answersLogoWhite

0

What is mol mass of CH3(CH2)11(OCH2CH2)nOSO3Na

User Avatar

Wiki User

7y ago

What else can I help you with?

Related Questions

What is the mass of hexane?

I assume you mean the molecular mass. Its molecular mass is 86.175


What is the molecular for sucrose?

I assume you mean the molecular mass. Its molecular mass is 342.3g/mol


What is the molecular mass of cytosine?

The molecular mass of cytosine is approximately 111.1 grams per mole.


What is the molecular mass in pentane?

Molecular mass of pentane is 72 u.


what is the molecular mass of water vapour?

The molecular mass of water vapour is 18.01528


What is the gram molecular mass of hydrogen?

The gram molecular mass of hydrogen is 1 gram per mole.


How can you find the molecular mass of a substance from its mass spectrum?

Obtain the molecular mass by determining the m/z value of the molecular ion peak (rightmost in the spectrum).


What is the molecular mass of sodium chloride?

The molecular mass of sodium chloride is 58,44 (rounded).


What is molecular mass for aldehyde?

The molecular mass of an aldehyde depends on the specific compound. For example, the molecular mass of formaldehyde (CH2O) is 30.03 g/mol, while the molecular mass of acetaldehyde (C2H4O) is 44.05 g/mol. You can calculate the molecular mass by adding up the atomic masses of all the atoms in the compound.


What is the molecular mass of sodium nitrate?

The molecular mass of sodium nitrate is 84,9947.


Molecular mass of sulphuric acid and potassium nitrate?

Molecular mass of sulfuric acid is 98 u. Molecular mass of potassium and nitrate ions are 39 and 62 respectively. The molar mass of potassium nitrate is 101u.


What is molecular mass?

Molecular mass is the sum of the atomic masses of all the atoms in a molecule. It is usually expressed in atomic mass units (amu) or grams per mole (g/mol). Molecular mass is used to determine the mass of a substance in chemical reactions and stoichiometry calculations.