- soluble
