0
A common formula that includes only carbon (C), hydrogen (H), oxygen (O), and nitrogen (N) atoms is that of the amino acid glycine, which is C₂H₅NO₂. This formula indicates that glycine contains two carbon atoms, five hydrogen atoms, one nitrogen atom, and two oxygen atoms. Such compounds are foundational in biochemistry, especially in the context of proteins and metabolic processes.
What else can I help you with?
How many atoms are presented in Ni(C2H3O2)4?
The chemical formula Ni(C₂H₃O₂)₄ indicates that there is one nickel (Ni) atom, four acetate groups (C₂H₃O₂), which contain a total of 8 carbon (C) atoms, 12 hydrogen (H) atoms, and 8 oxygen (O) atoms. Therefore, the total number of atoms in Ni(C₂H₃O₂)₄ is 1 (Ni) + 8 (C) + 12 (H) + 8 (O) = 29 atoms.
Which macromolecules have only atoms of c h and o?
The macromolecules that are composed primarily of C, H, and O are lipids and carbohydrates.
What is the formula C3h?
C3H is typically used to represent a chemical compound with three carbon atoms and an unknown number of hydrogen atoms. Without additional information, it is not possible to provide a specific formula for C3H.
What is the empirical formula of a molecule containing 24 carbon (C) 6 hydrogen (H) and 70 chlorine (Cl)?
To find the empirical formula, we first determine the simplest whole-number ratio of the elements. The given molecule has 24 carbon atoms, 6 hydrogen atoms, and 70 chlorine atoms. Dividing each by the greatest common divisor, which is 2, we get the ratio of C: 12, H: 3, Cl: 35. Therefore, the empirical formula is C₁₂H₃Cl₃₅.
Draw the complete Lewis structure of aspirin?
Aspirin has the chemical formula C9H8O4. The Lewis structure of aspirin would involve drawing the skeletal structure of 9 carbon atoms, 8 hydrogen atoms, and 4 oxygen atoms connected by single and double bonds to satisfy the octet rule for each atom in the molecule. The central part of the structure consists of a benzene ring attached to a carboxyl group (–COOH).
What is the structural formula of decene?
H h h h h h h h h h h-c c c c c c c c c c-hh h h h h h h h h h
Draw the structural formula for acetylene?
This browser does not support the simplest graphics so drawing a formula is out of the question, but, the formula is of the formH-(1)-C-(3)-C-(1)-H that is, a hydrogen atom single bonded to a carbon atom triple bonded to another carbon atom single bonded to hydrogen a atom.
How many atoms are presented in Ni(C2H3O2)4?
The chemical formula Ni(C₂H₃O₂)₄ indicates that there is one nickel (Ni) atom, four acetate groups (C₂H₃O₂), which contain a total of 8 carbon (C) atoms, 12 hydrogen (H) atoms, and 8 oxygen (O) atoms. Therefore, the total number of atoms in Ni(C₂H₃O₂)₄ is 1 (Ni) + 8 (C) + 12 (H) + 8 (O) = 29 atoms.
What is the molecular formula for butane C4H10-?
Butane is a hydrocarbon with four carbon atoms in a row bonded to each other. Coming off of each carbon atom are enough hydrogen atoms so that each carbon makes a total of 4 bonds: H H H H H - C - C - C - C - H H H H H The structure of Butane can also be written as: CH3-CH2-CH2-CH3. The molecular formula of Butane is C4H10. It's an organic compound that is a gas at room temperature, and is highly flammable, colorless, easily liquefied.
What is the difference between a simple and structural formula?
Complete Structural FormulaH H H H| | | |H-C-C-C-C-H| | | |H H H HCondensed Structural FormulaCH3CH2CH2CH3orCH3(CH2)2CH3
What is the structural formula for the compound butane?
i think its C6H6i just googled benzene and that was the first linkthe strucure of benzene with carbon showing sp2 hybirdization of orbitals with pi electron cloud on aboove and below the plane , it is C6H6
What is the structure formula of 1 octanol?
C8H18O that is the formula. H-c-c-c-c-c-c-c-c-h ( Basic structure before the addition of the other H atoms and the OH) to each Carbon atom there is two H atoms attached to it on top and on the bottom, therefore each C atom makes 4 bonds. The last carbon on the right will have a OH rather then just a H atom on top. If done properly there should be seven H atoms on the top of the basic structure i gave bonded to the C atoms with the one OH on the last C atom on the right. On the bottom there should be eight H atoms bonded with the C atoms.
What is the chemical formula for isobutane?
They are both C4H10 but isobutane has another structure, called Isomer Butane: Isobutane: H H H H H H H H-C-C-C-C-H H-C-C-C-H H H H H HHCHH H Isobutane comes in Y shape not in series as n-butane. In refineries, they transform n-butane to iso-buatene. So, they can use it in alkaline units to produce gasoline
Which macromolecules have only atoms of c h and o?
The macromolecules that are composed primarily of C, H, and O are lipids and carbohydrates.
What is the difference between a molecular and a structural formula?
A chemical formula that shows how atoms are arranged within a molecule or polyatomic ion and a molecular formula shows the number of the atoms that makes up the molecule.A molecular formula indicates the numbers and types of elements in one molecule of a substance. A structural formula indicates how the atoms are bonded to one another. Some examples include:water: H2O, H-O-Hcarbon dioxide: CO2, O=C=Ooxygen: O2, O=OIn a structural formula, each line represents a single covalent bond (one pair of shared electrons) between the atoms, and a double line represents a double covalent bond (two pairs of shared electrons) between the atoms.
Give the formula and name of the alkane which contains four carbon atoms in each molecule?
The formula for an alkane with four carbon atoms is C₄H₁₀. This alkane is named butane.
How many hydrogen atoms are there in an alkane molecule with 10 carbon atoms?
Formula for alkanes:Number of H = 2 * number of C + 2So, using this formula, H = 2 * 10 + 2, which gives 22
