answersLogoWhite

0

a complex ion: [Ni(NH3)6]

User Avatar

Wiki User

12y ago

What else can I help you with?

Related Questions

What is the color of the product Ni(NH3)62?

The color of Ni(NH3)6^2+ is violet.


Ammonia reacts with nickel sulfate to form what?

Ammonia reacts with nickel sulfate to form nickel(II) hydroxide, which is a pale green precipitate. This reaction is a double displacement reaction where the ammonia displaces the sulfate ion to form the precipitate.


What gas is made when nickel reacts with dilute sulphuric acid?

Nickel forms Hydrogen gas when reacts with dilute acid.


What is the equation of nickel nitrate and ammonia?

The reaction between nickel nitrate [Ni(NO3)2] and ammonia (NH3) can form a complex compound known as hexaamminenickel(II) nitrate, which has the formula Ni(NH3)62. This compound consists of a nickel ion coordinated with six ammonia molecules in an octahedral geometry.


What is the balanced equation for Na plus NaNO3?

This reaction is known as the double exchange reaction Ni(NO3)2(aq) + 2 NaOH(aq) --> Ni(OH)2(s) + 2 NaNO3(aq) (aq) means in aqueous solution (s) means solid, hence nickel hydroxide is seen precipitating out of the solution


What is Ni plus mgcl2?

No reaction


Why is the molecule of Ni3 is more unstable than NH3?

A molecule Ni3 doesn't exist; you think probable to a compound of Ni(III).


What solution will correctly complete and balance this equation NiCl2 plus 2Na?

2NaCl + Ni (for A+)


What is the product of Al plus NiCl2?

Ni + AlCl3


When this equation is balanced what is the coefficient for ni(no3)3. ni(no3)3 plus pbbr4 -- and gt nibr3 plus pb(no3)4?

Your formulas are not correct.


What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?

NI(NO3)3+pbbr4nibr3+pb(no3)4


Nickel reacts with lead nitrate to produce nickel nitrate and lead unbalanced equation?

The unbalanced equation for the reaction is: Ni + Pb(NO3)2 -> Ni(NO3)2 + Pb