answersLogoWhite

0

What is mol mass of CH3(CH2)11(OCH2CH2)nOSO3Na

User Avatar

Wiki User

7y ago

What else can I help you with?

Related Questions

What is the mass of hexane?

I assume you mean the molecular mass. Its molecular mass is 86.175


What is the molecular for sucrose?

I assume you mean the molecular mass. Its molecular mass is 342.3g/mol


What is the molecular mass of cytosine?

The molecular mass of cytosine is approximately 111.1 grams per mole.


What is the molecular mass in pentane?

Molecular mass of pentane is 72 u.


what is the molecular mass of water vapour?

The molecular mass of water vapour is 18.01528


What is the gram molecular mass of hydrogen?

The gram molecular mass of hydrogen is 1 gram per mole.


What is the gram molecular mass of a compound if 5 moles of the compound has a mass of 100 grams?

To find the gram molecular mass of the compound, you can use the formula: mass = moles × gram molecular mass. Given that 5 moles of the compound have a mass of 100 grams, you can rearrange the formula to find the gram molecular mass: gram molecular mass = mass / moles. Thus, gram molecular mass = 100 grams / 5 moles = 20 grams per mole.


How can you find the molecular mass of a substance from its mass spectrum?

Obtain the molecular mass by determining the m/z value of the molecular ion peak (rightmost in the spectrum).


What is the molecular mass of sodium chloride?

The molecular mass of sodium chloride is 58,44 (rounded).


What is molecular mass for aldehyde?

The molecular mass of an aldehyde depends on the specific compound. For example, the molecular mass of formaldehyde (CH2O) is 30.03 g/mol, while the molecular mass of acetaldehyde (C2H4O) is 44.05 g/mol. You can calculate the molecular mass by adding up the atomic masses of all the atoms in the compound.


What is the molecular mass of sodium nitrate?

The molecular mass of sodium nitrate is 84,9947.


Molecular mass of sulphuric acid and potassium nitrate?

Molecular mass of sulfuric acid is 98 u. Molecular mass of potassium and nitrate ions are 39 and 62 respectively. The molar mass of potassium nitrate is 101u.