0
What else can I help you with?
If a reaction occurs what will be the products of the unbalanced reaction below Cu(s) plus Ni(NO3) 2(aq)?
When copper (Cu) reacts with nickel(II) nitrate (Ni(NO3)2), a single displacement reaction occurs. Copper displaces nickel from nickel(II) nitrate, resulting in the formation of nickel (Ni) and copper(II) nitrate (Cu(NO3)2). The balanced products of the reaction are Ni(s) and Cu(NO3)2(aq).
What is the chemical symbol for nickelII?
Nickel(II) is the plus two (+2) oxidation state of nickel (Ni), and we write it Ni(II) or Ni++ when we set it down.
What are the coefficients that would correctly balance the reaction below NI plus C4H8N2O2 ----- and gt Ni(C4H8N202)2?
To balance the reaction Ni + C₄H₈N₂O₂ → Ni(C₄H₈N₂O₂)₂, the coefficients would be 1 for Ni and 2 for C₄H₈N₂O₂. This results in the balanced equation: 1 Ni + 2 C₄H₈N₂O₂ → 1 Ni(C₄H₈N₂O₂)₂.
What is Na2O plus CuCl2?
NiCl2 + 2Na --> 2NaCl + Ni
Fe plus Ni(OH)2-- and gt Ni plus Fe(OH)3 What if your answer?
The reaction Fe + Ni(OH)₂ → Ni + Fe(OH)₃ is an example of a redox reaction where iron (Fe) is oxidized, and nickel hydroxide (Ni(OH)₂) is reduced. In this process, iron donates electrons, leading to the formation of iron(III) hydroxide (Fe(OH)₃), while nickel is reduced to its elemental form. This indicates that iron has a higher tendency to oxidize compared to nickel in this context. Overall, the reaction showcases the principles of electron transfer and the relative reactivity of the metals involved.
What is the color of the product Ni(NH3)62?
The color of Ni(NH3)6^2+ is violet.
Ammonia reacts with nickel sulfate to form what?
Ammonia reacts with nickel sulfate to form nickel(II) hydroxide, which is a pale green precipitate. This reaction is a double displacement reaction where the ammonia displaces the sulfate ion to form the precipitate.
What gas is made when nickel reacts with dilute sulphuric acid?
Nickel forms Hydrogen gas when reacts with dilute acid.
What is the equation of nickel nitrate and ammonia?
The reaction between nickel nitrate [Ni(NO3)2] and ammonia (NH3) can form a complex compound known as hexaamminenickel(II) nitrate, which has the formula Ni(NH3)62. This compound consists of a nickel ion coordinated with six ammonia molecules in an octahedral geometry.
What is the balanced equation for Na plus NaNO3?
This reaction is known as the double exchange reaction Ni(NO3)2(aq) + 2 NaOH(aq) --> Ni(OH)2(s) + 2 NaNO3(aq) (aq) means in aqueous solution (s) means solid, hence nickel hydroxide is seen precipitating out of the solution
What is Ni plus mgcl2?
No reaction
Why is the molecule of Ni3 is more unstable than NH3?
A molecule Ni3 doesn't exist; you think probable to a compound of Ni(III).
If a reaction occurs what will be the products of the unbalanced reaction below Cu(s) plus Ni(NO3) 2(aq)?
When copper (Cu) reacts with nickel(II) nitrate (Ni(NO3)2), a single displacement reaction occurs. Copper displaces nickel from nickel(II) nitrate, resulting in the formation of nickel (Ni) and copper(II) nitrate (Cu(NO3)2). The balanced products of the reaction are Ni(s) and Cu(NO3)2(aq).
What solution will correctly complete and balance this equation NiCl2 plus 2Na?
2NaCl + Ni (for A+)
What is the product of Al plus NiCl2?
Ni + AlCl3
When this equation is balanced what is the coefficient for ni(no3)3. ni(no3)3 plus pbbr4 -- and gt nibr3 plus pb(no3)4?
Your formulas are not correct.
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
