0
What else can I help you with?
Which of these gases contribute to global warming?
Main gases contributing to global warming are carbon dioxide, methane, nitrous oxide, chlorofluorocarbons, and water vapor
What are 5 substances found in air?
H2O(Water; particularly vapor), CO2(Carbon dioxide), CH4(Methane), N2O(Nitrous oxide), Particulate Matter, and CFCs(Chlorofluorocarbons)
What is the chemical composition of greenhouse gases?
Greenhouse gases include carbon dioxide (CO2), methane (CH4), nitrous oxide (N2O), fluorinated gases, and water vapor. The primary greenhouse gases are CO2, CH4, and N2O, which contribute significantly to global warming and climate change.
Name 10 polluting gases?
Carbon dioxide (CO2) Methane (CH4) Nitrous oxide (N2O) Sulfur dioxide (SO2) Carbon monoxide (CO) Hydrofluorocarbons (HFCs) Perfluorocarbons (PFCs) Chlorofluorocarbons (CFCs) Nitrogen oxides (NOx) Volatile organic compounds (VOCs)
What is an example of greenhouse gas?
Methane.
Which of these gases contribute to global warming?
Main gases contributing to global warming are carbon dioxide, methane, nitrous oxide, chlorofluorocarbons, and water vapor
Greenhouse gases in Earth's atmosphere include water vapor methane nitrous oxide and what?
carbon dioxide, as well as ozone and chlorofluorocarbons from human activities like burning fossil fuels and deforestation.
What are 5 substances found in air?
H2O(Water; particularly vapor), CO2(Carbon dioxide), CH4(Methane), N2O(Nitrous oxide), Particulate Matter, and CFCs(Chlorofluorocarbons)
What gasses cause global warming?
Methane, carbon dioxide, CFCs (chlorofluorocarbons).
What gases are present in cow manure?
Methane, nitrous oxide and carbon dioxide.
The major greenhouse gases include methane CFCs water vapor and what?
The major greenhouse gases include carbon dioxide, methane, nitrous oxide, and fluorinated gases such as chlorofluorocarbons (CFCs). Water vapor is also a significant greenhouse gas, but its levels in the atmosphere are largely influenced by other environmental factors.
What is the chemical composition of greenhouse gases?
Greenhouse gases include carbon dioxide (CO2), methane (CH4), nitrous oxide (N2O), fluorinated gases, and water vapor. The primary greenhouse gases are CO2, CH4, and N2O, which contribute significantly to global warming and climate change.
Name 10 polluting gases?
Carbon dioxide (CO2) Methane (CH4) Nitrous oxide (N2O) Sulfur dioxide (SO2) Carbon monoxide (CO) Hydrofluorocarbons (HFCs) Perfluorocarbons (PFCs) Chlorofluorocarbons (CFCs) Nitrogen oxides (NOx) Volatile organic compounds (VOCs)
4 gases produced by human activities?
Carbon dioxide (CO2) from burning fossil fuels. Methane (CH4) from livestock digestion and rice cultivation. Nitrous oxide (N2O) from agricultural activities and burning fossil fuels. Chlorofluorocarbons (CFCs) from refrigeration and air conditioning systems.
What are the byproducts of a cow?
Carbon dioxide from exhaling, feces and urine, and methane and nitrous oxide from belching and flatulence.
How many types of green house gas are there?
There are seven main types of greenhouse gases: carbon dioxide (CO2), methane (CH4), nitrous oxide (N2O), fluorinated gases, water vapor, ozone, and chlorofluorocarbons (CFCs). They all contribute to trapping heat in the Earth's atmosphere, leading to global warming and climate change.
Which gases are trace gases?
Trace gases are such because their concentrations are so much smaller than carbon dioxide. The trace gases that appear to be most important are N2O- nitrous oxide (laughing gas), CH4- methane, and CFC- chlorofluorocarbons.
