answersLogoWhite

0

The products of propanol combustion are water and carbon dioxide.

User Avatar

Wiki User

∙ 11y ago

What else can I help you with?

Related Questions

What is the iupac name for ch3-ch2-ch2-oh?

Pentanol


What is the molecular structure of 3-methylpentane?

ch3-ch2-chohchch3ch3 ---- the upper written oh and ch3 are substituents at c3 and c2 respectively ---- ---- (CH3)2CH-CH(OH)-CH2-CH3


What is the structure of 2-methylpentan-3-ol?

ch3-ch2-chohchch3ch3 ---- the upper written oh and ch3 are substituents at c3 and c2 respectively ---- ---- (CH3)2CH-CH(OH)-CH2-CH3


What is the iupac name for CH3-CH2-OH?

CH3-CH2-OH is Ethanol Archaically , Ethyl Alcohol, as found in beers, wines and spirits. CH3-CH2-CH2-OH is Propanol ) propyl alcohol).


Explain Why a reaction is exothermic or endothermic because of bond energies?

the reaction is OH ç CH3 CH = CH CH2 CH3 + 2 H2O ® CH3 CH CH CH2 CH3 ç OH


How do you find oxidation number of carbon in CH3-CH2-OH?

The oxidation number of carbon in CH3-CH2-OH can be calculated using the formula: sum of oxidation numbers of all atoms in a neutral compound is zero. In this case, the oxidation number of carbon in CH3-CH2-OH is -2.


What is the IUPAC name of CH3-CHNH2-CH2-OH?

The IUPAC name of CH3-CHNH2-CH2-OH is 2-aminoethanol.


What is the structure for c2h6o?

C2H6O could be 1) Ethanol, CH3CH2OH 2) Dimethyl ether, CH3OCH3


What is the structure for octane?

Ch3-ch2-ch2-ch2-ch2-ch2-ch2-ch3


What is the chemical equation for the reaction that occurs when you add NaOH solution to a CH3CO2-NaCH3CO2 buffer solution?

The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O


What is condensed formula for 2 3 3 4 tetramethylnonane?

The condensed formula for 2,3,3,4-tetramethylnonane is CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH2-CH2-CH3.


What are the different types of organic reaction?

Addition Reactions - involve the conversion of a π bond into 2 new σ bonds General form: A + B → C Eg. CH3-CH=CH-CH3 + HCl → CH3-CH2-CHCl-CH3 Substitution Reactions - involve the no change in bonding - one σ bond replaces another General form: A + B → C + D Eg. CH3-CHBr-CH2-CH3 + KOH(aq) → CH3-CH(OH)-CH2-CH3 + KBr Elimination Reactions - reverse of addition, in that two σ bonds are lost, replaced by a new π bond General form: A → B + C Eg. CH3-CH(OH)-CH2-CH3 -- conc. H2SO4 --> CH3-CH=CH-CH3 + H2O Rearrangement / Isomerisation - process in which a single substance changes structure, A → B. Such a reaction may involve changes in bond / type, though this is not necessary. These reactions are comparatively rare. Eg. CH3-CH2-CH2-C(OH)=CH2 → CH3-CH2-CH2-C(=O)-CH3 These are the four "prototypical" reactions, though several others which can be categorised as one of these are generally referred to by other names. Eg. CH3-CH(OH)-CH3 -- H2SO4 / K2Cr2O7 --> CH3-C(=O)-CH3 could be described as an elimination reaction, but would usually be called an oxidation Eg. CH3-C(=O)-CH3 -- 1. LiAlH4 2. H^+ / H2O --> CH3-CH(OH)-CH3 could be described as a (nucleophilic) addition reaction, but would usually be called a reduction Eg. CH3-C(=O)-OH + CH3-OH -- H2SO4 / Δ / reflux --> CH3-C(=O)-O-CH3 + H2O could be described as a substitution reaction, but would usually be called a condensation Another important category of organic reactions are straight-forward Lowry-Bronsted acid-base reactions: Eg. (CH3-CH2)3N + HCl → (CH3-CH2)3NH^+ + Cl^- Note that there are also some reactions that are difficult to characterise in a simple way, like the following reactions requiring catalysis: stilbene + ethylene → styrene C6H5-CH=CH-C6H5 + CH2=CH2 → 2 C6H5-CH=CH2 but-1-yne + water → butanone CH3-CH2-C≡CH + H2O → CH3-CH2-C(=O)-CH3 (this is actually an addition reaction followed by an isomerisation) CH3-CH2-C(=O)-CH3 + NH2-OH → CH3-CH2-C(=N-OH)-CH3 + H2O the pinacol to pinacolone rearrangement CH3-C(CH3)(OH)-C(CH3)(OH)-CH3 → CH3-C(CH3)2-C(=O)-CH3 which is an elimination reaction that involves an isomerisation ... I add these last few just to illustrate that the general types are a useful tool / guide for understanding organic chemistry, but they are not the be-all and end-all.